initial file commit

config/AE2Stuff/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

config/AE2WirelessTerminals.cfg

@@ -0,0 +1,50 @@
+# Configuration file
+
+"client configs" {
+    # If enabled, colored light support will be enabled [default: true]
+    B:EnableColoredLightSupport=true
+
+    # Wireless Terminal will show a warning when Infinty Energy drops below this point and infinite range is active [range: 10 ~ 1000000, default: 5000]
+    I:InfinityEnergyWarningAmount=5000
+
+    # Will shift-clicking a bauble try to put said bauble in a bauble slot before trying to store in system [default: true]
+    B:ShiftClickBaubles=true
+}
+
+
+general {
+    # Should Infinity Booster Card Recipe be disabled? [default: false]
+    B:DisableBoosterRecipe=false
+
+    # Should Dragons drop Infinity Booster Card? [default: true]
+    B:DragonDropsBooster=false
+
+    # Enable Infinity Booster Card [default: true]
+    B:EnableBooster=true
+
+    # If true, AE2 controller will chunk load itself [default: false]
+    B:EnableControllerChunkLoading=false
+
+    # Percentage chance that booster card will drop upon killing an Enderman. (between 1 and 100) [range: 1 ~ 100, default: 5]
+    I:EndermanBoosterDropChance=5
+
+    # Will Enderman randomly drop infinity booster cards on death? [default: true]
+    B:EndermanDropBoosters=false
+
+    # Amount of Infinity Energy Consumed every 10 ticks when not in range of a WAP [range: 5 ~ 100, default: 15]
+    I:InfinityEnergyDrainAmount=15
+
+    # Amount of Infinity Energy 1 Infinity Booster Card will convert to [range: 5 ~ 1000, default: 100]
+    I:InfinityEnergyPerBooster=100
+
+    # If true, then simply inserting 1 Infinity Booster Card into the slot, will give limitless infinite range. [default: false]
+    B:UseOldInfinityMechanic=true
+
+    # Percentage chance that booster card will drop upon killing a wither. (between 1 and 100) [range: 1 ~ 100, default: 30]
+    I:WitherBoosterDropChance=30
+
+    # Should Withers drop Infinity Booster Card? [default: true]
+    B:WitherDropsBooster=false
+}
+
+

config/AppliedEnergistics2/AppliedEnergistics2.cfg

@@ -0,0 +1,459 @@
+# Configuration file
+
+automation {
+    I:formationPlaneEntityLimit=128
+}
+
+
+battery {
+    I:chargedStaff=8000
+    I:colorApplicator=20000
+    I:entropyManipulator=200000
+    I:matterCannon=200000
+    I:portableCell=20000
+    I:wirelessTerminal=1600000
+}
+
+
+client {
+    # Possible Values: AE, EU, RF, GTCEU
+    S:PowerUnit=AE
+
+    # Possible Values: AUTOSEARCH, AUTOSEARCH_KEEP, MANUAL_SEARCH, MANUAL_SEARCH_KEEP, JEI_AUTOSEARCH, JEI_AUTOSEARCH_KEEP, JEI_MANUAL_SEARCH, JEI_MANUAL_SEARCH_KEEP
+    S:SEARCH_MODE=AUTOSEARCH
+
+    # Possible Values: YES, NO, UNDECIDED
+    S:SEARCH_TOOLTIPS=YES
+
+    # Possible Values: TALL, FULL, SMALL
+    S:TERMINAL_STYLE=TALL
+
+    # Controls buttons on Crafting Screen : Capped at 9
+    I:craftAmtButton1=1
+
+    # Controls buttons on Crafting Screen : Capped at 99
+    I:craftAmtButton2=10
+
+    # Controls buttons on Crafting Screen : Capped at 999
+    I:craftAmtButton3=100
+
+    # Controls buttons on Crafting Screen : Capped at 9999
+    I:craftAmtButton4=1000
+    B:disableColoredCableRecipesInJEI=true
+    B:enableEffects=true
+
+    # Controls buttons on Level Emitter Screen : Capped at 9
+    I:levelAmtButton1=1
+
+    # Controls buttons on Level Emitter Screen : Capped at 99
+    I:levelAmtButton2=10
+
+    # Controls buttons on Level Emitter Screen : Capped at 999
+    I:levelAmtButton3=100
+
+    # Controls buttons on Level Emitter Screen : Capped at 9999
+    I:levelAmtButton4=1000
+
+    # Controls buttons on Priority Screen : Capped at 9
+    I:priorityAmtButton1=1
+
+    # Controls buttons on Priority Screen : Capped at 99
+    I:priorityAmtButton2=10
+
+    # Controls buttons on Priority Screen : Capped at 999
+    I:priorityAmtButton3=100
+
+    # Controls buttons on Priority Screen : Capped at 9999
+    I:priorityAmtButton4=1000
+    B:useColoredCraftingStatus=true
+    B:useTerminalUseLargeFont=false
+}
+
+
+condenser {
+    I:MatterBalls=256
+    I:Singularity=256000
+}
+
+
+craftingcpu {
+    I:craftingCalculationTimePerTick=5
+}
+
+
+##########################################################################################################
+# features
+#--------------------------------------------------------------------------------------------------------#
+# Warning: Disabling a feature may disable other features depending on it.
+##########################################################################################################
+
+features {
+
+    world {
+        B:CertusOre=false
+        B:CertusQuartzWorldGen=false
+        B:ChargedCertusOre=false
+        B:ChestLoot=true
+
+        # Blocks that are not used in any essential recipes, also slabs and stairs.
+        B:DecorativeBlocks=true
+        B:DecorativeLights=true
+        B:Flour=false
+        B:MeteoriteWorldGen=true
+        B:SkyStoneChests=true
+        B:SpawnPressesInMeteorites=true
+        B:TinyTNT=true
+        B:VillagerTrading=true
+    }
+
+    machines {
+        B:Charger=true
+        B:CrystalGrowthAccelerator=false
+        B:GrindStone=false
+        B:Inscriber=true
+        B:VibrationChamber=false
+    }
+
+    toolsclassifications {
+        B:CertusQuartzTools=true
+        B:NetherQuartzTools=true
+        B:PoweredTools=true
+    }
+
+    tools {
+        B:ChargedStaff=false
+        B:ColorApplicator=false
+        B:EntropyManipulator=false
+        B:MatterCannon=false
+        B:MeteoriteCompass=true
+        B:PaintBalls=false
+        B:QuartzAxe=false
+        B:QuartzHoe=false
+        B:QuartzKnife=false
+        B:QuartzPickaxe=false
+        B:QuartzSpade=false
+        B:QuartzSword=false
+        B:QuartzWrench=false
+        B:WirelessAccessTerminal=true
+    }
+
+    networkfeatures {
+        B:Channels=false
+        B:QuantumNetworkBridge=true
+        B:Security=true
+        B:SpatialIO=true
+    }
+
+    networkbuses {
+        B:AnnihilationPlane=true
+        B:CableAnchor=true
+        B:CraftingTerminal=true
+        B:ExportBus=true
+        B:FluidAnnihilationPlane=true
+        B:FluidExportBus=true
+        B:FluidFormationPlane=true
+        B:FluidImportBus=true
+        B:FluidInterface=true
+        B:FluidLevelEmitter=true
+        B:FluidStorageBus=true
+        B:FluidTerminal=true
+        B:FormationPlane=true
+        B:IdentityAnnihilationPlane=true
+        B:ImportBus=true
+        B:Interface=true
+        B:LevelEmitter=true
+        B:P2PTunnel=true
+        B:Panels=true
+        B:PartConversionMonitor=true
+        B:QuartzFiber=true
+        B:StorageBus=true
+        B:StorageMonitor=true
+        B:Terminal=true
+        B:ToggleBus=true
+    }
+
+    portablecell {
+        B:PortableCell=true
+    }
+
+    storage {
+        B:Condenser=true
+        B:IOPort=true
+        B:MEChest=true
+        B:MEDrive=true
+        B:StorageCells=true
+    }
+
+    networktool {
+        B:MemoryCard=true
+        B:NetworkTool=true
+    }
+
+    cables {
+        B:CoveredCables=true
+        B:DenseCables=true
+        B:GlassCables=true
+        B:SmartCables=true
+    }
+
+    energy {
+        B:DenseEnergyCells=true
+        B:EnergyAcceptor=true
+        B:EnergyCells=true
+    }
+
+    p2ptunnels {
+        B:P2PTunnelEU=true
+        B:P2PTunnelFE=true
+        B:P2PTunnelFluids=true
+        B:P2PTunnelGTCEU=true
+        B:P2PTunnelItems=true
+        B:P2PTunnelLight=true
+        B:P2PTunnelME=true
+        B:P2PTunnelOpenComputers=true
+        B:P2PTunnelPressure=true
+        B:P2PTunnelRedstone=true
+    }
+
+    blockfeatures {
+        B:MassCannonBlockDamage=true
+        B:TinyTNTBlockDamage=true
+    }
+
+    facades {
+        B:Facades=true
+    }
+
+    misc {
+        B:Achievements=false
+        B:CraftingLog=false
+        B:Creative=true
+        B:DebugLogging=false
+        B:GrinderLogging=false
+        B:IntegrationLogging=false
+        B:LightDetector=true
+        B:LogSecurityAudits=false
+        B:Logging=true
+        B:PacketLogging=false
+        B:UnsupportedDeveloperTools=false
+        B:UpdateLogging=false
+        B:WebsiteRecipes=false
+    }
+
+    crafting {
+        B:EnableDisassemblyCrafting=true
+        B:EnableFacadeCrafting=true
+        B:InWorldFluix=true
+        B:InWorldPurification=true
+        B:InWorldSingularity=true
+        B:InterfaceTerminal=true
+    }
+
+    rendering {
+        B:AlphaPass=true
+    }
+
+    craftingfeatures {
+        B:CraftingCPU=true
+
+        # Use CraftingManager to find an alternative recipe, after a pattern rejected an ingredient. Should be enabled to avoid issues, but can have a minor performance impact.
+        B:CraftingManagerFallback=true
+        B:MolecularAssembler=true
+        B:Patterns=true
+    }
+
+    upgrades {
+        B:AdvancedCards=true
+        B:BasicCards=true
+        B:ViewCell=true
+    }
+
+    materials {
+        B:Certus=true
+        B:CrystalSeeds=true
+        B:Dusts=true
+        B:Fluix=true
+        B:Nuggets=true
+        B:PureCrystals=true
+        B:QuartzGlass=true
+        B:Silicon=true
+        B:SkyStone=true
+    }
+
+    craftingcomponents {
+        B:Cores=true
+        B:MatterBall=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+    }
+
+    commands {
+        B:ChunkLoggerTrace=false
+    }
+
+}
+
+
+general {
+    # Will auto-remove items that crash when being loaded from storage. This will destroy those items instead of crashing the game!
+    B:removeCrashingItemsOnLoad=false
+}
+
+
+##########################################################################################################
+# grindstone
+#--------------------------------------------------------------------------------------------------------#
+# Creates recipe of the following pattern automatically: '1 oreTYPE => 2 dustTYPE' and '(1 ingotTYPE or 1 crystalTYPE or 1 gemTYPE) => 1 dustTYPE'
+##########################################################################################################
+
+grindstone {
+    # Blacklists the exact oredict name from being handled by any recipe.
+    S:blacklist <
+     >
+
+    # The list of types to handle. Specify without a prefix like ore or dust.
+    S:grinderOres <
+        Obsidian
+        Ender
+        EnderPearl
+        Coal
+        Iron
+        Gold
+        Charcoal
+        NetherQuartz
+        CertusQuartz
+        Wheat
+        Fluix
+        Copper
+        Tin
+        Silver
+        Lead
+        Bronze
+        Brass
+        Platinum
+        Nickel
+        Invar
+        Aluminium
+        Electrum
+        Osmium
+        Zinc
+     >
+
+    # Chance to actually get an output with stacksize > 1.
+    D:oreDoublePercentage=90.0
+}
+
+
+##########################################################################################################
+# modintegration
+#--------------------------------------------------------------------------------------------------------#
+# Valid Values are 'AUTO', 'ON', or 'OFF' - defaults to 'AUTO' ; Suggested that you leave this alone unless your experiencing an issue, or wish to disable the integration for a reason.
+##########################################################################################################
+
+modintegration {
+    S:CraftTweaker=AUTO
+    S:GregTech=AUTO
+    S:IndustrialCraft2=AUTO
+    S:InventoryTweaks=AUTO
+    S:JustEnoughItems=AUTO
+    S:Mekanism=AUTO
+    S:MineFactoryReloaded=AUTO
+    S:OpenComputers=AUTO
+    S:Railcraft=AUTO
+    S:Tesla=AUTO
+    S:TheOneProbe=AUTO
+    S:Waila=AUTO
+}
+
+
+powerratios {
+    D:ForgeEnergy=0.5
+    D:GTCEU=2.0
+    D:IC2=2.0
+    D:UsageMultiplier=1.0
+}
+
+
+spatialio {
+    D:spatialPowerExponent=1.35
+    D:spatialPowerMultiplier=1250.0
+    I:storageDimensionID=2
+    I:storageProviderID=-11
+}
+
+
+##########################################################################################################
+# tickrates
+#--------------------------------------------------------------------------------------------------------#
+#  Min / Max Tickrates for dynamic ticking, most of these components also use sleeping, to prevent constant ticking, adjust with care, non standard rates are not supported or tested.
+##########################################################################################################
+
+tickrates {
+    I:AnnihilationPlane.max=120
+    I:AnnihilationPlane.min=2
+    I:Charger.max=120
+    I:Charger.min=10
+    I:ExportBus.max=60
+    I:ExportBus.min=5
+    I:FluidExportBus.max=60
+    I:FluidExportBus.min=5
+    I:FluidImportBus.max=40
+    I:FluidImportBus.min=5
+    I:FluidStorageBus.max=60
+    I:FluidStorageBus.min=5
+    I:IOPort.max=5
+    I:IOPort.min=1
+    I:ImportBus.max=40
+    I:ImportBus.min=5
+    I:Inscriber.max=1
+    I:Inscriber.min=1
+    I:Interface.max=120
+    I:Interface.min=5
+    I:ItemTunnel.max=60
+    I:ItemTunnel.min=5
+    I:LightTunnel.max=60
+    I:LightTunnel.min=5
+    I:METunnel.max=20
+    I:METunnel.min=5
+    I:OpenComputersTunnel.max=5
+    I:OpenComputersTunnel.min=1
+    I:PressureTunnel.max=120
+    I:PressureTunnel.min=1
+    I:StorageBus.max=60
+    I:StorageBus.min=5
+    I:VibrationChamber.max=40
+    I:VibrationChamber.min=10
+}
+
+
+##########################################################################################################
+# wireless
+#--------------------------------------------------------------------------------------------------------#
+# Range= wirelessBaseRange + wirelessBoosterRangeMultiplier * Math.pow( boosters, wirelessBoosterExp )
+# PowerDrain= wirelessBaseCost + wirelessCostMultiplier * Math.pow( boosters, 1 + boosters / wirelessHighWirelessCount )
+##########################################################################################################
+
+wireless {
+    D:wirelessBaseCost=8.0
+    D:wirelessBaseRange=16.0
+    D:wirelessBoosterExp=1.5
+    D:wirelessBoosterRangeMultiplier=1.0
+    D:wirelessCostMultiplier=1.0
+    D:wirelessTerminalDrainMultiplier=1.0
+}
+
+
+worldgen {
+    D:meteoriteClusterChance=0.1
+    I:meteoriteDimensionWhitelist <
+        0
+     >
+    I:meteoriteMaximumSpawnHeight=180
+    I:minMeteoriteDistance=707
+    I:quartzOresClusterAmount=15
+    I:quartzOresPerCluster=4
+    D:spawnChargedChance=0.07999998331069946
+}
+
+

config/AppliedEnergistics2/CustomRecipes.cfg

@@ -0,0 +1,22 @@
+# Configuration file
+
+cache {
+    S:digest=0f589f496221d7874de0a6fff541b733
+
+    # Caching can save processing time, if there are a lot of items. [default: true]
+    B:enableCache=true
+}
+
+
+general {
+    # Will output more detailed information into the CSV like corresponding items [default: false]
+    B:enableAdditionalInfo=false
+
+    # If true, the CSV exporting will always happen. This will not use the cache to reduce the computation. [default: false]
+    B:enableForceRefresh=false
+
+    # If true, all registered items will be exported containing the internal minecraft name and the localized name to actually find the item you are using. This also contains the item representation of the blocks, but are missing items, which are too much to display e.g. FMP. [default: true]
+    B:exportItemNames=true
+}
+
+

config/AppliedEnergistics2/Facades.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+##########################################################################################################
+# common
+#--------------------------------------------------------------------------------------------------------#
+# Settings applied to all facades.
+# 
+# By default full blocks with no tile entity and a model do not need whitelisting.
+# This will only be read once during client startup.
+##########################################################################################################
+
+common {
+    # Unsupported: Allows whitelisting TileEntity as facades. Could work, have render issues, or corrupt your world. USE AT YOUR OWN RISK.
+    B:allowTileEntityFacades=false
+}
+
+
+##########################################################################################################
+# facades
+#--------------------------------------------------------------------------------------------------------#
+# A way to explicitly handle certain blocks as facades.
+# 
+# Blocks can be added by their resource location under the following rules.
+#  - One category per domain like minecraft or appliedenergistics2
+#  - One key per id. E.g. glass in case of minecraft:glass
+#  - An integer value ranging from 0 to 16 representing the metadata 0-15 and 16 as wildcard for all - Multiple entries for the same id but different metadata are possible when needed
+##########################################################################################################
+
+facades {
+
+    minecraft {
+        I:glass=16
+        I:stained_glass=16
+    }
+
+    appliedenergistics2 {
+        I:quartz_glass=16
+        I:quartz_vibrant_glass=16
+    }
+
+}
+
+

config/AppliedEnergistics2/VersionChecker.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+cache {
+    # Waits as many hours, until it checks again. [range: 0 ~ 168, default: 24]
+    I:interval=24
+    S:lastCheck=1642937155568
+}
+
+
+channel {
+    # Determines the channel level which should be checked for updates. Can be either Stable, Beta or Alpha. [default: Beta]
+    S:level=Beta
+}
+
+
+client {
+    # If true, the player is getting a notification including changelog. Only happens if notification are enabled. [default: true]
+    B:changelog=true
+
+    # If true, the player is getting a notification, that a new version is available. [default: true]
+    B:notify=true
+}
+
+
+general {
+    # If true, the version checker is enabled. Acts as a master switch. [default: true]
+    B:enabled=true
+}
+
+

config/AppliedEnergistics2/extracells.cfg

@@ -0,0 +1,50 @@
+# Configuration file
+
+integration {
+    # Enable BuildCraftFuel Integration.
+    B:"enableBuildCraftAPI|fuels"=true
+
+    # Enable BuildCraft Wrench Integration.
+    B:"enableBuildCraftAPI|tools"=true
+
+    # Enable MekanismGas Integration.
+    B:"enableMekanismAPI|gas"=true
+
+    # Enable COFH Hammer Integration.
+    B:"enablecofhapi|item"=true
+
+    # Enable IngameWikiMod Integration.
+    B:enableigwmod=true
+
+    # Enable Just Enough Items Integration.
+    B:enablejei=true
+
+    # Enable mekanism Integration.
+    B:enablemekanism=true
+
+    # Enable opencomputers Integration.
+    B:enableopencomputers=true
+
+    # Enable Thaumatic Energistics Integration.
+    B:enablethaumicenergistics=true
+
+    # Enable waila Integration.
+    B:enablewaila=true
+
+    # Enable AE2 Wireless Crafting Terminal Integration.
+    B:enablewct=true
+}
+
+
+"storage cells" {
+    # Should the mount of bytes needed for a new type depend on the cellsize?
+    B:dynamicTypes=true
+}
+
+
+tooltips {
+    # Shall the guis shorten large mB values?
+    B:shortenedBuckets=true
+}
+
+

config/Building Gadgets.cfg

@@ -0,0 +1,207 @@
+# Configuration file
+
+general {
+    # Disable absolute coords-mode for the Copy-Paste gadget
+    B:"Allow absolute Coord-Mode"=true
+
+    # Whether the Building / CopyPaste Gadget can overwrite blocks like water, lava, grass, etc (like a player can).
+    # False will only allow it to overwrite air blocks.
+    B:"Allow non-Air-Block-Overwrite"=true
+
+    # The maximum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Max"=3
+
+    # The minimum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Min"=1
+
+    # Determines if the Copy/Paste GUI's coordinate mode starts in 'Absolute' mode by default.
+    # Set to true for Absolute, set to False for Relative.
+    B:"Default to absolute Coord-Mode"=false
+
+    # Set to false to disable the recipe for construction paste.
+    B:"Enable Construction Paste"=true
+
+    # Set to false to disable the Destruction Gadget.
+    B:"Enable Destruction Gadget"=true
+
+    # Defines how far away you can build
+    # Min: 1.0
+    # Max: 48.0
+    D:"Max Build Distance"=32.0
+
+    # Set to true for Forge Energy Support, set to False for vanilla Item Damage
+    B:"Powered by Forge Energy"=true
+
+    ##########################################################################################################
+    # blacklist settings
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure your Blacklist-Settings here
+    ##########################################################################################################
+
+    "blacklist settings" {
+        # All Blocks added to this will be treated similar to TileEntities. Not at all.
+        # Notice that you can use Regular Expressions as defined by Java Patterns to express more complex name combinations.
+        # Use for example "awfulmod:.*" to blacklist all awfulmod Blocks.
+        S:"Blacklisted Blocks" <
+            minecraft:.*_door.*
+            minecraft:piston_head
+            minecraft:reeds
+            *:*torch*
+            *:*flower*
+         >
+    }
+
+    ##########################################################################################################
+    # gadgets
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Gadgets here
+    ##########################################################################################################
+
+    gadgets {
+        # The max energy of Building, Exchanging & Copy-Paste Gadget
+        # Min: 0
+        # Max: 2147483647
+        I:"Maximum Energy"=500000
+
+        # The max range of the Gadgets
+        # Min: 1
+        # Max: 25
+        I:"Maximum allowed Range"=15
+
+        ##########################################################################################################
+        # building gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Building Gadget
+        ##########################################################################################################
+
+        "building gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+        ##########################################################################################################
+        # exchanging gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Exchanging Gadget
+        ##########################################################################################################
+
+        "exchanging gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=2
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=100
+        }
+
+        ##########################################################################################################
+        # destruction gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost, Durability & Maximum Energy of the Destruction Gadget
+        ##########################################################################################################
+
+        "destruction gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=4
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=200
+
+            # The max energy of the Destruction Gadget
+            # Min: 0
+            # Max: 2147483647
+            I:"Maximum Energy"=1000000
+
+            # If enabled, the Destruction Gadget can be taken out of fuzzy mode, allowing only instances of the block clicked to be removed (at a higher cost)
+            B:"Non-Fuzzy Mode Enabled"=false
+
+            # The cost in energy/durability will increase by this amount when not in fuzzy mode
+            # Min: 0.0
+            # Max: 1.7976931348623157E308
+            D:"Non-Fuzzy Mode Multiplier"=2.0
+        }
+
+        ##########################################################################################################
+        # copy-paste gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Copy-Paste Gadget
+        ##########################################################################################################
+
+        "copy-paste gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+    }
+
+    ##########################################################################################################
+    # paste containers
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Paste Containers here
+    ##########################################################################################################
+
+    "paste containers" {
+        # The maximum capacity of a tier 1 (iron) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T1 Container Capacity"=512
+
+        # The maximum capacity of a tier 2 (gold) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T2 Container Capacity"=2048
+
+        # The maximum capacity of a tier 3 (diamond) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T3 Container Capacity"=8192
+    }
+
+}
+
+

config/CustomMainMenu/mainmenu.json

@@ -0,0 +1,141 @@
+{
+  "images": {
+    "title": {
+      "image": "minecraft:textures/gui/title/top.png",
+      "posX": -150,
+      "posY": 4,
+      "width": 300,
+      "height": 77,
+      "alignment": "top_center"
+    }
+  },
+  "buttons": {
+    "singleplayer": {
+      "text": "menu.singleplayer",
+      "posX": 4,
+      "posY": -46,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openGui",
+        "gui": "singleplayer"
+      }
+    },
+    "multiplayer": {
+      "text": "menu.multiplayer",
+      "posX": 125,
+      "posY": -46,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openGui",
+        "gui": "multiplayer"
+      }
+    },
+    "mods": {
+      "text": "fml.menu.mods",
+      "posX": 4,
+      "posY": -22,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openGui",
+        "gui": "mods"
+      }
+    },
+    "options": {
+      "text": "menu.options",
+      "posX": 125,
+      "posY": -22,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openGui",
+        "gui": "options"
+      }
+    },
+    "quit": {
+      "text": "menu.quit",
+      "posX": 4,
+      "posY": 74,
+      "width": 240,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "quit"
+      }
+    },
+    "update": {
+      "text": "Update Notes",
+      "posX": 125,
+      "posY": 26,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openLink",
+        "link": "https://github.com/Nomifactory/Nomifactory/blob/dev/UPDATENOTES.md"
+      }
+    },
+    "discord": {
+      "text": "Join Us On Discord!",
+      "posX": 4,
+      "posY": 26,
+      "width": 120,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openLink",
+        "link": "https://discord.gg/zwQzqP8b6q"
+      }
+    },
+    "akliz": {
+      "text": "Rent Your Own Nomifactory Server!",
+      "posX": 4,
+      "posY": 50,
+      "width": 240,
+      "height": 20,
+      "alignment": "left_center",
+      "action": {
+        "type": "openLink",
+        "link": "https://www.akliz.net/nomifactory"
+      }
+    }
+  },
+  "labels": {
+    "mojang": {
+      "text": "Copyright Mojang AB. Do not distribute!",
+      "posX": -197,
+      "posY": -10,
+      "color": -1,
+      "alignment": "bottom_right"
+    }
+  },
+  "other": {
+    "background": {
+      "image": "",
+      "slideshow": {
+        "displayDuration": 100,
+        "fadeDuration": 40,
+        "images": [
+          "minecraft:textures/gui/title/background/01_koslow#5221_2020-07-13_18.29.23.jpg",
+          "minecraft:textures/gui/title/background/02_zefenglin#4068_unknown.jpg",
+          "minecraft:textures/gui/title/background/03_koslow#5221_2020-07-15_12.47.13.jpg",
+          "minecraft:textures/gui/title/background/04_twgecko#4094_2020-07-23_23.52.42.jpg",
+          "minecraft:textures/gui/title/background/05_misterpemodder#0404_2020-04-16_00.02.35.jpg",
+          "minecraft:textures/gui/title/background/07_sjihttam#1781_2020-01-16_13.41.00.jpg",
+          "minecraft:textures/gui/title/background/06_koslow#5221_2020-07-22_15.51.02.jpg",
+          "minecraft:textures/gui/title/background/08_immow#9906_unknown.jpg",
+          "minecraft:textures/gui/title/background/10_twgecko#4094_2020-07-28_01.02.15.jpg",
+          "minecraft:textures/gui/title/background/09_max the potato#6258_2020-07-14_18.16.47.jpg",
+          "minecraft:textures/gui/title/background/11_thatguy#6588_2020-02-11_23.31.02.jpg",
+          "minecraft:textures/gui/title/background/12_misterpemodder#0404_2020-07-14_00.47.49.jpg"
+        ]
+      }
+    }
+  }
+}

config/DimensionalEdibles.cfg

@@ -0,0 +1,322 @@
+# Configuration file
+
+dimensionaledibles {
+
+    ##########################################################################################################
+    # general
+    #--------------------------------------------------------------------------------------------------------#
+    # The Category for general features of the mod
+    ##########################################################################################################
+
+    general {
+        # Set to true to enable Custom Apple.
+        B:customApple=false
+
+        # Set to true to enable custom Cakes.
+        B:customCake=true
+
+        # Set to true to enable End Cake.
+        B:endCake=true
+
+        # Set to true to enable Ender Apple.
+        B:enderApple=false
+
+        # Set to true to enable Nether Apple.
+        B:netherApple=false
+
+        # Set to true to enable Nether Cake.
+        B:netherCake=true
+
+        # Required operator level to invalidate stored cake spawning position
+        # Min: 1
+        # Max: 4
+        I:operatorInvalidationLevel=1
+
+        # Set to true to enable Overworld Apple.
+        B:overworldApple=false
+
+        # Set to true to enable Overworld Cake.
+        B:overworldCake=true
+    }
+
+    ##########################################################################################################
+    # tweaks
+    #--------------------------------------------------------------------------------------------------------#
+    # The category for tweaking behaviors of mod features
+    ##########################################################################################################
+
+    tweaks {
+        # Set to true to disable the activation of vanilla End Portal.
+        B:disableVanillaEndPortal=true
+
+        ##########################################################################################################
+        # endcake
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for dealing with the End Cake
+        ##########################################################################################################
+
+        endcake {
+            # Set to true to make the End Cake consume fuel.
+            B:consumeFuel=true
+
+            # Set the fuel used by End Cake (Don't change this unless you know what you're doing).
+            S:fuel=minecraft:ender_eye
+
+            # Set to true to make the End Cake pre-fueled upon placed.
+            B:preFueled=true
+
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # enderapple
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for dealing with the End Apple
+        ##########################################################################################################
+
+        enderapple {
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # nethercake
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for dealing with the Nether Cake
+        ##########################################################################################################
+
+        nethercake {
+            # Set to true to make the Nether Cake consume fuel.
+            B:consumeFuel=true
+
+            # Set the fuel used by Nether Cake (Don't change this unless you know what you're doing).
+            S:fuel=minecraft:obsidian
+
+            # Set to true to make the Nether Cake pre-fueled upon placed.
+            B:preFueled=true
+
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # netherapple
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for dealing with the Nether Apple
+        ##########################################################################################################
+
+        netherapple {
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # overworldcake
+        #--------------------------------------------------------------------------------------------------------#
+        # The category dealing with the Overworld Cake
+        ##########################################################################################################
+
+        overworldcake {
+            # Set to true to make the Overworld Cake consume fuel.
+            B:consumeFuel=true
+
+            # Set the fuel used by Overworld Cake (Don't change this unless you know what you're doing).
+            S:fuel=minecraft:sapling
+
+            # Set to true to make the Overworld Cake pre-fueled upon placed.
+            B:preFueled=true
+
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            # Set to true to make the Overworld Cake teleport players to world spawn.
+            # Otherwise, it will use the cached position.
+            B:useWorldSpawn=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # overworldapple
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for dealing with the Overworld Apple
+        ##########################################################################################################
+
+        overworldapple {
+            # Set to true to use custom coordinates for the teleportation.
+            B:useCustomCoords=false
+
+            # Set to true to make the Overworld Apple teleport players to world spawn.
+            # Otherwise, it will use the cached position.
+            B:useWorldSpawn=false
+
+            ##########################################################################################################
+            # customcoords
+            #--------------------------------------------------------------------------------------------------------#
+            # Define the custom spawn coordinates
+            ##########################################################################################################
+
+            customcoords {
+                # The X spawn coordinate
+                D:x=0.0
+
+                # The Y spawn coordinate
+                # Min: 0.0
+                # Max: 255.0
+                D:y=64.0
+
+                # The Z spawn coordinate
+                D:z=0.0
+            }
+
+        }
+
+        ##########################################################################################################
+        # customedible
+        #--------------------------------------------------------------------------------------------------------#
+        # The category for defining and modifying a Custom Cake
+        ##########################################################################################################
+
+        customedible {
+            # Set a list of custom coordinates used by Custom Cakes / Apples, this is optional.
+            # Format: <Dimension ID>, <X>, <Y>, <Z>
+            # Example: 0, 420, 123, -420
+            S:customCoords <
+                119, 2, 80, 2
+             >
+
+            # Set a list of dimensions to add cakes / apples for.
+            # Format: <Dimension ID>, <Cake / Apple Name>
+            # Example: 0, Overworld
+            # Note: "Cake" is automatically appended onto the end of the name for cakes.
+            S:dimensions <
+                119, Void World
+             >
+
+            ##########################################################################################################
+            # customcake
+            #--------------------------------------------------------------------------------------------------------#
+            # Customization of Custom Cake features
+            ##########################################################################################################
+
+            customcake {
+                # Set to true to make all Custom Cakes consume fuel.
+                B:consumeFuel=true
+
+                # Set the fuel used by Custom Cakes.
+                # Format: <Dimension ID>, <Fuel Registry Name>
+                # Example: 0, minecraft:apple
+                S:fuel <
+                    119, contenttweaker:pulsatingdust
+                 >
+
+                # Set to true to make all Custom Cakes pre-fueled upon placed.
+                B:preFueled=true
+            }
+
+        }
+
+    }
+
+}
+
+

config/EffortlessBuilding.cfg

@@ -0,0 +1,80 @@
+# Configuration file
+
+reach {
+    # Reach: how far away the player can place blocks using mirror/array etc.
+    # Enable the crafting of reach upgrades to increase reach.
+    # If disabled, reach is set to level 3 for survival players.
+    B:enableReachUpgrades=true
+
+    # Maximum reach in creative
+    # Keep in mind that chunks need to be loaded to be able to place blocks inside.
+    I:maxReachCreative=200
+
+    # Maximum reach in survival without upgrades
+    # Reach upgrades are craftable consumables that permanently increase reach.
+    # Set to 0 to disable Effortless Building until the player has consumed a reach upgrade.
+    I:maxReachLevel0=20
+
+    # Maximum reach in survival with one upgrade
+    I:maxReachLevel1=50
+
+    # Maximum reach in survival with two upgrades
+    I:maxReachLevel2=100
+
+    # Maximum reach in survival with three upgrades
+    I:maxReachLevel3=200
+}
+
+
+survivalbalancers {
+    # Allows a survival player to break blocks that are far away, in addition to placing blocks.
+    # Note: this allows insta-breaking of blocks in survival.
+    B:breakFar=false
+
+    # Increases the time to mine a block when breaking multiple at once.
+    # Mining time depends on how many blocks, what type of blocks, and the percentage below.
+    # Example: breaking 1 dirt + 1 obsidian takes the time of breaking 1 dirt + 1 obsidian.
+    B:increasedMiningTime=true
+
+    # How much the mining time of each additional block counts towards an increased mining time.
+    # A percentage between 0% and 100%, where 0% is the same as disabling it,
+    # and 100% takes as much time as breaking each block individually.
+    # The block in front of you always counts as 100%.
+    # Min: 0
+    # Max: 200
+    I:miningTimePercentage=50
+
+    # Determines what blocks can be replaced in survival.
+    # -1: only blocks that can be harvested by hand (default)
+    # 0: blocks that can be harvested with wooden or gold tools
+    # 1: blocks that can be harvested with stone tools
+    # 2: blocks that can be harvested with iron tools
+    # 3: blocks that can be harvested with diamond tools
+    # Min: -1
+    # Max: 3
+    I:quickReplaceMiningLevel=-1
+
+    # How many placements are remembered for the undo functionality.
+    I:undoStackSize=5
+}
+
+
+visuals {
+    # Show a block preview if you have a block in hand on build mode NORMAL
+    B:alwaysShowBlockPreview=false
+
+    # How long the dissolve effect takes when placing blocks.
+    # Default between 30 and 60 ticks, you can multiply that here.
+    # Recommended values:
+    # Snappy: 0.7
+    # Relaxing: 1.5
+    D:dissolveTimeMultiplier=1.0
+
+    # Switch to using the simple performance shader when placing more than this many blocks.
+    I:shaderTreshold=1500
+
+    # Use fancy shaders while placing blocks
+    B:useShaders=true
+}
+
+

config/ElevatorMod/ElevatorMod.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+general {
+    # Can mobs spawn in elevators ? [default: true]
+    B:mobSpawn=true
+
+    # Realign players after teleporting to the center of elevator ? [default: true]
+    B:precisionTarget=true
+
+    # Should elevators have the same color to teleport ? [default: true]
+    B:sameColor=true
+}
+
+

config/Guide-API/Guide-API.cfg

@@ -0,0 +1,39 @@
+# Configuration file
+
+##########################################################################################################
+# books
+#--------------------------------------------------------------------------------------------------------#
+# All settings related to Books.
+##########################################################################################################
+
+books {
+    # Allows books to spawn with new players.
+    # This is a global override for all books. [default: true]
+    B:canSpawnWithBooks=true
+
+    ##########################################################################################################
+    # spawn
+    #--------------------------------------------------------------------------------------------------------#
+    # If true, the user will spawn with the book.
+    # This defaults to the value the book owner has set and is overridden by this config.
+    ##########################################################################################################
+
+    spawn {
+        B:"bloodmagic:guide"=false
+    }
+
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# Miscellaneous settings.
+##########################################################################################################
+
+general {
+    # Enables extra information being printed to the console. [default: true]
+    B:enableLogging=true
+}
+
+

config/InvTweaks.cfg

@@ -0,0 +1,22 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Sun Jun 30 14:35:26 EDT 2019
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=false
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+version=1.63+release.109.220f184

config/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

config/JustEnoughCalculation/main.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # Set to true to force client mode: no item and recipe allowed, use key bindings instead.
+    B:clientMode=false
+}
+
+

config/JustEnoughCalculation/record.json

@@ -0,0 +1,17 @@
+{
+    "craft": {
+        "inventory": 0b,
+        "amount": "",
+        "recents": []
+    },
+    "player": {
+        "last": "",
+        "recipes": {}
+    },
+    "math": {
+        "current": "",
+        "last": "0",
+        "operator": 0,
+        "state": 0
+    }
+}

config/LogisticsPipes.cfg

@@ -0,0 +1,74 @@
+# Configuration file
+
+async {
+    # Threshold for running asynchronous code. A lower value will make async calls with small networks where the impact is low. Low values might hurt performance
+    I:threshold=100
+}
+
+
+general {
+    # The max. distance between a player and the HUD that get's shown in blocks.
+    I:HUDRenderDistance=15
+
+    # Render every LP pipe opaque.
+    B:OpaquePipes=false
+
+    # The number of slots in a chassis pipe starting from MK1 to MK5. Because there are 5 tiers, there need to be 5 values (positive integers, zero is allowed).
+    I:chassisSlots <
+        1
+        2
+        3
+        4
+        8
+     >
+
+    # Should LogisticsPipes check for updates?
+    B:checkForUpdates=false
+
+    # The maximum number of buildcraft pipes (including forks) between logistics pipes. This is an indicator of the maximum amount of nodes the recursion algorithm will visit before giving up. As it is possible to fork a pipe connection using standard BC pipes the algorithm will attempt to discover all available destinations through that pipe. Do note that the logistics system will not interfere with the operation of non-logistics pipes. So a forked pipe will usually be sup-optimal, but it is possible. A low value might reduce CPU usage, a high value will be able to handle more complex pipe setups. If you never fork your connection between the logistics pipes this has the same meaning as detectionLength and the lower of the two will be used
+    I:detectionCount=100
+
+    # The maximum shortest length between logistics pipes. This is an indicator on the maxim depth of the recursion algorithm to discover logistics neighbours. A low value might use less CPU, a high value will allow longer pipe sections
+    I:detectionLength=50
+
+    # Set the default configuration for the popup of the Orderer Gui. Should it be used?
+    B:displayPopup=true
+
+    # Do you fancy easter eggs?
+    B:easterEggs=true
+
+    # Whether or not special particles will spawn.
+    B:enableParticleFX=true
+
+    # Number of LPower units the Logistics Crafting Table uses per craft.
+    I:logisticsCraftingTablePowerUsage=250
+
+    # The max. distance between two robots when there is no zone defined.
+    I:maxRobotDistance=64
+
+    # Inverts the the mouse wheel scrolling for remote order number of items
+    B:ordererCountInvertWheel=false
+
+    # Inverts the the mouse wheel scrolling for remote order pages
+    B:ordererPageInvertWheel=false
+
+    # Disable the power usage trough LogisticsPipes
+    B:powerUsageDisabled=false
+
+    # A Multiplyer for the power usage.
+    D:powerUsageMultiplyer=1.0
+
+    # The amount of time that passes between checks to see if it is still connected to its neighbours (Independently from block place detection). A low value will mean that it will correct wrong values faster but use more CPU. A high value means error correction takes longer, but CPU consumption is reduced. A value of 20 will check about every second (default 600 [30 seconds])
+    I:reDetectionFrequency=600
+}
+
+
+multithread {
+    # Number of routing table update Threads, 0 to disable.
+    I:count=4
+
+    # Priority of the multiThread Threads. 10 is highest, 5 normal, 1 lowest
+    I:priority=5
+}
+
+

config/MoreOverlays.cfg

@@ -0,0 +1,82 @@
+# Configuration file
+
+##########################################################################################################
+# chunkbounds
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the chunk bounds overlay
+##########################################################################################################
+
+chunkbounds {
+    # Show the middle of the current Chunk (yellow line)
+    B:middle=true
+
+    # Radius (in Chunks) to show the edges (red line)
+    I:radius=1
+}
+
+
+itemsearch {
+    S:matchNBT <
+        minecraft:enchanted_book
+     >
+}
+
+
+##########################################################################################################
+# lightoverlay
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the light / mobspawn overlay
+##########################################################################################################
+
+lightoverlay {
+    # Range of the lightoverlay (negative Y)
+    I:downrange=16
+
+    # Range of the lightoverlay (Horizontal N,E,S,W)
+    I:hrange=16
+
+    # Ignore if there in no 2 Block space to spawn. (Less lag if true)
+    B:ignoreLayer=false
+
+    # Ignore if mobs can actually spawn and just go by light value
+    B:ignoreSpawns=false
+
+    # Minimum save light level where no mobs can spawn
+    I:saveLevel=8
+
+    # Range of the lightoverlay (positive Y)
+    I:uprange=4
+}
+
+
+##########################################################################################################
+# rendersettings
+#--------------------------------------------------------------------------------------------------------#
+# Settings for lines & colors
+# Values: 0xRRGGBB (Hex)
+##########################################################################################################
+
+rendersettings {
+    # Color for the chunk edge
+    I:chunk_edge_color=16711680
+
+    # Color for the chunk grid
+    I:chunk_grid_color=65280
+
+    # Line width for chunk boundaries
+    D:chunk_line_width=1.5
+
+    # Color for the middle chunk line
+    I:chunk_mid_color=16776960
+
+    # Color the X that marks "Spawns always possible"
+    I:spawn_always_color=16711680
+
+    # Line width for spawn indication
+    I:spawn_line_width=2
+
+    # Color the X that marks "Spawns at night possible"
+    I:spawn_night_color=16776960
+}
+
+

config/acronym/base/General.cfg

@@ -0,0 +1,39 @@
+# Configuration file
+
+general {
+    # Config entry for adding other items to count as tools. Format is "modid:item_name:meta" * is for any meta
+    S:"Other Tools" <
+        [immersiveengineering:tool:0
+        thermalfoundation:wrench:*
+        techreborn:wrench:*
+        actuallyadditions:item_laser_wrench:*
+        hammercore:wrench:*
+        hammercore:iwrench:*
+        mekanism:configurator:*
+        calculator:wrench:*
+        ic2:wrench:*
+        appliedenergistics2:certus_quartz_wrench:*
+        appliedenergistics2:nether_quartz_wrench:*
+        enderio:item_yeta_wrench:*
+        botania:twigwand:*
+        essentials:wrench:*
+        factorytech:wrench:*]
+     >
+}
+
+
+materials {
+    # List for Prioritizing OreDict returns by modid
+    S:preferredOreDictIds <
+        contenttweaker
+        base
+     >
+}
+
+
+module {
+    B:"JourneyMap enabled"=true
+    B:"Tool enabled"=true
+}
+
+

config/acronym/contenttweaker/General.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+module {
+    B:"Chickens enabled"=true
+    B:"Materials enabled"=true
+    B:"Tinkers enabled"=true
+    B:"Vanilla CraftTweaker enabled"=true
+}
+
+

config/acronym/material_system.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+item {
+    # 0 - All Item Parts on a Single MC Item, 1 - All Item Parts have their own MC Item, > 1 - That many Parts per item
+    I:size=0
+}
+
+

config/acronym/saved/material_parts_contenttweaker-original.json

@@ -0,0 +1,3 @@
+{
+  "materialMappings": {}
+}

config/acronym/saved/material_parts_contenttweaker.json

@@ -0,0 +1,3 @@
+{
+  "materialMappings": {}
+}

config/acronym/saved/saved_sub_blocks_contenttweaker-original.json

@@ -0,0 +1,3 @@
+{
+  "savedSubBlockNames": {}
+}

config/acronym/saved/saved_sub_blocks_contenttweaker.json

@@ -0,0 +1,3 @@
+{
+  "savedSubBlockNames": {}
+}

config/actuallyadditions.cfg

@@ -0,0 +1,577 @@
+# Configuration file
+
+"machine values" {
+    # The amount of power the atomic reconstructor can store.
+    I:"Atomic Reconstructor Power"=300000
+
+    # The Coal Generator's Energy Production in CF/tick while burning.
+    I:"Coal Generator Energy Production"=30
+
+    # The size of the farmer's farming area.  Default is 9x9, must be an odd number.
+    I:"Farmer Area"=9
+
+    # By default, the Item Repairer only repairs items which are repairable in an anvil. Add an item's REGISTRY NAME here if you want it to be repairable.
+    S:"Item Repairer Extra Whitelist" <
+        tconstruct:pickaxe
+        tconstruct:shovel
+        tconstruct:hatchet
+        tconstruct:mattock
+        tconstruct:broadsword
+        tconstruct:longsword
+        tconstruct:frypan
+        tconstruct:battlesign
+        tconstruct:hammer
+        tconstruct:excavator
+        tconstruct:lumberaxe
+        tconstruct:cleaver
+        tconstruct:rapier
+     >
+
+    # If Energy Laser Relays should have energy loss
+    B:"Laser Relay Energy Loss"=true
+
+    # The size of the Leaf Generator's harvesting area.  Default is 7x7x7, must be an odd number.
+    I:"Leaf Generator Area"=7
+
+    # The cooldown between two generation cycles of the Leaf Generator, in ticks
+    I:"Leaf Generator Cooldown"=5
+
+    # The Leaf Generator's Energy Production in CF/Leaf
+    I:"Leaf Generator Energy Production"=300
+
+    # The energy use of the Atomic Reconstructor's Mining Lens.
+    I:"Mining Lens Energy"=60000
+
+    # If true, the mining lens uses some weird math to calculate energy costs.
+    B:"Mining Lens Math"=true
+
+    # The amount of power that the 4 tiers of oils generate in CF/t.  Ordered.
+    I:"Oil Gen: Power Values" <
+        40
+        80
+        100
+        120
+     >
+
+    # The amount of time that the 4 tiers of oils work for in seconds.  Ordered.
+    I:"Oil Gen: Time Values" <
+        100
+        120
+        280
+        400
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can mine, but shouldn't be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option will apply in both modes.
+    S:"Vertical Digger Blacklist" <
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option only applies if the miner is in Ores Only Mode.
+    S:"Vertical Digger Extra Whitelist" <
+     >
+}
+
+
+"mob drops" {
+    # Should Bat wings drop from Bats?
+    B:"Bat Wing Drop"=true
+
+    # If true, Mobs will randomly drop solidified XP occasionally.
+    B:"Solidified XP Drop"=true
+
+    # Should Cobwebs drop from spiders?
+    B:"Spider Cobweb Drop"=true
+}
+
+
+other {
+    # Show Advanced Item Info when holding Control on every Item.
+    B:"Advanced Info"=true
+
+    # The maximum amount of characters that is displayed by the NBT view of the CTRL Advanced Info. Set to a zero to have no limit
+    I:"Advanced Info NBT Character Limit"=1000
+
+    # Show the 'Press Control for more Info'-Text on Item Tooltips
+    B:"Advanced Info Tooltips"=true
+
+    # The size of the booklet's large font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Large Font Size"=0
+
+    # The size of the booklet's medium font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Medium Font Size"=0
+
+    # The size of the booklet's small font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Small Font Size"=0
+
+    # If true, the Lens of Color will attempt to pull from the oredict instead of only using vanilla dyes.
+    B:"Color Lens Oredict"=false
+
+    # The non-Actually Additions items that are used to configure blocks from the mod. The first one is the Redstone Torch used to configure the Redstone Mode, and the second one is the Compass used to configure Laser Relays. If another mod overrides usage of either one of these items, you can change the registry name of the used items (using blocks is not possible) here.
+    S:"Configuration Items" <
+        minecraft:redstone_torch
+        minecraft:compass
+     >
+
+    # The items that aren't allowed as outputs from OreDict Crusher recipes. Use this in case a mod, for example, adds a dust variant that can't be smelted into an ingot. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_item@3
+    S:"Crusher Output Blacklist" <
+     >
+
+    # Ingots, Dusts and Ores that will be blacklisted from being auto-registered to be crushed by the Crusher. This list uses OreDictionary Names of the Inputs only.
+    S:"Crusher Recipe Exceptions" <
+        ingotBrick
+        ingotBrickNether
+     >
+
+    # If true, Cats drop Hairy Balls Occasionally.
+    B:"Do Cat Drops"=false
+
+    # If true, Actually Additions Checks for updates on World Load.
+    B:"Do Update Check"=false
+
+    # The 1/n drop chance, per tick, for a fur ball to be dropped.
+    I:"Fur Drop Chance"=5000
+
+    # If true, the booklet should be given to the player when he first crafts something from the Mod
+    B:"Give Booklet on First Craft"=false
+
+    # The ItemFood, IGrowable and IPlantable Items that can not be used to craft Mashed Food. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Mashed Food Crafting Exceptions" <
+        actuallyadditions:item_coffee
+     >
+
+    # The items that aren't allowed as being generated by the Lens of the Miner. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Mining Lens Blacklist" <
+     >
+
+    # By default, the mining lens has a set number of ores it can generate. If there is an ore that it should be able to generate, add its OreDictionary name followed by an @ and the weight that it should have (the higher, the more often it will generate), followed by another @ and then an s for it to generate in stone and an n for it to generate in netherrack. For instance: oreCheese@100@s would add cheese ore with a weight of 100 that generates in stone.
+    S:"Mining lens Extra Whitelist" <
+     >
+
+    # If you want to be really boring and lame, you can turn on this setting to disable colored names on Actually Additions items. Because why would you want things to look pretty anyways, right?
+    B:"No Colored Item Names"=false
+
+    # The items that aren't allowed to be put in the Repairer. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Repair Blacklist" <
+     >
+
+    # The items that aren't allowed to be put in the Traveller's Sack. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Sack Blacklist" <
+     >
+
+    # If true, Solidified Experience will always spawn orbs, even for regular players.
+    B:"Solid XP Orbs"=false
+
+    # By default, the Spawner Changer allows every living entity to be put into a spawner. If there is one that shouldn't be able to, put its MAPPING NAME here.
+    S:"Spawner Changer Blacklist" <
+        minecraft:villager_golem
+     >
+
+    # Turn this on to make recipes for items from the mod really hard. (This is a joke feature poking fun at the whole FTB Infinity Expert Mode style of playing. You shouldn't really turn this on as it makes the mod completely unplayable.)
+    B:"Super Duper Hard Recipes"=false
+
+    # The amount of ticks waited before a TileEntity sends an additional Update to the Client
+    I:"Tile Entities: Update Interval"=5
+
+    # Should Tiny Coal and Tiny Charcoal be craftable
+    B:"Tiny Coal"=true
+
+    # If true, Actually Additions' Update Checker searches for updates for the Minecraft Version you currently play on.
+    B:"Version Specific Update Checker"=true
+
+    # Should Actually Additions Loot generate in dungeons?
+    B:"Village and Dungeon Loot"=true
+
+    # Should right-clicking a bowl on water blocks create a water bowl?
+    B:"Water Bowl"=true
+
+    # Should the water bowl spill if you don't sneak while using it?
+    B:"Water Bowl Spilling"=true
+
+    # 11?
+    I:"What is 11"=0
+
+    # The amount of ticks it takes for a worm to die. When at 0 ticks, it will not die.
+    I:"Worm Death Time"=0
+
+    # If true, worms will drop from tilling the soil.
+    B:Worms=true
+}
+
+
+"tool control" {
+    # This will disable the Black Quartz AIOT. It will not be registered. [default: false]
+    B:"Disable: Black Quartz AIOT"=true
+
+    # This will disable the Black Quartz Axe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Axe"=true
+
+    # This will disable the Black Quartz Boots. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Boots"=true
+
+    # This will disable the Black Quartz Chestplate. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Chestplate"=true
+
+    # This will disable the Black Quartz Helmet. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Helmet"=true
+
+    # This will disable the Black Quartz Hoe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Hoe"=true
+
+    # This will disable the Black Quartz Pants. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pants"=true
+
+    # This will disable the Black Quartz Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pickaxe"=true
+
+    # This will disable the Black Quartz Shovel. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Shovel"=true
+
+    # This will disable the Black Quartz Sword. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Sword"=true
+
+    # This will disable the Diamatine Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal AIOT"=true
+
+    # This will disable the Diamatine Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Axe"=true
+
+    # This will disable the Diamatine Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Boots"=true
+
+    # This will disable the Diamatine Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Chestplate"=true
+
+    # This will disable the Diamatine Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Helmet"=true
+
+    # This will disable the Diamatine Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Hoe"=true
+
+    # This will disable the Diamatine Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pants"=true
+
+    # This will disable the Diamatine Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pickaxe"=true
+
+    # This will disable the Diamatine Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Shovel"=true
+
+    # This will disable the Diamatine Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Sword"=true
+
+    # This will disable the Diamond AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamond AIOT"=true
+
+    # This will disable the Emeradic Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal AIOT"=true
+
+    # This will disable the Emeradic Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Axe"=true
+
+    # This will disable the Emeradic Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Boots"=true
+
+    # This will disable the Emeradic Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Chest"=true
+
+    # This will disable the Emeradic Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Helmet"=true
+
+    # This will disable the Emeradic Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Hoe"=true
+
+    # This will disable the Emeradic Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pants"=true
+
+    # This will disable the Emeradic Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pickaxe"=true
+
+    # This will disable the Emeradic Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Shovel"=true
+
+    # This will disable the Emeradic Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Sword"=true
+
+    # This will disable the Emerald AIOT. It will not be registered. [default: false]
+    B:"Disable: Emerald AIOT"=true
+
+    # This will disable the Emerald Axe. It will not be registered. [default: false]
+    B:"Disable: Emerald Axe"=true
+
+    # This will disable the Emerald Boots. It will not be registered. [default: false]
+    B:"Disable: Emerald Boots"=true
+
+    # This will disable the Emerald Chestplate. It will not be registered. [default: false]
+    B:"Disable: Emerald Chestplate"=true
+
+    # This will disable the Emerald Helmet. It will not be registered. [default: false]
+    B:"Disable: Emerald Helmet"=true
+
+    # This will disable the Emerald Hoe. It will not be registered. [default: false]
+    B:"Disable: Emerald Hoe"=true
+
+    # This will disable the Emerald Pants. It will not be registered. [default: false]
+    B:"Disable: Emerald Pants"=true
+
+    # This will disable the Emerald Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emerald Pickaxe"=true
+
+    # This will disable the Emerald Shovel. It will not be registered. [default: false]
+    B:"Disable: Emerald Shovel"=true
+
+    # This will disable the Emerald Sword. It will not be registered. [default: false]
+    B:"Disable: Emerald Sword"=true
+
+    # This will disable the Engineer's Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Goggles"=false
+
+    # This will disable the Engineer's Infrared Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Infrared Goggles"=false
+
+    # This will disable the Enori Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal AIOT"=true
+
+    # This will disable the Enori Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Axe"=true
+
+    # This will disable the Enori Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Boots"=true
+
+    # This will disable the Enori Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Chest"=true
+
+    # This will disable the Enori Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Helmet"=true
+
+    # This will disable the Enori Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Hoe"=true
+
+    # This will disable the Enori Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pants"=true
+
+    # This will disable the Enori Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pickaxe"=true
+
+    # This will disable the Enori Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Shovel"=true
+
+    # This will disable the Enori Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Sword"=true
+
+    # This will disable the Golden AIOT. It will not be registered. [default: false]
+    B:"Disable: Golden AIOT"=true
+
+    # This will disable the Iron AIOT. It will not be registered. [default: false]
+    B:"Disable: Iron AIOT"=true
+
+    # This will disable the Obsidian AIOT. It will not be registered. [default: false]
+    B:"Disable: Obsidian AIOT"=true
+
+    # This will disable the Obsidian Axe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Axe"=true
+
+    # This will disable the Obsidian Boots. It will not be registered. [default: false]
+    B:"Disable: Obsidian Boots"=true
+
+    # This will disable the Obsidian Chestplate. It will not be registered. [default: false]
+    B:"Disable: Obsidian Chestplate"=true
+
+    # This will disable the Obsidian Helmet. It will not be registered. [default: false]
+    B:"Disable: Obsidian Helmet"=true
+
+    # This will disable the Obsidian Hoe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Hoe"=true
+
+    # This will disable the Obsidian Pants. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pants"=true
+
+    # This will disable the Obsidian Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pickaxe"=true
+
+    # This will disable the Obsidian Shovel. It will not be registered. [default: false]
+    B:"Disable: Obsidian Shovel"=true
+
+    # This will disable the Obsidian Sword. It will not be registered. [default: false]
+    B:"Disable: Obsidian Sword"=true
+
+    # This will disable the Palis Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal AIOT"=true
+
+    # This will disable the Palis Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Axe"=true
+
+    # This will disable the Palis Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Boots"=true
+
+    # This will disable the Palis Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Chestplate"=true
+
+    # This will disable the Palis Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Helmet"=true
+
+    # This will disable the Palis Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Hoe"=true
+
+    # This will disable the Palis Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pants"=true
+
+    # This will disable the Palis Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pickaxe"=true
+
+    # This will disable the Palis Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Shovel"=true
+
+    # This will disable the Palis Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Sword"=true
+
+    # This will disable the Restonia Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal AIOT"=true
+
+    # This will disable the Restonia Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Axe"=true
+
+    # This will disable the Restonia Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Boots"=true
+
+    # This will disable the Restonia Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Chestplate"=true
+
+    # This will disable the Restonia Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Helmet"=true
+
+    # This will disable the Restonia Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Hoe"=true
+
+    # This will disable the Restonia Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pants"=true
+
+    # This will disable the Restonia Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pickaxe"=true
+
+    # This will disable the Restonia Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Shovel"=true
+
+    # This will disable the Restonia Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Sword"=true
+
+    # This will disable the Stone AIOT. It will not be registered. [default: false]
+    B:"Disable: Stone AIOT"=true
+
+    # This will disable the Void Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Void Crystal AIOT"=true
+
+    # This will disable the Void Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Axe"=true
+
+    # This will disable the Void Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Boots"=true
+
+    # This will disable the Void Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Chestplate"=true
+
+    # This will disable the Void Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Helmet"=true
+
+    # This will disable the Void Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Hoe"=true
+
+    # This will disable the Void Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pants"=true
+
+    # This will disable the Void Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pickaxe"=true
+
+    # This will disable the Void Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Shovel"=true
+
+    # This will disable the Void Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Sword"=true
+
+    # This will disable the Wooden AIOT. It will not be registered. [default: false]
+    B:"Disable: Wooden AIOT"=true
+}
+
+
+"tool values" {
+    # By default, the AIOT can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"AIOT Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+
+    # If true,'Press key for more information' text should show when the item has a page in the booklet
+    B:"Booklet Quick Opening Info"=true
+
+    # By default, the Drill can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Drill Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+}
+
+
+"world gen" {
+    # Should Black Lotus generate in the World?
+    B:"Black Lotus Gen"=true
+
+    # The Amount of Black Lotus generating
+    I:"Black Lotus: Amount"=5
+
+    # Shold Black Quartz generate in the world?
+    B:"Black Quartz"=false
+
+    # Should Canola generate in the World?
+    B:"Canola Gen"=true
+
+    # The Amount of Canola generating
+    I:"Canola: Amount"=10
+
+    # Should Coffee Plants generate in the World?
+    B:"Coffee Gen"=true
+
+    # The Amount of Coffee generating
+    I:"Coffee: Amount"=6
+
+    # Should Custom Crop Fields exist?
+    B:"Crop Field: Existence"=true
+
+    # If Crystal Clusters should generate in Lush Caves
+    B:"Crystal Clusters in Lush Caves"=true
+
+    # Should the Engineer Villager and his House generate in the worl?
+    B:"Engineer Villager: Existence"=false
+
+    # Should Flax generate in the World?
+    B:"Flax Gen"=true
+
+    # The Amount of Flax generating
+    I:"Flax: Amount"=8
+
+    # Should caves with trees and grass randomly generate underground?
+    B:"Generate Lush Caves"=false
+
+    # Should the Jam Villager and his House generate in the world?
+    B:"Jam Villager: Existence"=true
+
+    # The chances for lush caves to generate. The lower the number, the higher the chances.
+    I:"Lush Caves: Chance"=20
+
+    # If true, the ore gen dimension blacklist will be treated as a whitelist.
+    B:"Ore Gen Whitelist"=false
+
+    # The list of IDs that Actually Additions OreGen (Ex: Black Quartz) is banned in. This also applies for other world gen like lush caves.
+    I:"OreGen Dimension Blacklist" <
+     >
+
+    # The list of IDs of the dimensions that Actually Additions Plants (Rice for example) are banned in.
+    I:"Plant Blacklist" <
+     >
+
+    # Should Rice generate in the World?
+    B:"Rice Gen"=true
+
+    # The Amount of Rice generating
+    I:"Rice: Amount"=15
+
+    # Should Treasure Chests generate in the World?
+    B:"Treasure Chest Gen"=true
+}
+
+

config/adhooks/hooks/prototype.cfg

@@ -0,0 +1,26 @@
+# Configuration file
+
+hookPrototype {
+    # Defines interation with non-playable characters. [default: true]
+    B:affectsNPCs=true
+
+    # Defines interation with players. [default: true]
+    B:affectsPlayers=true
+
+    # If true, you can hook any block regardless of its material and hardness. [default: false]
+    B:canHookAnyBlock=false
+
+    # Defines how much damage it will deal to entity on hit. [range: 0.0 ~ 100.0, default: 0.0]
+    S:damage=0.0
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how long it can be under fire influence (in seconds). [range: 0.0 ~ 60.0, default: 0.0]
+    S:resistance=0.0
+
+    # Defines how heavy duty it can withstand. [range: 0.0 ~ 20.0, default: 0.0]
+    S:strength=0.0
+}
+
+

config/adhooks/hooks/pudge.cfg

@@ -0,0 +1,68 @@
+# Configuration file
+
+hookPudge {
+    # Defines interation with non-playable characters. [default: true]
+    B:affectsNPCs=true
+
+    # Defines interation with players. [default: true]
+    B:affectsPlayers=true
+
+    # If true, you can hook any block regardless of its material and hardness. [default: false]
+    B:canHookAnyBlock=false
+
+    # Defines how much damage it will deal to entity on hit. [range: 0.0 ~ 100.0, default: 0.0]
+    S:damage=0.0
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how long it can be under fire influence (in seconds). [range: 0.0 ~ 60.0, default: 10.0]
+    S:resistance=10.0
+
+    # Defines how heavy duty it can withstand. [range: 0.0 ~ 20.0, default: 10.0]
+    S:strength=10.0
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [ingotIron], [stick]]
+            S:components <
+                ingotIron
+                stick
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:pudge_hook]
+            S:output=adhooks:pudge_hook
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 011 101 200]
+            S:pattern=011 101 200
+        }
+
+    }
+
+}
+
+

config/adhooks/hooks/spear.cfg

@@ -0,0 +1,68 @@
+# Configuration file
+
+hookSpear {
+    # Defines interation with non-playable characters. [default: true]
+    B:affectsNPCs=true
+
+    # Defines interation with players. [default: true]
+    B:affectsPlayers=true
+
+    # If true, you can hook any block regardless of its material and hardness. [default: false]
+    B:canHookAnyBlock=false
+
+    # Defines how much damage it will deal to entity on hit. [range: 0.0 ~ 100.0, default: 2.0]
+    S:damage=2.0
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how long it can be under fire influence (in seconds). [range: 0.0 ~ 60.0, default: 5.0]
+    S:resistance=5.0
+
+    # Defines how heavy duty it can withstand. [range: 0.0 ~ 20.0, default: 5.0]
+    S:strength=5.0
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [ingotIron], [stickWood]]
+            S:components <
+                ingotIron
+                stickWood
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:spear_hook]
+            S:output=adhooks:spear_hook
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 011 021 100]
+            S:pattern=011 021 100
+        }
+
+    }
+
+}
+
+

config/adhooks/hooks/web.cfg

@@ -0,0 +1,68 @@
+# Configuration file
+
+hookWeb {
+    # Defines interation with non-playable characters. [default: true]
+    B:affectsNPCs=true
+
+    # Defines interation with players. [default: true]
+    B:affectsPlayers=true
+
+    # If true, you can hook any block regardless of its material and hardness. [default: false]
+    B:canHookAnyBlock=false
+
+    # Defines how much damage it will deal to entity on hit. [range: 0.0 ~ 100.0, default: 0.0]
+    S:damage=0.0
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how long it can be under fire influence (in seconds). [range: 0.0 ~ 60.0, default: 2.0]
+    S:resistance=2.0
+
+    # Defines how heavy duty it can withstand. [range: 0.0 ~ 20.0, default: 2.0]
+    S:strength=2.0
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [web], [string]]
+            S:components <
+                web
+                string
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:web_hook]
+            S:output=adhooks:web_hook
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 001 020 200]
+            S:pattern=001 020 200
+        }
+
+    }
+
+}
+
+

config/adhooks/launchers/prototype.cfg

@@ -0,0 +1,81 @@
+# Configuration file
+
+Rope {
+    # Defines a color in ARGB (Alpha, Red, Green, Blue) hex format (0xaarrggbb) [default: 0x00000000]
+    S:color=0x00000000
+
+    # Defines how elastic the rope is. [range: 0.0 ~ 0.95, default: 0.0]
+    S:elasticity=0.0
+
+    # Defines the maximal rope length. [range: 1 ~ 80, default: 0]
+    I:maxLength=0
+
+    # Defines rope width. [range: 1.0 ~ 10.0, default: 0.0]
+    S:width=0.0
+}
+
+
+launcherPrototype {
+    # Defines how high you will be thrown upward when boost is activated [range: 0.0 ~ 3.0, default: 1.0]
+    S:boostStrength=1.0
+
+    # Defines durability of the item. [range: 0 ~ 65535, default: 0]
+    I:durability=0
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how fast the launcher reels in the rope. [range: 0.1 ~ 4.0, default: 0.0]
+    S:reelingSpeed=0.0
+
+    # Defines the material for repair on an anvil. [default: string]
+    S:repair=string
+
+    # If true, repair cost will grow for this item after each repair on an anvil. [default: false]
+    B:repairCostGrow=false
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [ingotIron], [stone_button], [repeater]]
+            S:components <
+                ingotIron
+                stone_button
+                repeater
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:prototype_launcher]
+            S:output=adhooks:prototype_launcher
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 321 211 113]
+            S:pattern=321 211 113
+        }
+
+    }
+
+}
+
+

config/adhooks/launchers/pudge.cfg

@@ -0,0 +1,84 @@
+# Configuration file
+
+Rope {
+    # Defines a color in ARGB (Alpha, Red, Green, Blue) hex format (0xaarrggbb) [default: 0xffbf0000]
+    S:color=0xffbf0000
+
+    # Defines how elastic the rope is. [range: 0.0 ~ 0.95, default: 0.0]
+    S:elasticity=0.0
+
+    # Defines the maximal rope length. [range: 1 ~ 80, default: 32]
+    I:maxLength=32
+
+    # Defines rope width. [range: 1.0 ~ 10.0, default: 3.0]
+    S:width=3.0
+}
+
+
+launcherPudge {
+    # Defines how high you will be thrown upward when boost is activated [range: 0.0 ~ 3.0, default: 1.0]
+    S:boostStrength=1.0
+
+    # Defines durability of the item. [range: 0 ~ 65535, default: 300]
+    I:durability=300
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how fast the launcher reels in the rope. [range: 0.1 ~ 4.0, default: 0.7]
+    S:reelingSpeed=0.7
+
+    # Defines the material for repair on an anvil. [default: string]
+    S:repair=string
+
+    # If true, repair cost will grow for this item after each repair on an anvil. [default: false]
+    B:repairCostGrow=false
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [adhooks:prototype_launcher], [adhooks:pudge_hook], [string], [dyeGray], [dyeYellow], [dyeRed]]
+            S:components <
+                adhooks:prototype_launcher
+                adhooks:pudge_hook
+                string
+                dyeGray
+                dyeYellow
+                dyeRed
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:pudge_launcher]
+            S:output=adhooks:pudge_launcher
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 542 413 036]
+            S:pattern=542 413 036
+        }
+
+    }
+
+}
+
+

config/adhooks/launchers/spear.cfg

@@ -0,0 +1,84 @@
+# Configuration file
+
+Rope {
+    # Defines a color in ARGB (Alpha, Red, Green, Blue) hex format (0xaarrggbb) [default: 0xbf000000]
+    S:color=0xbf000000
+
+    # Defines how elastic the rope is. [range: 0.0 ~ 0.95, default: 0.6]
+    S:elasticity=0.6
+
+    # Defines the maximal rope length. [range: 1 ~ 80, default: 64]
+    I:maxLength=64
+
+    # Defines rope width. [range: 1.0 ~ 10.0, default: 4.0]
+    S:width=4.0
+}
+
+
+launcherSpear {
+    # Defines how high you will be thrown upward when boost is activated [range: 0.0 ~ 3.0, default: 1.0]
+    S:boostStrength=1.0
+
+    # Defines durability of the item. [range: 0 ~ 65535, default: 180]
+    I:durability=180
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how fast the launcher reels in the rope. [range: 0.1 ~ 4.0, default: 0.5]
+    S:reelingSpeed=0.5
+
+    # Defines the material for repair on an anvil. [default: string]
+    S:repair=string
+
+    # If true, repair cost will grow for this item after each repair on an anvil. [default: false]
+    B:repairCostGrow=false
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [adhooks:prototype_launcher], [adhooks:spear_hook], [string], [dyeWhite], [dyeGray], [dyeBlack]]
+            S:components <
+                adhooks:prototype_launcher
+                adhooks:spear_hook
+                string
+                dyeWhite
+                dyeGray
+                dyeBlack
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:spear_launcher]
+            S:output=adhooks:spear_launcher
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 542 413 036]
+            S:pattern=542 413 036
+        }
+
+    }
+
+}
+
+

config/adhooks/launchers/web.cfg

@@ -0,0 +1,84 @@
+# Configuration file
+
+Rope {
+    # Defines a color in ARGB (Alpha, Red, Green, Blue) hex format (0xaarrggbb) [default: 0xffffffff]
+    S:color=0xffffffff
+
+    # Defines how elastic the rope is. [range: 0.0 ~ 0.95, default: 0.95]
+    S:elasticity=0.95
+
+    # Defines the maximal rope length. [range: 1 ~ 80, default: 76]
+    I:maxLength=76
+
+    # Defines rope width. [range: 1.0 ~ 10.0, default: 6.0]
+    S:width=6.0
+}
+
+
+launcherWeb {
+    # Defines how high you will be thrown upward when boost is activated [range: 0.0 ~ 3.0, default: 1.0]
+    S:boostStrength=1.0
+
+    # Defines durability of the item. [range: 0 ~ 65535, default: 240]
+    I:durability=240
+
+    # Set to 'false' if you don't need this unit. [default: true]
+    B:enabled=true
+
+    # Defines how fast the launcher reels in the rope. [range: 0.1 ~ 4.0, default: 0.8]
+    S:reelingSpeed=0.8
+
+    # Defines the material for repair on an anvil. [default: string]
+    S:repair=string
+
+    # If true, repair cost will grow for this item after each repair on an anvil. [default: false]
+    B:repairCostGrow=false
+
+    CraftingRecipe {
+
+        main {
+            # Amount of output units. [range: 1 ~ 64, default: 1]
+            I:amount=1
+
+            # Recipe components list.
+            # Components should be represented by its ids.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: [adhooks:prototype_launcher], [adhooks:web_hook], [string], [dyeLightBlue], [dyeWhite], [dyeWhite]]
+            S:components <
+                adhooks:prototype_launcher
+                adhooks:web_hook
+                string
+                dyeLightBlue
+                dyeWhite
+                dyeWhite
+             >
+
+            # Output unit id.
+            # Id is a basic unit (block or item) identifier in <modId:unitName:meta> format.
+            # ModId can be omitted for vanilla items. Meta can be omitted too if it equals 0.
+            # UnitName must be lowercase, words separated by '_', words order - from private to common (example: black_iron_ore).
+            # Unit name will be automatically converted to ore dictionary name with reverse word order (example: oreIronBlack).
+            # Use '*' char as meta value to specify all possible values.
+            # To define multiple block states, you can use block properties instead of meta. The format is <modId:blockName:[prop1=value1, prop2=value2]>
+            # Also you may use just ore dictionary name as full id.
+            #  [default: adhooks:web_launcher]
+            S:output=adhooks:web_launcher
+
+            # Shaped recipe pattern in format <nn nn> or <nnn nnn nnn>.
+            # Where 'n' - number of recipe component (from 1 to 9).
+            # Zero value (0) is for empty slot.
+            # If pattern is empty, then recipe will be treated as shapeless. [default: 542 413 036]
+            S:pattern=542 413 036
+        }
+
+    }
+
+}
+
+

config/advRocketry/ChemicalReactor.xml

@@ -0,0 +1,51 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="40" power ="20">
+		<input>
+			<itemStack>advancedrocketry:carbonscrubbercartridge 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:carbonscrubbercartridge</itemStack>
+			<itemStack>minecraft:coal 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="10">
+		<input>
+			<fluidStack>oxygen 10</fluidStack>
+			<fluidStack>hydrogen 10</fluidStack>
+		</input>
+		<output>
+			<fluidStack>rocketfuel 20</fluidStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>minecraft:bone</itemStack>
+			<fluidStack>nitrogen 10</fluidStack>
+		</input>
+		<output>
+			<itemStack>minecraft:dye 8 15</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/Crystallizer.xml

@@ -0,0 +1,41 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>dustDilithium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productcrystal</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSilicon</oreDict>
+			<oreDict>nuggetSilicon</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productboule 1 3</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/CuttingMachine.xml

@@ -0,0 +1,104 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>advancedrocketry:alienwood</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:planks 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>advancedrocketry:itemcircuitplate 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 4 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>libvulpes:productboule 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:wafer 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 2</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log2</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log2 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 5</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/ElectricArcFurnace.xml

@@ -0,0 +1,69 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="9000" power ="20">
+		<input>
+			<itemStack>thermalfoundation:material 7 132</itemStack>
+			<itemStack>libvulpes:productingot 3 7</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productingot 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="6000" power ="1">
+		<input>
+			<itemStack>minecraft:coal 1 1</itemStack>
+			<itemStack>minecraft:iron_ingot</itemStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 160</itemStack>
+			<itemStack>nuclearcraft:alloy 1 5</itemStack>
+			<itemStack>libvulpes:productingot 1 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="12000" power ="1">
+		<input>
+			<itemStack>minecraft:sand</itemStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productingot 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="3000" power ="20">
+		<input>
+			<itemStack>thermalfoundation:material 1 135</itemStack>
+			<itemStack>libvulpes:productingot 1 7</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productingot 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="10">
+		<input>
+			<oreDict>oreRutile</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productingot 1 7</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/Electrolyser.xml

@@ -0,0 +1,33 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="100" power ="20">
+		<input>
+			<fluidStack>water 10</fluidStack>
+		</input>
+		<output>
+			<fluidStack>hydrogen 100</fluidStack>
+			<fluidStack>oxygen 100</fluidStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/Lathe.xml

@@ -0,0 +1,776 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotOsmiridium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14207</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBatteryAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14091</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNaquadahEnriched</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14309</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotLumium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14706</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPromethium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14056</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNaquadah</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14307</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCobalt</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14017</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotConductiveIron</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14700</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotVibrantAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14702</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSignalum</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14707</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBlackBronze</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14229</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEpoxid</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14142</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotYttriumBariumCuprate</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14200</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEuropium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14022</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEnderium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14708</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotDuranium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14312</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPolyvinylChloride</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14989</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotUranium235</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14076</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotStainlessSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14183</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSiliconRubber</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14960</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotMagnalium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14129</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEnergeticAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14701</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSterlingSilver</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14227</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBismuthBronze</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14230</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTungsten</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14074</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotLead</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14035</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotRubber</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14152</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPraseodymium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14055</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTungstenSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14235</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotElectricalSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14705</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAntimony</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14003</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotKanthal</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14127</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotOsmium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14047</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotElectrum</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14112</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTritanium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14311</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSolderingAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14180</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotStyreneButadieneRubber</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14953</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotVanadiumSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14301</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTin</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14071</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotWroughtIron</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14197</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPlutonium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14052</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTungstenCarbide</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14300</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPotassium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14054</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productrod 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCobaltBrass</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14238</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBlueSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14233</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotRoseGold</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14228</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPolyphenyleneSulfide</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14934</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNaquadahAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14308</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitanium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 7</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotManyullyn</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14714</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAmericium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14002</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNiobiumTitanium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14135</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotHssg</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14302</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTinAlloy</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14189</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotHsse</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14303</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBronze</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14095</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotGold</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14026</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotUltimet</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14192</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAluminium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14001</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPalladium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14049</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBlackSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14231</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSilver</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14062</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotDarkSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14704</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotRedSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14232</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPigIron</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14140</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIronMagnetic</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14297</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNeodymium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14042</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCupronickel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14109</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBrass</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14094</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPulsatingIron</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14703</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNaquadria</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14310</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSteelMagnetic</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14298</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAnnealedCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14087</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotDamascusSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14234</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotDarmstadtium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14043</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPlatinum</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14051</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotChrome</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14016</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPlutonium241</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14053</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEndSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14712</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumAluminide</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productrod 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotArdite</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14713</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotHsss</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14304</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNiobiumNitride</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14134</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotVanadiumGallium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14195</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNeutronium</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14972</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotInvar</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14126</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNeodymiumMagnetic</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14299</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNichrome</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14133</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNickelZincFerrite</oreDict>
+		</input>
+		<output>
+			<itemStack>gregtech:meta_item_1 2 14921</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/PrecisionAssembler.xml

@@ -0,0 +1,210 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:misc</itemStack>
+			<itemStack>advancedrocketry:lens</itemStack>
+			<itemStack>thermalfoundation:material 1 321</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:atmanalyser</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>advancedrocketry:lens</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>thermalfoundation:material 1 320</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="500" power ="60">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:emerald</itemStack>
+			<itemStack>advancedrocketry:ic</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:dataunit</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>thermalfoundation:material 1 33</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="100">
+		<input>
+			<itemStack>minecraft:gold_ingot</itemStack>
+			<itemStack>minecraft:redstone_block</itemStack>
+			<itemStack>advancedrocketry:wafer</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemcircuitplate 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="100">
+		<input>
+			<itemStack>minecraft:gold_ingot</itemStack>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>advancedrocketry:wafer</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:feather</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:leather_boots</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:diamond</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:fire_charge</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>advancedrocketry:ic</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:redstone_torch</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:misc</itemStack>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+			<itemStack>thermalfoundation:material 1 321</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:biomechanger</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+			<itemStack>advancedrocketry:itemupgrade 1 4</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:beaconfinder</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>advancedrocketry:spacestationchip</itemStack>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:elevatorchip</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="50">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:ender_eye</itemStack>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:productrod 2 4</itemStack>
+			<itemStack>libvulpes:productrod 1 7</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:wafer 2</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:satelliteprimaryfunction 1 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:dye 1 4</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>libvulpes:productrod 1 1</itemStack>
+			<itemStack>advancedrocketry:lens 3</itemStack>
+			<itemStack>minecraft:glass 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:blocklens</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/SmallPlatePress.xml

@@ -0,0 +1,160 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreDilithium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockGold</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreGold</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTin</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreTin</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitanium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 7</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockAluminum</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 9</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreAluminum</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 9</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitaniumAluminide</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitaniumIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate 4 1</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

config/advRocketry/advancedRocketry.cfg

@@ -0,0 +1,414 @@
+# Configuration file
+
+asteroid {
+    # Multiplier changing how long a mining mission takes
+    D:miningMissionTmeMultiplier=1.0
+
+    # List of oredictionary names of ores allowed to spawn in asteriods
+    S:standardOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+     >
+}
+
+
+black_hole_generator {
+    # List of blocks and the amount of ticks they can power the black hole generator format: 'modname:block:meta;number_of_ticks'
+    S:blackHoleTimings <
+        minecraft:stone;1
+        minecraft:dirt;1
+        minecraft:netherrack;1
+        minecraft:cobblestone;1
+     >
+
+    # List of blocks and the amount of ticks they can power the black hole generator format: 'modname:block:meta;number_of_ticks'
+    I:defaultBurnTime=500
+}
+
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# UI locations can by set by clicking and dragging the middle mouse button ingame
+##########################################################################################################
+
+client {
+    # If true, AR will use a custom skybox on planets
+    B:PlanetSkyOverride=true
+
+    # If true, AR will use a custom skybox on space stations
+    B:StationSkyOverride=true
+    I:atmBarModeX=-1
+    I:atmBarModeY=1
+    I:atmBarX=8
+    I:atmBarY=27
+    I:hydrogenBarModeX=0
+    I:hydrogenBarModeY=1
+    I:hydrogenBarX=-8
+    I:hydrogenBarY=74
+
+    # If UI is not locked, the middle mouse can be used to drag certain AR UIs around the screen, positions are saved on hitting quit in the menu
+    B:lockUI=true
+    B:overworldSkyOverride=true
+    I:oxygenBarModeX=0
+    I:oxygenBarModeY=1
+    I:oxygenBarX=-8
+    I:oxygenBarY=57
+    I:suitPanelModeX=-1
+    I:suitPanelModeY=-1
+    I:suitPanelX=8
+    I:suitPanelY=8
+}
+
+
+gasmining {
+    # Multiplier for the amount of time gas collection missions take
+    D:gasMissionMultiplier=1.0
+
+    # list of fluid names that can be harvested as Gas [default: ]
+    S:harvestableGasses <
+     >
+    S:spawnableGasses <
+        hydrogen;125;1600;1.0
+        helium;125;1600;0.9
+        helium3;175;1600;0.2
+        oxygen;0;124;1.0
+        nitrogen;0;124;1.0
+        ammonia;0;124;0.75
+        methane;0;124;0.25
+     >
+}
+
+
+general {
+    # If true, allows players being hurt due to lack of oxygen and allows effects from non-standard atmosphere types
+    B:EnableAtmosphericEffects=true
+
+    # If true, allows players to experience nausea on non-standard atmosphere types
+    B:EnableAtmosphericNausea=false
+
+    # Enables the laser drill machine
+    B:EnableLaserDrill=true
+
+    # Enables terraforming items and blocks
+    B:EnableTerraforming=false
+
+    # Power multiplier for the laser drill machine
+    D:LaserDrillPowerMultiplier=1.0
+
+    # Multiplier for the amount of energy produced by the microwave reciever
+    D:MicrowaveRecieverMultiplier=1.0
+
+    # How high the rocket has to go before it reaches orbit [range: 255 ~ 2147483647, default: 1000]
+    I:OrbitHeight=1000
+
+    # Power consumption multiplier for the oxygen vent
+    D:OxygenVentPowerMultiplier=1.0
+
+    # setting this to false will will prevent resetPlanetsFromXML from being set to false upon world reload.  Recommended for those who want to force ALL saves to ALWAYS use the planetDefs XML in the /config folder.  Essentially that 'Are you sure you're sure' option.  If resetPlanetsFromXML is false, this option does nothing. [default: true]
+    B:ResetOnlyOnce=true
+
+    # The largest size a space station can be.  Should also be a power of 2 (512, 1024, 2048, 4096, ...).  CAUTION: CHANGING THIS OPTION WILL DAMAGE EXISTING STATIONS!!!
+    I:SpaceStationBuildRadius=2048
+
+    # how many millibuckets/t are required to keep the terraformer running
+    I:TerraformerFluidConsumeRate=40
+    B:TerraformerRequiresFluids=true
+
+    # If true players will respawn near beds on planets IF the spawn location is in a breathable atmosphere
+    B:allowPlanetRespawn=true
+
+    # EXPERIMENTAL: If set to true allows contruction and usage of the terraformer.  This is known to cause strange world generation after successful terraform
+    B:allowTerraforming=false
+
+    # If true dimensions not added by AR can be terraformed, including the overworld
+    B:allowTerraformingNonARWorlds=false
+
+    # If true players will be able to completely disable gravity on spacestation.  It's possible to get stuck and require a teleport, you have been warned!
+    B:allowZeroGSpacestations=false
+
+    # How many blocks have the biome changed per tick.  Large numbers can slow the server down
+    I:biomeUpdateSpeed=1
+
+    # Multiplier for the amount of power per tick the black hole generator should produce
+    I:blackHoleGeneratorMultiplier=1
+
+    # Multiplier for the build speed of the Rocket Builder (0.5 is twice as fast 2 is half as fast
+    D:buildSpeedMultiplier=1.0
+
+    # If true, breaking an extinguished torch will drop an extinguished torch instead of a vanilla torch
+    B:dropExtinguishedTorches=false
+
+    # Should Electric Mushrooms be able to spawn lightning
+    B:electricPlantsSpawnLightning=true
+
+    # If false the gravity controller cannot be built or used
+    B:enableGravityMachine=true
+
+    # list entities which should not be affected by atmosphere properties [default: ]
+    S:entityAtmBypass <
+     >
+
+    # If true, rockets will be able to actually fly around space, EXPERIMENTAL
+    B:experimentalSpaceFlight=false
+
+    # If true players will respawn near beds on planets REGARDLESS of the spawn location being in a non-breathable atmosphere. Requires 'allowPlanetRespawn' being true.
+    B:forcePlanetRespawn=false
+
+    # If true planets with higher gravity require more fuel and lower gravity would require less
+    B:gravityAffectsFuels=true
+
+    # Amount of force the jetpack provides with respect to gravity, 1 is the same acceleration as caused by Earth's gravity, 2 is 2x the acceleration caused by Earth's gravity, etc.  To make jetpack only work on low gravity planets, simply set it to a value less than 1
+    D:jetPackForce=1.3
+
+    # List of oredictionary names of ores allowed to be mined by the laser drill if surface drilling is disabled.  Ores can be specified by just the oreName:<size> or by <modname>:<blockname>:<meta>:<size> where size is optional
+    S:laserDrillOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+        oreDiamond
+     >
+
+    # True if the ores in laserDrillOres should be a blacklist, false for whitelist
+    B:laserDrillOres_blacklist=false
+
+    # If true the orbital laser will actually mine blocks on the planet below
+    B:laserDrillPlanet=false
+
+    # Outputs and chances of objects from Enriched Lava in the Centrifuge.  Format: <oredictionaryEntry>:<weight>.  Larger weights are more frequent [default: [nuggetCopper:100], [nuggetIron:100], [nuggetTin:100], [nuggetLead:100], [nuggetSilver:100], [nuggetGold:75], [nuggetDiamond:10], [nuggetUranium:10], [nuggetIridium:1]]
+    S:lavaCentrifugeOutputs <
+        nuggetCopper:100
+        nuggetIron:100
+        nuggetTin:100
+        nuggetLead:100
+        nuggetSilver:100
+        nuggetGold:75
+        nuggetDiamond:10
+        nuggetUranium:10
+        nuggetIridium:1
+     >
+
+    # If true the boots only protect the player on planets with low gravity
+    B:lowGravityBoots=false
+
+    # If true the machines from AdvancedRocketry will produce things like plates/rods for other mods even if Advanced Rocketry itself does not use the material (This can increase load time)
+    B:makeMaterialsForOtherMods=false
+
+    # Maximum unique biomes per planet, -1 to disable
+    I:maxBiomesPerPlanet=5
+
+    # Multiplier on how much O2 an oxygen vent consumes per tick
+    D:oxygenVentConsumptionMultiplier=1.0
+
+    # If true planets must be discovered in the warp controller before being visible
+    B:planetsMustBeDiscovered=false
+
+    # How many units of fuel should each Dilithium Crystal give to warp ships
+    I:pointsPerDilithium=500
+
+    # setting this to true will force AR to read from the XML file in the config/advRocketry instead of the local data, intended for use pack developers to ensure updates are pushed through [default: false]
+    B:resetPlanetsFromXML=false
+
+    # Mod:Blockname  for example "minecraft:chest" [default: [minecraft:portal], [minecraft:bedrock], [minecraft:snow_layer], [minecraft:water], [minecraft:flowing_water], [minecraft:lava], [minecraft:flowing_lava]]
+    S:rocketBlockBlackList <
+     >
+
+    # Should the cutting machine be able to cut vanilla wood into planks
+    B:sawMillCutVanillaWood=false
+
+    # If true the Oxygen scrubbers require a consumable carbon collection cartridge
+    B:scrubberRequiresCartrige=true
+
+    # Blocks that are automatically detected as sealable but should not seal.  Format "Mod:Blockname"  for example "minecraft:chest" [default: ]
+    S:sealableBlockBlackList <
+     >
+
+    # Blocks that are not automatically detected as sealable but should seal.  Format "Mod:Blockname"  for example "minecraft:chest" [default: ]
+    S:sealableBlockWhiteList <
+     >
+
+    # Amount of power per tick the solar generator should produce
+    I:solarGeneratorMultiplier=1
+
+    # Laser drill will not mine these dimension [default: ]
+    S:spaceLaserDimIdBlackList <
+     >
+
+    # Dimension ID to use for space stations
+    I:spaceStationId=-2
+
+    # Maximum time in minutes that the spacesuit's internal buffer can store O2 for
+    I:spaceSuitO2Buffer=30
+
+    # Max number of blocks allowed to be changed per tick
+    I:terraformBlockPerTick=1
+
+    # Multplier for atmosphere change speed
+    D:terraformMult=1.0
+
+    # Mod:Blockname  for example "minecraft:chest" [default: ]
+    S:torchBlocks <
+     >
+
+    # Amount of damage taken every second in a vacuum
+    I:vacuumDamage=1
+
+    # Multiplier for warp travel time
+    D:warpTravelTime=1.0
+}
+
+
+"mod interaction" {
+    # If true Galacticcraft's air will be disabled entirely requiring use of Advanced Rocketry's Oxygen system on GC planets
+    B:OverrideGCAir=true
+}
+
+
+"ore generation" {
+    I:AluminumPerChunk=0
+    I:AluminumPerClump=16
+    I:CopperPerChunk=0
+    I:CopperPerClump=6
+    I:DilithiumPerChunk=0
+    I:DilithiumPerChunkLuna=0
+    I:DilithiumPerClump=16
+    B:EnableOreGen=true
+    B:GenerateCopper=false
+    B:GenerateRutile=false
+    B:GenerateTin=false
+    I:IridiumPerChunk=0
+    I:IridiumPerClump=16
+    I:RutilePerChunk=0
+    I:RutilePerClump=6
+    I:TinPerChunk=0
+    I:TinPerClump=6
+    B:generateAluminum=false
+
+    # If true then low pressure planets will have meteor craters.  Note: setting this option to false overrides 'generageCraters' in the planetDefs.xml
+    B:generateCraters=true
+    B:generateDilithium=false
+
+    # If true then ore-containing geodes are generated on high pressure planets
+    B:generateGeodes=true
+    B:generateIridium=false
+
+    # Enable to allow structures like villages and mineshafts to generate on planets with a breathable atmosphere.  Note, setting this to false will override 'generateStructures' in the planetDefs.xml [default: false]
+    B:generateVanillaStructures=false
+
+    # If true then very hot planets planets will volcanos.  Note: setting this option to false overrides 'generateVolcanos' in the planetDefs.xml
+    B:generateVolcanos=true
+
+    # average size of the geodes
+    I:geodeBaseSize=36
+
+    # List of oredictionary names of ores allowed to spawn in geodes
+    S:geodeOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+     >
+
+    # True if the ores in geodeOres should be a blacklist, false for whitelist
+    B:geodeOres_blacklist=false
+
+    # variation in geode size
+    I:geodeVariation=24
+}
+
+
+performance {
+    # Advanced visual effects
+    B:advancedVFX=true
+
+    # BitMask: 0: no threading, radius based; 1: threading, radius based (EXP); 2: no threading volume based; 3: threading volume based (EXP)
+    I:atmosphereCalculationMethod=3
+
+    # Radius of the O2 vent.  if atmosphereCalculationMethod is 2 or 3 then max volume is calculated from this radius.  WARNING: larger numbers can lead to lag
+    I:oxygenVentSize=32
+}
+
+
+planet {
+    # List of Biomes to be blacklisted from spawning as BiomeIds, default is: river, sky, hell, void, alienForest [default: [minecraft:river], [minecraft:sky], [minecraft:hell], [minecraft:void], [advancedrocketry:alien forest]]
+    S:BlacklistedBiomes <
+        7
+        8
+        9
+        127
+        43
+     >
+
+    # Biomes that only spawn on worlds with pressures over 125, will override blacklist.  Defaults: StormLands, DeepSwamp [default: [advancedrocketry:deepswamp], [advancedrocketry:stormland]]
+    S:HighPressureBiomes <
+        48
+        46
+     >
+
+    # Some worlds have a chance of spawning single biomes contained in this list.  Defaults: deepSwamp, crystalChasms, alienForest, desert hills, mushroom island, extreme hills, ice plains [default: [advancedrocketry:volcanicbarren], [advancedrocketry:deepswamp], [advancedrocketry:crystalchasms], [advancedrocketry:alien forest], [minecraft:desert_hills], [minecraft:mushroom_island], [minecraft:extreme_hills], [minecraft:ice_flats]]
+    S:SingleBiomes <
+        48
+        47
+        43
+        17
+        14
+        3
+        12
+     >
+
+    # Prevents any vanilla biomes from spawning on planets [default: false]
+    B:blackListVanillaBiomes=false
+
+    # Dimensions including and after this number are allowed to be made into planets [range: -127 ~ 8000, default: 2]
+    I:minDimension=2
+
+    # Chance of planet discovery in the warp ship monitor is not all planets are initially discoved, chance is 1/n
+    I:planetDiscoveryChance=5
+}
+
+
+rockets {
+    D:asteroidTBIBurnMult=1.0
+
+    # Setting to false will disable the retrorockets that fire automatically on reentry on both player and automated rockets
+    B:autoRetroRockets=true
+    B:canBeFueledByHand=false
+
+    # Multiplier for per-tank capacity
+    D:fuelCapacityMultiplier=1.0
+    I:orbitHeight=1000
+    S:rocketBipropellants <
+        hydrogen
+     >
+
+    # List of fluid names for fluids that can be used as rocket fuel
+    S:rocketFuels <
+        rocket_fuel
+     >
+    S:rocketOxidizers <
+        oxygen
+     >
+
+    # Set to false if rockets should not require fuel to fly
+    B:rocketsRequireFuel=true
+    I:stationClearance=1000
+
+    # Multiplier for per-engine thrust
+    D:thrustMultiplier=1.0
+    I:transBodyInjection=0
+    D:warpTBIBurnMult=10.0
+}
+
+
+sealableblockwhitelist {
+    S:general <
+     >
+}
+
+

config/advRocketry/asteroidConfig.xml

@@ -0,0 +1,11 @@
+<Asteroids>
+	<asteroid name="Small Asteroid" distance="10" mass="100" massVariability="0.5" minLevel="0" probability="10" richness="0.2" richnessVariability="0.5">
+		<ore itemStack="minecraft:iron_ore" chance="15" />
+		<ore itemStack="minecraft:gold_ore" chance="10" />
+		<ore itemStack="minecraft:redstone_ore" chance="10" />
+	</asteroid>
+	<asteroid name="Iridium Enriched asteroid" distance="100" mass="25" massVariability="0.5" minLevel="0" probability="0.75" richness="0.2" richnessVariability="0.3">
+		<ore itemStack="minecraft:iron_ore" chance="25" />
+		<ore itemStack="libvulpes:ore0 10" chance="5" />
+	</asteroid>
+</Asteroids>

config/advRocketry/oreConfig.xml

@@ -0,0 +1,2 @@
+<OreConfig>
+</OreConfig>

config/advRocketry/planetDefs.xml

@@ -0,0 +1,105 @@
+<galaxy>
+    <star name="Sol" temp="100" x="0" y="0" numPlanets="0" numGasGiants="0">
+		<planet name="Earth" DIMID="0" dimMapping="">
+			<isKnown>true</isKnown>
+			<fogColor>1.0,1.0,1.0</fogColor>
+			<skyColor>1.0,1.0,1.0</skyColor>
+			<gravitationalMultiplier>100</gravitationalMultiplier>
+			<orbitalDistance>80</orbitalDistance>
+			<orbitalPhi>0</orbitalPhi>
+			<rotationalPeriod>24000</rotationalPeriod>
+			<atmosphereDensity>100</atmosphereDensity>
+			<planet name="Luna" DIMID="100">
+				<isKnown>true</isKnown>
+				<fogColor>1.0,1.0,1.0</fogColor>
+				<skyColor>1.0,1.0,1.0</skyColor>
+				<gravitationalMultiplier>16</gravitationalMultiplier>
+				<orbitalDistance>150</orbitalDistance>
+				<orbitalPhi>0</orbitalPhi>
+				<rotationalPeriod>128000</rotationalPeriod>
+				<atmosphereDensity>0</atmosphereDensity>
+			</planet>
+		</planet>
+		<planet name="Mercury" DIMID="101" customIcon="lava">
+		    <biomeIds>biomesoplenty:volcanic_island</biomeIds>
+            <skyColor>0,0,0</skyColor>
+			<oceanBlock>minecraft:fluid.lava</oceanBlock>
+			<atmosphereDensity>120</atmosphereDensity>
+			<gravitationalMultiplier>38</gravitationalMultiplier>
+			<orbitalDistance>10</orbitalDistance>
+			<rotationalPeriod>1400000</rotationalPeriod>
+		</planet>
+		<planet name="Venus" DIMID="102" customIcon="lava">
+		    <biomeIds>biomesoplenty:volcanic_island</biomeIds>
+            <skyColor>0,0,0</skyColor>
+			<fogColor>0.9,0.9,0.9</fogColor>
+			<oceanBlock>nuclearcraft:fluid.sulfuric_acid</oceanBlock>
+			<atmosphereDensity>120</atmosphereDensity>
+			<gravitationalMultiplier>90</gravitationalMultiplier>
+			<orbitalDistance>40</orbitalDistance>
+			<rotationalPeriod>2784000</rotationalPeriod>
+		</planet>
+		<planet name="Mars" DIMID="103" customIcon="marslike">
+			<biomeIds>advancedrocketry:hotdryrock</biomeIds>
+            <skyColor>1,0.2,0</skyColor>
+			<fogColor>0.9,0.6,0.1</fogColor>
+			<atmosphereDensity>0</atmosphereDensity>
+			<orbitalDistance>120</orbitalDistance>
+			<gravitationalMultiplier>70</gravitationalMultiplier>
+			<rotationalPeriod>20000</rotationalPeriod>
+		</planet>
+		<planet name="Jupiter" DIMID="104" customIcon="gasgiantred">
+            <GasGiant>true</GasGiant>
+			<gas>hydrogen</gas>
+			<gas>helium</gas>
+			<orbitalDistance>120</orbitalDistance>
+			<rotationalPeriod>9900</rotationalPeriod>
+			<planet name="Io" DIMID="105" customIcon="moon">
+				<atmosphereDensity>0</atmosphereDensity>
+				<gravitationalMultiplier>300</gravitationalMultiplier>
+				<orbitalDistance>180</orbitalDistance>
+				<rotationalPeriod>10000</rotationalPeriod>
+            </planet>
+			<planet name="Europa" DIMID="106" customIcon="waterworld">
+				<biomeIds>minecraft:frozen_ocean</biomeIds>
+				<atmosphereDensity>0</atmosphereDensity>
+				<gravitationalMultiplier>30</gravitationalMultiplier>
+				<orbitalDistance>90</orbitalDistance>
+				<orbitalPhi>90</orbitalPhi>
+				<rotationalPeriod>10000</rotationalPeriod>
+            </planet>
+        </planet>
+		<planet name="Saturn" DIMID="107" customIcon="gasgiantblue">
+            <GasGiant>true</GasGiant>
+			<gas>hydrogen</gas>
+			<gas>helium</gas>
+			<hasRings>true</hasRings>
+			<orbitalDistance>130</orbitalDistance>
+			<rotationalPeriod>10600</rotationalPeriod>
+			<planet name="Titan" DIMID="108" customIcon="moon">
+				<atmosphereDensity>0</atmosphereDensity>
+				<gravitationalMultiplier>250</gravitationalMultiplier>
+				<orbitalDistance>250</orbitalDistance>
+				<orbitalPhi>120</orbitalPhi>
+				<rotationalPeriod>12000</rotationalPeriod>
+			</planet>
+        </planet>
+		<planet name="Uranus" DIMID="109" customIcon="iceworld">
+		    <GasGiant>true</GasGiant>
+			<gas>hydrogen</gas>
+			<gas>helium</gas>
+			<atmosphereDensity>0</atmosphereDensity>
+			<orbitalDistance>300</orbitalDistance>
+			<gravitationalMultiplier>200</gravitationalMultiplier>
+			<rotationalPeriod>17250</rotationalPeriod>
+        </planet>
+		<planet name="Neptune" DIMID="110" customIcon="iceworld">
+		   <GasGiant>true</GasGiant>
+			<gas>hydrogen</gas>
+			<gas>helium</gas>
+			<orbitalDistance>350</orbitalDistance>
+			<gravitationalMultiplier>200</gravitationalMultiplier>
+			<rotationalPeriod>21100</rotationalPeriod>
+        </planet>
+		</star>
+</galaxy>

config/appleskin.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are client-side only
+##########################################################################################################
+
+client {
+    # If true, shows your food exhaustion as a progress bar behind the hunger bars
+    B:show.food.exhaustion.hud.underlay=true
+
+    # If true, adds a line that shows your hunger, saturation, and exhaustion level in the F3 debug overlay
+    B:show.food.stats.in.debug.overlay=true
+
+    # If true, shows the hunger (and saturation if show.saturation.hud.overlay is true) that would be restored by food you are currently holding
+    B:show.food.values.hud.overlay=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip while holding SHIFT
+    B:show.food.values.in.tooltip=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip automatically (without needing to hold SHIFT)
+    B:show.food.values.in.tooltip.always=true
+
+    # If true, shows your current saturation level overlayed on the hunger bar
+    B:show.saturation.hud.overlay=true
+}
+
+

config/armorplus/config.cfg

@@ -0,0 +1,68 @@
+# Configuration file
+
+global {
+    # Sets the Recipe Difficulty
+    # -1 Disables almost all in-game recipes from the mod (can be used with the 'useJsonRecipes' property to only enable vanilla crafting table recipes),
+    # 0 = easy (All recipes are extremely easy),
+    # 1 = expert (default, All Recipes Are Harder),
+    # 2 = hellish (Repairing for A+ items is DISABLED)
+    # Min: -1
+    # Max: 2
+    I:gameMode=1
+
+    # Will make ArmorPlus use the Crafting Table 3x3 for all the recipes instead of the tiered benches
+    B:useJsonRecipes=false
+}
+
+
+lavapickaxe {
+    # Add blocks to the smelting blacklist of "Infused Lava Pickaxe"
+    # If You add want to add an item to the blacklist
+    # Add it in the following format: "<namespace>:<name>"
+    # Examples can be found inside the list itself
+    S:blacklist <
+        minecraft:wet_sponge
+        minecraft:sponge
+        minecraft:obsidian
+     >
+}
+
+
+maps {
+    # Enable/Disable the ability of the maps to spawn bosses, suck as the "Skeletal King" from the "Map of Sacrifice"
+    B:allowSpawnOfBosses=true
+}
+
+
+tgotg {
+    # Add Blacklisted Items to the "The Gift Of The Gods"
+    # If You add want to add an item to the blacklist
+    # You will need to replace 1 from "minecraft:dirt" to the item you want to add
+    S:blackListedItems <
+        minecraft:dirt
+     >
+
+    # Set the cooldown ticks until you can use The Gift Of The Gods (1 second = 20 ticks)
+    I:cooldownTicks=600
+
+    # Enable/Disable The Gift Of The Gods
+    B:enable=true
+
+    # Enable/Disable the BlackList
+    B:enableBlackList=false
+
+    # Enable/Disable the WhiteList
+    B:enableWhiteList=false
+
+    # Set the max amount of uses for the item
+    I:maxUses=2
+
+    # Add WhiteListed Items to the "The Gift Of The Gods"
+    # If You add want to add an item to the whitelist
+    # You will need to replace 1 from "minecraft:dirt" to the item you want to add
+    S:whiteListedItems <
+        minecraft:dirt
+     >
+}
+
+

config/armorplus/debug.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+debug {
+    # Enable/Disable Debug Mode
+    B:debugMode=false
+
+    # Enable/Disable Debug Mode for the Enchantments
+    B:debugModeEnchantments=false
+
+    # Enable/Disable Debug Mode for the Ender Dragon Zombie
+    B:debugModeEnderDragonZombie=false
+
+    # Enable/Disable Debug Mode for the Gift Of The Gods
+    B:debugModeTGOTG=false
+}
+
+

config/armorplus/dimensions.cfg

@@ -0,0 +1,18 @@
+# Configuration file
+
+dimensions {
+    # The numeral id of the armorplus:arena dimension
+    I:arenaDimensionID=120
+    B:enableArenaDimension=false
+
+    # Enable/Disable the realm of insanity
+    B:enableRealmOfInsanity=false
+
+    # Too unstable, unfinished to be enabled by default.
+    B:enableTheArenaDimension=false
+
+    # The numeral id of the armorplus:realm_of_insanity dimension
+    I:realmDimensionID=121
+}
+
+

config/armorplus/entities.cfg

@@ -0,0 +1,98 @@
+# Configuration file
+
+ender_dragon_zombie {
+    # Set the Ender Dragon Zombie's Armor
+    D:armor=2.0
+
+    # Set the Ender Dragon Zombie's Attack Damage
+    D:attackDamage=3.0
+
+    # Enable/Disable the Ender Dragon Zombie to spawn in the End
+    B:enableSpawnEnd=false
+
+    # Enable/Disable the Ender Dragon Zombie's Withering Effect
+    B:enableWithering=true
+    D:followRange=35.0
+
+    # Set the Ender Dragon Zombie's Health
+    D:health=40.0
+
+    # Set the Ender Dragon Zombie's Movement Speed
+    D:movementSpeed=0.23000000417232513
+
+    # Set the Ender Dragon Zombie's Withering effect Duration
+    I:witheringEffectDuration=20
+
+    # Set the Ender Dragon Zombie's Withering effect Level
+    I:witheringEffectLevel=4
+}
+
+
+mob_drops {
+
+    trophy {
+        # Enable/Disable the trophy dropped when killing a boss (some of the wip armorplus bosses)
+        B:enableAPBossTrophyDrops=true
+        B:enableTrophyDrops=false
+
+        # Enable/Disable the trophy dropped when killing a boss (vanilla bosses)
+        B:enableVanillaTrophyDrops=true
+    }
+
+    ender_dragon_scale {
+        # Enable/Disable the drop from the Ender Dragon
+        B:drop=true
+
+        # Set the amount that the Ender Dragon will drop
+        I:dropAmount=12
+    }
+
+    wither_bone {
+        # Enable/Disable the drop from the Wither Boss
+        B:bossDrop=true
+
+        # Set the amount that the Wither Boss will drop
+        I:dropAmount=6
+
+        # Enable/Disable the drop from the Wither Skeleton
+        B:witherSkeletonDrop=true
+    }
+
+    guardian_scale {
+        # Set the amount that the Elder Guardian will drop
+        I:dropAmount=6
+
+        # Enable/Disable the drop from the Elder Guardian
+        B:elderDrop=true
+
+        # Enable/Disable the drop from the Guardian
+        B:guardianDrop=true
+    }
+
+    skeletal_king {
+        # Enable/Disable the drops from the Skeletal King
+        B:skeletalKingDrop=true
+    }
+
+}
+
+
+skeletal_king {
+    # Set the Skeletal King's Armor
+    D:armor=8.0
+
+    # Set the Skeletal King's Health
+    # Max value 1024
+    D:bossHealth=1024.0
+
+    # Enable/Disable the Skeletal King's resistance buff effect
+    B:enableResistance=true
+
+    # Set the Skeletal King's Movement Speed
+    D:movementSpeed=0.6000000238418579
+
+    # Set the Skeletal King's resistance effect Level (0 = lvl 1)
+    I:resistanceAmplifier=0
+}
+
+

config/armorplus/experimental.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+experimental {
+    # This will enable experimental features that the mod provides, use with caution can corrupt/destroy/break your worlds
+    B:enableExperimentalMode=false
+}
+
+

config/armorplus/integrations.cfg

@@ -0,0 +1,37 @@
+# Configuration file
+
+integrations {
+    # Enable/Disable the JEI integration
+    B:enableJEIIntegration=true
+
+    # Enable/Disable the ProjectE integration
+    B:enableProjectEIntegration=false
+
+    # Enable/Disable the Tinkers' Construct integration
+    B:enableTConstructIntegration=false
+
+    # Enable/Disable the The One Probe integration
+    B:enableTOPIntegration=false
+
+    # Draconic Evolution: Set the chaos resistance of the [Ender Dragon, Guardian, Super Star] armor
+    # Min: 0.8999999761581421
+    # Max: 0.9900000095367432
+    D:normalChaosResistance=0.8999999761581421
+
+    # Draconic Evolution: enable/disable the chaos immunity of the [Ultimate] armor
+    B:ultimateChaosImmunity=true
+
+    tconstruct {
+        # Enable/Disable ender dragon scale material.
+        B:enableEnderDragonMaterial=true
+
+        # Enable/Disable guardian scale material.
+        B:enableGuardianScaleMaterial=true
+
+        # Enable/Disable wither bone material.
+        B:enableWitherBoneMaterial=true
+    }
+
+}
+
+

config/armorplus/misc.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+misc {
+    # Enable/Disable the armor Flight
+    B:enableFlightAbility=true
+}
+
+

config/armorplus/worldgen.cfg

@@ -0,0 +1,91 @@
+# Configuration file
+
+lava_crystal {
+
+    ##########################################################################################################
+    # overworld
+    #--------------------------------------------------------------------------------------------------------#
+    # Configuration for the 'Overworld' dimension
+    ##########################################################################################################
+
+    overworld {
+        # Enable/Disable the lava crystal world generation
+        B:enable=false
+
+        # Set the maximum y getExactRandPos level of the lava crystal world gen
+        I:maxYSpawn=16
+
+        # Set the minimum y getExactRandPos level of the lava crystal world gen
+        I:minYSpawn=6
+
+        # Set the rarity level of the lava crystal world gen
+        I:rarity=10
+
+        # Set the vein amount of the lava crystal world gen
+        I:veinAmount=4
+    }
+
+    ##########################################################################################################
+    # the_nether
+    #--------------------------------------------------------------------------------------------------------#
+    # Configuration for the 'The Nether' dimension
+    ##########################################################################################################
+
+    the_nether {
+        # Enable/Disable the lava crystal world generation
+        B:enable=true
+
+        # Set the maximum y getExactRandPos level of the lava crystal world gen
+        I:maxYSpawn=30
+
+        # Set the minimum y getExactRandPos level of the lava crystal world gen
+        I:minYSpawn=0
+
+        # Set the rarity level of the lava crystal world gen
+        I:rarity=5
+
+        # Set the vein amount of the lava crystal world gen
+        I:veinAmount=2
+    }
+
+    ##########################################################################################################
+    # the_end
+    #--------------------------------------------------------------------------------------------------------#
+    # Configuration for the 'The End' dimension
+    ##########################################################################################################
+
+    the_end {
+        # Enable/Disable the lava crystal world generation
+        B:enable=false
+
+        # Set the maximum y getExactRandPos level of the lava crystal world gen
+        I:maxYSpawn=0
+
+        # Set the minimum y getExactRandPos level of the lava crystal world gen
+        I:minYSpawn=0
+
+        # Set the rarity level of the lava crystal world gen
+        I:rarity=0
+
+        # Set the vein amount of the lava crystal world gen
+        I:veinAmount=0
+    }
+
+}
+
+
+tower {
+    # Set the spawn chance need of the Tower Generation in the Overworld
+    I:chanceNeededForSpawning=7000
+
+    # Enable/Disable the Tower Generation
+    B:enable=true
+
+    # Enable/Disable the tower generation outside the overworld
+    B:shouldOnlyGenerateInTheOverworld=true
+
+    # Set the spawn chance of the Tower Generation in the Overworld
+    I:spawnChance=1
+}
+
+

config/attributefix.cfg

@@ -0,0 +1,65 @@
+# Configuration file
+
+attributes {
+    # The maximum amount for the Armor attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxArmor=65536.0
+
+    # The maximum amount for the ArmorToughness attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxArmorToughness=65536.0
+
+    # The maximum amount for the AttackDamage attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxAttackDamage=65536.0
+
+    # The maximum amount for the AttackSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxAttackSpeed=65536.0
+
+    # The maximum amount for the FlyingSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxFlyingSpeed=65536.0
+
+    # The maximum amount for the FollowRange attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxFollowRange=65536.0
+
+    # The maximum amount for the KnockbackResistance attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxKnockbackResistance=65536.0
+
+    # The maximum amount for the Luck attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxLuck=65536.0
+
+    # The maximum amount for the MaxHealth attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxMaxHealth=65536.0
+
+    # The maximum amount for the MovementSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 65536.0]
+    S:maxMovementSpeed=65536.0
+
+    # The minimum amount for the Armor attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minArmor=0.0
+
+    # The minimum amount for the ArmorToughness attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minArmorToughness=0.0
+
+    # The minimum amount for the AttackDamage attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minAttackDamage=0.0
+
+    # The minimum amount for the AttackSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minAttackSpeed=0.0
+
+    # The minimum amount for the FlyingSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minFlyingSpeed=0.0
+
+    # The minimum amount for the FollowRange attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minFollowRange=0.0
+
+    # The minimum amount for the KnockbackResistance attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minKnockbackResistance=0.0
+
+    # The minimum amount for the Luck attribute. [range: 1.4E-45 ~ 3.4028235E38, default: -1024.0]
+    S:minLuck=-1024.0
+
+    # The minimum amount for the MaxHealth attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 1.4E-45]
+    S:minMaxHealth=1.4E-45
+
+    # The minimum amount for the MovementSpeed attribute. [range: 1.4E-45 ~ 3.4028235E38, default: 0.0]
+    S:minMovementSpeed=0.0
+}
+
+

config/avaritia.cfg

@@ -0,0 +1,65 @@
+~1.0
+
+#General configuration of Avaritia components.
+"general" {
+	#Disable to remove end stone out of some of Avaritia's recipes.
+	B:"use_end_stone"=true
+
+	#Disable if you don't want the World Breaker to break unbreakable blocks.
+	B:"break_bedrock"=true
+
+	#Enable to keep the Ultimate Stew and Cosmic Meatballs from grabbing more ingredients.
+	B:"boring_food"=false
+
+	#Enable if you don't have RotaryCraft installed and want some buggy fractured ores.
+	B:"fractured_ores"=false
+
+	#These are the OreDictionary ID's for default trashed items. These are synced from the server to the client. And will appear as defaults on the client also. Clients can override these, They are defaults not Musts.
+	S:"aoe_trash_defaults" <
+		dirt
+		sand
+		gravel
+		cobblestone
+		netherrack
+		stoneGranite
+		stoneDiorite
+		stoneAndesite
+	>
+
+	#Enables verbose logging of actions taken on avaritia by CraftTweaker scripts. Only effects CraftTweakers script log file.
+	B:"verbose_craft_tweaker_logging"=false
+}
+
+#Disable to stop using that material in recipes. Useful if a mod adds unobtainable placeholder ores.
+"materials" {
+	B:"copper"=true
+
+	B:"tin"=true
+
+	B:"silver"=true
+
+	B:"lead"=true
+
+	B:"nickel"=true
+
+	B:"steel"=true
+
+	B:"fluxed"=true
+
+	B:"enderium"=true
+
+	B:"dark_steel"=true
+
+	B:"platinum"=false
+
+	B:"iridium"=false
+}
+
+#Balance modifications for the Compressor.
+"balance" {
+	#Added to the existing modifier to make prices more expensive or cheaper. Can be negative.
+	I:"cost_modifier"=0
+
+	#Added to the existing multiplier to make prices more expensive or cheaper. Can be negative.
+	I:"cost_multiplier"=0
+}

config/badwithernocookiereloaded.cfg

@@ -0,0 +1,37 @@
+# Configuration file
+
+##########################################################################################################
+# general settings
+#--------------------------------------------------------------------------------------------------------#
+# Choose Global Sounds to Silence
+##########################################################################################################
+
+"general settings" {
+    # Set to true to silence the server messages for when any of these sounds have been silenced.
+    B:"The Console on Success"=true
+
+    # Set to true to silence the server-wide Ender Dragon Death broadcast sound.
+    B:"The Dragon"=true
+
+    # Set to true to silence the server-wide Thunder caused by Lightning broadcast sound.
+    B:"The Lightning"=true
+
+    # Set to true to silence the server-wide Wither spawn broadcast sound.
+    B:"The Wither"=true
+}
+
+
+##########################################################################################################
+# localized settings
+#--------------------------------------------------------------------------------------------------------#
+# Yes, you can silence other sounds too!
+##########################################################################################################
+
+"localized settings" {
+    # A list of sounds to silence, discoverable with the toggle command /listen 
+    # enter one sound event per line with no commas.
+    S:silenceUs <
+     >
+}
+
+

config/baubles.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+client {
+    # Set this to false to disable rendering of baubles in the player. [default: true]
+    B:baubleRender.enabled=true
+}
+
+

config/betteradvancements/betteradvancements.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+general {
+    B:addInventoryButton=false
+
+    # Lists the criteria for partially completed advancements, e.g. the biomes required for 'Adventuring Time'
+    #     Off: Vanilla default
+    #     Default: List which criteria you have already obtained
+    #     Spoiler: Only reveal unobtained criteria
+    #     All: Show both obtained and unobtained criteria
+    S:criteriaDetail=Default
+    B:criteriaDetailRequiresShift=false
+    S:defaultCompletedIconColor=#DBA213
+    S:defaultCompletedLineColor=#FFFFFF
+    S:defaultCompletedTitleColor=#DBA213
+    B:defaultDrawDirectLines=false
+    B:defaultHideLines=false
+    S:defaultUncompletedIconColor=#FFFFFF
+    S:defaultUncompletedLineColor=#FFFFFF
+    S:defaultUncompletedTitleColor=#0489C1
+    B:doAdvancementsBackgroundFade=true
+    B:orderTabsAlphabetically=false
+    B:showDebugCoordinates=false
+
+    # Values below 50% might give odd results, use on own risk ;)
+    I:uiScaling=100
+}
+
+

config/betterbuilderswands.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+##########################################################################################################
+# balance
+#--------------------------------------------------------------------------------------------------------#
+# For those wanting to change balance.
+# Note: The 'blocks-at-a-time' for the unbreakable wand is 2^n where n is the damage value. Recipe modification can be done with another mod.
+##########################################################################################################
+
+balance {
+    # How many blocks the diamond wand can place at a time. Use -1 for default
+    I:diamond_wand_limit=-1
+}
+
+
+general {
+    # Blocks that won't work at all with the wands. E.g. 'minecraft:bedrock/0'
+    S:blacklisted_blocks <
+     >
+
+    # Enable recipe for diamond builder's wand
+    B:enable_diamond_wand=true
+
+    # Enable recipe for iron builder's wand
+    B:enable_iron_wand=true
+
+    # Enable recipe for stone builder's wand
+    B:enable_stone_wand=true
+
+    # Specify forced mappings for what to build from certain blocks.
+    # (what you are looking at)=>(number required)*(item required)=>(block to build)
+    S:forced_blocks=minecraft:lapis_ore/0=>1*minecraft:lapis_ore/4=>minecraft:lapis_ore/0,minecraft:lit_redstone_ore/0=>1*minecraft:redstone_ore/0=>minecraft:lit_redstone_ore/0,minecraft:grass/0=>1*minecraft:grass/0=>minecraft:grass/0,minecraft:grass/0=>1*minecraft:dirt/0=>minecraft:dirt/0,minecraft:dirt/1=>1*minecraft:dirt/1=>minecraft:dirt/1,minecraft:dirt/1=>1*minecraft:dirt/0=>minecraft:dirt/0,minecraft:dirt/2=>1*minecraft:dirt/2=>minecraft:dirt/2,minecraft:dirt/2=>1*minecraft:dirt/0=>minecraft:dirt/0
+
+    # Blocks that break assumptions. When the placed block is not what you expect. E.g. 'minecraft:bedrock/0'
+    S:no_assumption_blocks <
+     >
+}
+
+
+why_not {
+    # For those that don't like Extra Utils progression. [default: false]
+    B:straymav_ultimate_wand=false
+}
+
+

config/betterquesting.cfg

@@ -0,0 +1,35 @@
+# Configuration file
+
+client {
+    B:"Quest Notices"=true
+}
+
+
+general {
+    B:"Claim all requires confirmation"=true
+    B:"Experimental Dirty Mode"=true
+    B:"Hide Updates"=false
+    B:"Lock Tray"=false
+
+    # Clamps the max UI height (-1 to disable) [range: -1 ~ 2147483647, default: -1]
+    I:"Max GUI Height"=-1
+
+    # Clamps the max UI width (-1 to disable) [range: -1 ~ 2147483647, default: -1]
+    I:"Max GUI Width"=-1
+
+    # Enabled the popup notices when quests are completed or updated [default: true]
+    B:"Quest Notices"=true
+    S:"Scroll Speed Multiplier"=1.0
+
+    # The current questing theme [default: betterquesting:light]
+    S:Theme=bq_standard:dark
+
+    # Jumps the user to the last opened quest [default: true]
+    B:"Use Quest Bookmark"=true
+    B:"Zoom In on Cursor"=true
+    B:"Zoom Out on Cursor"=true
+    S:"Zoom Smoothness"=100.0
+    S:"Zoom Speed"=1.25
+}
+
+

config/betterquesting/credits-reinforced-neon.txt

@@ -0,0 +1,4 @@
+All pixels are my work besides the quest objects from Funwayguy.
+
+Thanks for using my theme and don't forget to check out my dark mode theme Midnight!
+https://www.curseforge.com/minecraft/customization/bq-custom-theme-midnight

config/betterquesting/credits.txt

@@ -0,0 +1,2 @@
+All pixels are my work besides the quest objects from Funwayguy.
+

config/betterquesting/questbook.cfg

@@ -0,0 +1,20 @@
+# Configuration file
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# General options for the Quest Book mod.
+##########################################################################################################
+
+general {
+    # [NYI]Disable party notifications.  Default: false
+    B:disablePartyNotifications=false
+
+    # [NYI]Disable quest notifications.  Default: false
+    B:disableQuestNotifications=false
+
+    # Enable this option so new players will spawn with a Quest Book. Default: false
+    B:spawnWithBook=false
+}
+
+

config/betterquesting/resources/midnight/bq_themes.json

@@ -0,0 +1,324 @@
+[
+    {
+    "themeParent":"none",
+    "themeName":"Midnight by kastaqt",
+    "themeID":"midnight:dark",
+    "textures":
+    {
+      "betterquesting:panel_main":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,0,48,48],
+        "padding": [16,16,16,16],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,0,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,20,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,40,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,0,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,20,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [48,40,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:scroll_v_bg":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [248,0,8,60],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:item_frame":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,48,18,18],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:aux_frame_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,128,128,128],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:quest_norm_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_3":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_3":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "midnight:textures/gui/midnight_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      }
+    },
+    "colors":
+    {
+      "betterquesting:text_header":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:text_main":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:gui_divider":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:grid_major":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF000000"
+      },
+      "betterquesting:grid_minor":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF000000"
+      },
+      "betterquesting:quest_line_locked":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFC00000"
+      },
+      "betterquesting:quest_line_unlocked":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FFFFFF00"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF808000"
+        }
+      },
+      "betterquesting:quest_line_pending":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      },
+      "betterquesting:quest_line_complete":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      },
+      "betterquesting:quest_icon_locked":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF808080"
+      },
+      "betterquesting:quest_icon_unlocked":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FFC00000"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF600000"
+        }
+      },
+      "betterquesting:quest_icon_pending":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF00FFFF"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF008080"
+        }
+      },
+      "betterquesting:quest_icon_complete":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      }
+    },
+    "lines":
+    {
+      "betterquesting:gui_divider":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:grid_major":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:grid_minor":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 2,
+        "stippleMask": "1010101010101010"
+      },
+      "betterquesting:quest_locked":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_unlocked":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_pending":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_complete":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      }
+    }
+  }
+]

config/betterquesting/resources/reinforced-neon/bq_themes.json

@@ -0,0 +1,324 @@
+[
+    {
+    "themeParent":"none",
+    "themeName":"Reinforced Neon by kastaqt",
+    "themeID":"reinforced-neon:dark",
+    "textures":
+    {
+      "betterquesting:panel_main":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,0,48,48],
+        "padding": [16,16,16,16],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,0,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,20,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_normal_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,40,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,0,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,20,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:btn_clean_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [48,40,200,20],
+        "padding": [2,2,2,3],
+        "sliceMode": 1
+      },
+      "betterquesting:scroll_v_bg":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [248,0,8,60],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:scroll_v_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [248,60,8,20],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:item_frame":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,48,18,18],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:aux_frame_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,128,128,128],
+        "padding": [1,1,1,1],
+        "sliceMode": 2
+      },
+      "betterquesting:quest_norm_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_norm_3":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [0,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_0":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_1":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_2":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      },
+      "betterquesting:quest_main_3":
+      {
+        "textureType": "betterquesting:texture_sliced",
+        "atlas": "reinforced-neon:textures/gui/reinforced_neon_gui.png",
+        "bounds": [24,104,24,24],
+        "padding": [11,11,11,11],
+        "sliceMode": 1
+      }
+    },
+    "colors":
+    {
+      "betterquesting:text_header":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:text_main":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:gui_divider":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFFFFFFF"
+      },
+      "betterquesting:grid_major":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF000000"
+      },
+      "betterquesting:grid_minor":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF000000"
+      },
+      "betterquesting:quest_line_locked":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FFC00000"
+      },
+      "betterquesting:quest_line_unlocked":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FFFFFF00"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF808000"
+        }
+      },
+      "betterquesting:quest_line_pending":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      },
+      "betterquesting:quest_line_complete":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      },
+      "betterquesting:quest_icon_locked":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF808080"
+      },
+      "betterquesting:quest_icon_unlocked":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FFC00000"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF600000"
+        }
+      },
+      "betterquesting:quest_icon_pending":
+      {
+        "colorType": "betterquesting:color_pulse",
+        "period": 1.0,
+        "phase": 0.0,
+        "color1":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF00FFFF"
+        },
+        "color2":
+        {
+          "colorType": "betterquesting:color_static",
+          "color": "FF008080"
+        }
+      },
+      "betterquesting:quest_icon_complete":
+      {
+        "colorType": "betterquesting:color_static",
+        "color": "FF00FF00"
+      }
+    },
+    "lines":
+    {
+      "betterquesting:gui_divider":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:grid_major":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:grid_minor":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 2,
+        "stippleMask": "1010101010101010"
+      },
+      "betterquesting:quest_locked":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_unlocked":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_pending":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      },
+      "betterquesting:quest_complete":
+      {
+        "lineType": "betterquesting:line_simple",
+        "stippleScale": 1,
+        "stippleMask": "1111111111111111"
+      }
+    }
+  }
+]

config/bookshelf.cfg

@@ -0,0 +1,41 @@
+# Configuration file
+
+##########################################################################################################
+# oredict
+#--------------------------------------------------------------------------------------------------------#
+# WARNIG: Changing these config options may break recipes in mods that use Bookshelf.
+##########################################################################################################
+
+oredict {
+    # Should vanilla arrows be ore dicted? [default: true]
+    B:arrows=true
+
+    # Should vanilla fences and fence gates be ore dicted? [default: true]
+    B:fence=true
+
+    # Should misc blocks like magma blocks and bone blocks be put in the ore dict? [default: true]
+    B:misc=true
+
+    # Should vanilla rails be ore dicted? [default: true]
+    B:rails=true
+
+    # Should vanilla seeds be ore dicted? [default: true]
+    B:seeds=true
+
+    # Should vanilla shulker boxes be ore dicted? [default: true]
+    B:shulker=true
+}
+
+
+##########################################################################################################
+# translations
+#--------------------------------------------------------------------------------------------------------#
+# Adds support for additional levels. Lowering this can improve memory.
+##########################################################################################################
+
+translations {
+    # The amount of enchantment levels to translate. 10 or less will disable this. [range: 0 ~ 32767, default: 256]
+    I:enchantmentCount=256
+}
+
+

config/bountiful/bounties.json

@@ -0,0 +1,110 @@
+[
+  {
+    "content": "gregtech:meta_item_1:32600",
+    "amount": {
+      "min": 5,
+      "max": 10
+    },
+    "unitWorth": 5,
+    "weight": 70
+  },
+  {
+    "content": "contenttweaker:stonewidget",
+    "amount": {
+      "min": 5,
+      "max": 25
+    },
+    "unitWorth": 3,
+    "weight": 30
+  },
+  {
+    "content": "gregtech:meta_item_1:32640",
+    "amount": {
+      "min": 2,
+      "max": 4
+    },
+    "unitWorth": 10,
+    "weight": 50
+  },
+  {
+    "content": "gregtech:meta_item_2:32450",
+    "amount": {
+      "min": 5,
+      "max": 25
+    },
+    "unitWorth": 1,
+    "weight": 20
+  },
+  {
+    "content": "contenttweaker:combinationcircuit",
+    "amount": {
+      "min": 1,
+      "max": 5
+    },
+    "unitWorth": 35,
+    "weight": 50
+  },
+    {
+    "content": "gregtech:machine:501",
+    "amount": {
+      "min": 1,
+      "max": 5
+    },
+    "unitWorth": 10,
+    "weight": 20
+  },
+  {
+    "content": "gregtech:meta_item_1:32690",
+    "amount": {
+      "min": 2,
+      "max": 4
+    },
+    "unitWorth": 10,
+    "weight": 30
+  },
+  {
+    "content": "gregtech:meta_item_1:32680",
+    "amount": {
+      "min": 2,
+      "max": 4
+    },
+    "unitWorth": 15,
+    "weight": 30
+  },
+  {
+    "content": "gregtech:meta_item_1:32610",
+    "amount": {
+      "min": 2,
+      "max": 4
+    },
+    "unitWorth": 15,
+    "weight": 30
+  },
+  {
+    "content": "contenttweaker:enderwidget",
+    "amount": {
+      "min": 2,
+      "max": 5
+    },
+    "unitWorth": 30,
+    "weight": 50
+  },
+  {
+    "content": "contenttweaker:alloywidget",
+    "amount": {
+      "min": 2,
+      "max": 5
+    },
+    "unitWorth": 20,
+    "weight": 40
+  },
+  {
+    "content": "contenttweaker:woodenwidget",
+    "amount": {
+      "min": 5,
+      "max": 25
+    },
+    "unitWorth": 2,
+    "weight": 80
+  }
+]

config/bountiful/bountiful.cfg

@@ -0,0 +1,97 @@
+# Configuration file
+
+board {
+    # Whether or not the bounty board can be broken (Default: true).
+    B:"Board Breakable?"=true
+
+    # Whether or not bounty boards will drop when broken (Default: true).
+    B:"Board Drops on Break"=true
+
+    # Whether or not a recipe for the bounty board is created (Default: false).
+    B:"Board Recipe Enabled?"=true
+
+    # The number of entries that a Bounty Board starts with when placed, if not using global bounties (Default: 0)
+    I:"Bounties Created On Place"=5
+
+    # How long entries stay on the board, at max (Bounties will be removed prematurely if board hits max entries). (Default: 72000)
+    I:"Bounty on Board Lifespan"=72000
+
+    # By default (false), all boards share a single, global inventory per dimension. If false, all boards have their own inventory.
+    B:"Global Bounty Inventory"=true
+
+    # How many entries should be on a bounty board at a given time. (Max: 27, Default: 17)
+    I:"Max Bounties Per Board At A Time"=20
+
+    # How often, in ticks, new bounty should show up on the bounty board. (Min: 20, Default: 2400)
+    I:"New Bounty Frequency"=600
+
+    # Whether or not bounty boards naturally generate in villages (Default: true).
+    B:"Village Generation"=true
+}
+
+
+bounty {
+    # A general multiplier for how long you get to complete a bounty, based on bounty worth. (Default: 28.0)
+    D:"Bounty Expiry Time Multiplier"=5.0
+
+    # The maximum number of objectives that a bounty could ask for (Default: 2)
+    I:"Bounty Items Max"=4
+
+    # The minimum number of objectives that a bounty could ask for (Default: 1)
+    I:"Bounty Items Min"=1
+
+    # By default (true), the user must cash in the bounty by right clicking on the bounty board. If false, you can right click with the item in hand.
+    B:"Cash In At Bounty Board?"=true
+
+    # A multiplier for how much longer entity (mob) bounties will give you to complete than item bounties.
+    D:"Entity Bounty Time Multiplier"=2.0
+
+    # The minimum time, in ticks, required to complete a bounty. (Default: 6000)
+    I:"Minimum Bounty Time"=6000
+
+    # The chance, per level, for a bounty to increase in rarity (Default: 0.27)
+    D:"Rarity Increase Chance"=0.27
+
+    # By default (false), entries do not start counting down until the player takes them.
+    B:"Should Bounties Count Down on Board?"=true
+}
+
+
+compat {
+    # Whether or not gamestages compat is enabled.
+    B:"GameStages Compat"=true
+}
+
+
+misc {
+    # How much experience you get for completing a bounty at each rarity tier. (Default: 4 (Common), 8 (Uncommon), 12 (Rare), 20 (Epic))
+    I:"How much experience each rarity of bounty should give you." <
+        0
+        0
+        0
+        0
+     >
+}
+
+
+rarity {
+    # A multiplier for how much a common bounty is worth. (Default: 1.0)
+    D:"a) Common Worth Multiplier"=1.0
+
+    # A multiplier for how much an uncommon bounty is worth (Default: 1.1)
+    D:"b) Uncommon Worth Multiplier"=1.1
+
+    # A multiplier for how much a rare bounty is worth (Default: 1.2)
+    D:"c) Rare Worth Multiplier"=1.2
+
+    # A multiplier for how much an epic bounty is worth (Default: 1.5)
+    D:"d) Epic Worth Multiplier"=1.5
+}
+
+
+rewards {
+    # If using a currency for rewards, set this to true. By default (false), rewards will be picked at random until they match the bounty value (adjusted by rarity). If true, rewards will be greedily chosen (The most expensive coming first) until they match the bounty value. Currency rewards benefit from setting this to true because the highest possible coin values will be given first. With this turned on, reward weights are ignored.
+    B:"Greedy Rewards?"=false
+}
+
+

config/bountiful/rewards.json

@@ -0,0 +1,38 @@
+[
+  {
+    "content": "contenttweaker:omnicoin100",
+    "unitWorth": 100,
+    "weight": 10,
+	"amount": {
+      "min": 1,
+      "max": 3
+    }
+  },
+  {
+    "content": "contenttweaker:omnicoin5",
+    "unitWorth": 5,
+    "weight": 100,
+	"amount": {
+      "min": 10,
+      "max": 20
+    }
+  },
+  {
+    "content": "contenttweaker:omnicoin25",
+    "unitWorth": 25,
+    "weight": 50,
+	"amount": {
+      "min": 5,
+      "max": 10
+    }
+  },
+  {
+    "content": "contenttweaker:omnicoin",
+    "unitWorth": 1,
+    "weight": 100,
+	"amount": {
+      "min": 10,
+      "max": 50
+    }
+  }
+]

config/bq_standard.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # Hide update notifications [default: false]
+    B:"Hide Updates"=false
+}
+
+

config/bqtweaker.cfg

@@ -0,0 +1,36 @@
+# Configuration file
+
+general {
+
+    ##########################################################################################################
+    # client
+    #--------------------------------------------------------------------------------------------------------#
+    # Client Config
+    ##########################################################################################################
+
+    client {
+        # Override BQ's Home page?
+        B:"BQ Home Override"=true
+
+        # Should BQTweaker attempt to patch an entity rendering bug when Mobends is active? (Disabling this disables Party Create and Party Manage overrides as well.)
+        B:"BQ Mobends Patch"=true
+
+        # Should the button for toggling notifications be enabled?
+        B:"BQ Notifications Button"=true
+
+        # Override BQ's Party Create page?
+        B:"BQ Party Create Override"=true
+
+        # Override BQ's Party Manage page?
+        B:"BQ Party Manage Override"=true
+
+        # Override BQ's Quest page?
+        B:"BQ Quest Override"=true
+
+        # Override BQ's Questline page?
+        B:"BQ Questline Override"=true
+    }
+
+}
+
+

config/brandon3055/BrandonsCore.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+##########################################################################################################
+# Misc
+#--------------------------------------------------------------------------------------------------------#
+# Comment for category: Misc
+##########################################################################################################
+
+Misc {
+    # Enable DEV log output.
+    B:devLog=false
+
+    # Allows you to disable the tpx command.
+    B:enableTpx=true
+}
+
+
+##########################################################################################################
+# Server
+#--------------------------------------------------------------------------------------------------------#
+# Comment for category: Server
+##########################################################################################################
+
+Server {
+    # This disables the gui that is shown to clients if a server side config that cant be hot swapped has changed.
+    # It is replaced by a chat message that has an option to open the gui
+    B:disableInvasiveConfigGui=false
+}
+
+

config/brandon3055/CSG/Config.json

@@ -0,0 +1,60 @@
+{
+  "inventory": {
+    "0:4": "questbook:itemquestbook",
+    "1:2": "minecraft:leather_chestplate",
+    "0:0": "minecraft:sapling,16",
+    "1:0": "minecraft:leather_boots",
+    "1:3": "minecraft:leather_helmet",
+    "0:2": "minecraft:torch,64",
+    "0:3": "scannable:scanner,1,0,{items:{Size:9,Items:[{Slot:0,id:\"scannable:module_ore_rare\",Count:1b,Damage:0s},{Slot:1,id:\"scannable:module_ore_common\",Count:1b,Damage:0s},{Slot:2,id:\"scannable:module_range\",Count:1b,Damage:0s}]},energy:500000}",
+    "0:1": "actuallyadditions:item_fertilizer,64",
+    "1:1": "minecraft:leather_leggings"
+  },
+  "kits": {
+    "jumpstart": {
+      "1:0": "minecraft:iron_boots",
+      "0:16": "refinedstorage:wrench",
+      "1:1": "minecraft:iron_leggings",
+      "0:19": "refinedstorage:pattern,64",
+      "0:9": "refinedstorage:controller,1,0,{Energy:0}",
+      "1:3": "minecraft:iron_helmet",
+      "0:10": "refinedstorage:grid",
+      "0:22": "enderio:item_power_conduit,64",
+      "0:24": "enderio:item_liquid_conduit,64,1",
+      "0:17": "enderio:item_yeta_wrench",
+      "0:12": "refinedstorage:grid,1,2",
+      "0:0": "gregtech:meta_tool,1,1,{ench:[{lvl:1s,id:16s}],RandomKey:4056109899909888239L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:1033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:14": "refinedstorage:crafter,16",
+      "0:18": "refinedstorage:pattern,64",
+      "0:4": "scannable:scanner,1,0,{items:{Size:9,Items:[{Slot:0,id:\"scannable:module_ore_common\",Count:1b,Damage:0s},{Slot:1,id:\"scannable:module_ore_rare\",Count:1b,Damage:0s},{Slot:2,id:\"scannable:module_range\",Count:1b,Damage:0s}]},energy:500000}",
+      "1:2": "minecraft:iron_chestplate",
+      "0:25": "enderio:item_refined_storage_conduit,64",
+      "0:2": "gregtech:meta_tool,1,3,{ench:[{lvl:1s,id:16s}],RandomKey:5405274563335862843L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:3033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:3": "gregtech:meta_tool,1,2,{ench:[{lvl:1s,id:16s}],RandomKey:-7089872378654919681L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:2033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:23": "enderio:item_item_conduit,64",
+      "0:8": "minecraft:cooked_chicken,64",
+      "0:20": "refinedstorage:pattern,64",
+      "0:21": "refinedstorage:pattern,64",
+      "0:15": "refinedstorage:interface,16",
+      "0:7": "minecraft:torch,64",
+      "0:11": "refinedstorage:grid,1,1",
+      "0:1": "gregtech:meta_tool,1,0,{ench:[{lvl:1s,id:16s}],RandomKey:-5020092748714047907L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:33s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:13": "refinedstorage:storage,4,2",
+      "0:26": "nuclearcraft:rtg_californium"
+    },
+    "starter": {
+      "0:0": "gregtech:meta_tool,1,1,{ench:[{lvl:1s,id:16s}],RandomKey:4056109899909888239L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:1033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:3": "gregtech:meta_tool,1,2,{ench:[{lvl:1s,id:16s}],RandomKey:-7089872378654919681L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:2033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:7": "minecraft:torch,64",
+      "1:2": "minecraft:iron_chestplate",
+      "0:8": "minecraft:cooked_chicken,64",
+      "1:0": "minecraft:iron_boots",
+      "1:1": "minecraft:iron_leggings",
+      "1:3": "minecraft:iron_helmet",
+      "0:2": "gregtech:meta_tool,1,3,{ench:[{lvl:1s,id:16s}],RandomKey:5405274563335862843L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:3033s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:1": "gregtech:meta_tool,1,0,{ench:[{lvl:1s,id:16s}],RandomKey:-5020092748714047907L,CreatorMost:-5567380206174582019L,CraftingComponents:[{id:\"gregtech:meta_item_2\",Count:1b,Damage:33s},{id:\"minecraft:stick\",Count:1b,Damage:0s}],GT.ToolStats:{PrimaryMaterial:\"iron\",HandleMaterial:\"wood\"},CreatorLeast:-6837252790035570724L}",
+      "0:4": "scannable:scanner,1,0,{items:{Size:9,Items:[{Slot:0,id:\"scannable:module_ore_common\",Count:1b,Damage:0s},{Slot:1,id:\"scannable:module_ore_rare\",Count:1b,Damage:0s},{Slot:2,id:\"scannable:module_range\",Count:1b,Damage:0s}]},energy:500000}"
+    },
+    "nothing": {}
+  }
+}

config/brandon3055/Custom Fusion Recipe Info.txt

@@ -0,0 +1,124 @@
+//The recipe format has recently been updated! Old recipes will still work but may be disabled in a future MC version.
+
+It is now possible to add custom fusion recipes and/or remove existing ones.
+This feature is intended for Mod pack creators.
+
+Recipes are specified using json file which you will need to place in config/brandon3055 (The same folder you should have found this text document in)
+The json MUST be named "CustomFusionRecipes.json" (Without the quotes)
+
+The following is an example of what the json file should look like (See further down for an explanation of what everything means)
+
+[
+    {
+        "mode": "ADD",
+        "result": "minecraft:beacon",
+        "catalyst": "minecraft:nether_star",
+        "energy": 1000,
+        "tier": 1,
+        "ingredients": [
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:obsidian"
+        ]
+    },
+    {
+        "mode": "ADD",
+        "result": "minecraft:diamond_sword,1,0,{ench:[0:{lvl:5s,id:21s},1:{lvl:5s,id:20s},2:{lvl:5s,id:19s}]}",
+        "catalyst": "minecraft:golden_apple,1,1",
+        "energy": 1000,
+        "tier": 1,
+        "ingredients": [
+            "ore:oreGold",
+            "ore:blockGold",
+            "ore:ingotGold",
+            "minecraft:stone,1,0,{ench:[0:{lvl:5s,id:21s},1:{lvl:5s,id:20s},2:{lvl:5s,id:19s}]}"
+        ]
+    },
+    {
+        "mode": "REMOVE",
+        "result": "draconicevolution:draconic_staff_of_power",
+        "catalyst": "draconicevolution:draconic_pick",
+        "ingredients": [
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_shovel",
+            "draconicevolution:draconic_sword",
+            "draconicevolution:awakened_core"
+        ]
+    },
+    {
+        "mode": "REMOVE",
+        "result": "draconicevolution:draconic_shovel",
+        "catalyst": "draconicevolution:wyvern_shovel"
+    }    
+]
+
+
+The above json adds 2 recipes for vanilla items and removes 2 recipes from Draconic Evolution. It should be fairly clear how those examples work
+The following explains the recipes in more detail
+
+# Adding Recipes #
+
+"mode":
+- For adding recipes mode can be set to "ADD" or it can be left out and the recipe will default to the ADD function
+
+"result":
+- This is the item stack that the recipe will create.
+- This should be a specific item. It can not be an ore dictionary item.
+
+"catalyst":
+- The catalyst is the item that gets combined with the ingredients to create the result. 
+- This should be a specific item. It can not be an ore dictionary item.
+
+"energy":
+- This id the energy required for the crafting. Note that this number is multiplied by the number of ingredients.
+Meaning if you specifies 1000 for a recipe that has 8 ingredients the total energy cost would be 8000RF.
+
+"tier":
+- This is the crafting tier of this recipe 0 = basic, 1 = wyvern, 2 = awakened, 3 = chaotic
+
+"ingredients":
+- This is a list of ingredients required for the recipe.
+- These can be ore dictionary items.
+
+
+# Removing Recipes #
+
+"mode":
+- Mode must be set to "REMOVE" when removing a recipe
+
+When removing recipes you to not need to specify the tier or energy cost of the target recipe.
+You can instead just specify the result, catalyst and ingredients of the target recipe.
+Optionally if you leave out the ingredients it will remove any recipe matching the result and catalyst items.
+
+
+## Item Stack Strings ##
+
+Example:      minecraft:wool,16,14     - This is 16 red wool
+Ore Example:  ore:ingotCopper          - This is 1 copper ingots using the ore dictionary
+Note: Ore entries do not support more that 1 stack size, Item damage or nbt
+More on the ore dictionary http://www.minecraftuniversity.com/forge/ore_dictionary_list/
+
+The name used in the item/block registry name or an ore dictionary name. Both the number of items and the damage value are optional
+
+Examples:
+name, stack size, meta, NBT
+ore:stone
+minecraft:stone         
+minecraft:stone,64       
+minecraft:stone,64,3 
+minecraft:stone,64,3,{NBT}
+
+
+### Notes ###
+The order in which you add/remove recipes dose not matter when replacing recipes. 
+Meaning for example you can add a recipe for a DE item then remove the original recipe and it will not remove the one you jsut added.
+
+You can use ore dictionary items for the catalyst and result when adding recipes but the default fusion implementation dose not support that. 
+So they will be replaced with the first item stack from the ore dictionary that matches that name.

config/brandon3055/CustomFusionRecipes.json

@@ -0,0 +1,344 @@
+[{
+		"mode": "REMOVE",
+		"result": "draconicevolution:wyvern_core",
+		"catalyst": "minecraft:emerald_block"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:wyvern_core",
+		"catalyst": "actuallyadditions:block_crystal_empowered,1,4",
+		"energy": 21943000,
+		"tier": 0,
+		"ingredients": [
+			"extendedcrafting:storage,1,2",
+			"extendedcrafting:storage,1,2",
+			"draconicevolution:draconic_core",
+			"draconicevolution:draconic_core",
+			"draconicevolution:draconic_core",
+			"draconicevolution:draconic_core",
+			"armorplus:block_compressed_infused_lava_crystal",
+			"armorplus:block_compressed_infused_lava_crystal"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "solarflux:solar_panel_chaotic,4,0",
+		"catalyst": "draconicevolution:chaotic_core"
+	},
+	{
+		"mode": "ADD",
+		"result": "solarflux:solar_panel_chaotic,2,0",
+		"catalyst": "draconicevolution:chaotic_core",
+		"energy": 3355440000,
+		"tier": 3,
+		"ingredients": [
+			"solarflux:solar_panel_draconic",
+			"draconicevolution:draconic_energy_core",
+			"draconicevolution:draconic_energy_core",
+			"solarflux:solar_panel_draconic"
+		]
+	},
+	{
+		"mode": "ADD",
+		"result": "solarflux:solar_panel_neutronium",
+		"catalyst": "solarflux:solar_panel_chaotic",
+		"energy": 13421760000,
+		"tier": 3,
+		"ingredients": [
+			"draconicevolution:chaotic_core",
+			"draconicevolution:chaotic_core",
+			"gregtech:wire_single,1,432",
+			"gregtech:wire_single,1,432",
+			"extendedcrafting:storage,1,4",
+			"extendedcrafting:storage,1,4",
+			"gregtech:wire_single,1,432",
+			"gregtech:wire_single,1,432",
+			"draconicevolution:chaotic_core",
+			"draconicevolution:chaotic_core"
+		]
+	},
+	{
+		"mode": "ADD",
+		"result": "solarflux:solar_panel_draconic,2,0",
+		"catalyst": "draconicevolution:draconic_energy_core",
+		"energy": 1677720000,
+		"tier": 2,
+		"ingredients": [
+			"solarflux:solar_panel_wyvern",
+			"solarflux:solar_panel_wyvern",
+			"enderio:item_endergy_conduit,1,11",
+			"enderio:item_endergy_conduit,1,11",
+			"draconicevolution:wyvern_energy_core",
+			"draconicevolution:wyvern_energy_core",
+			"enderio:item_endergy_conduit,1,11",
+			"enderio:item_endergy_conduit,1,11",
+			"solarflux:solar_panel_wyvern",
+			"solarflux:solar_panel_wyvern"
+		]
+	},
+	{
+		"mode": "ADD",
+		"result": "solarflux:solar_panel_wyvern,2,0",
+		"catalyst": "draconicevolution:wyvern_energy_core",
+		"energy": 838860000,
+		"tier": 1,
+		"ingredients": [
+			"solarflux:solar_panel_8",
+			"solarflux:solar_panel_8",
+			"enderio:item_endergy_conduit,1,10",
+			"enderio:item_endergy_conduit,1,10",
+			"draconicevolution:draconium_block",
+			"draconicevolution:draconium_block",
+			"enderio:item_endergy_conduit,1,10",
+			"enderio:item_endergy_conduit,1,10",
+			"solarflux:solar_panel_8",
+			"solarflux:solar_panel_8"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:reactor_core",
+		"catalyst": "draconicevolution:chaos_shard"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:reactor_core",
+		"catalyst": "extendedcrafting:material,1,13",
+		"energy": 2600000000,
+		"tier": 2,
+		"ingredients": [
+			"draconicevolution:draconic_block",
+			"draconicevolution:draconic_block",
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard",
+			"contenttweaker:stabilizedeinsteinium",
+			"contenttweaker:stabilizedeinsteinium",
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard",
+			"draconicevolution:draconic_block",
+			"draconicevolution:draconic_block"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:crafting_injector,1,3",
+		"catalyst": "draconicevolution:crafting_injector,1,2"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:crafting_injector,1,3",
+		"catalyst": "draconicevolution:crafting_injector,1,2",
+		"energy": 3000000000,
+		"tier": 2,
+		"ingredients": [
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard",
+			"gregtech:meta_ingot,1,127",
+			"gregtech:meta_ingot,1,127",
+			"gregtech:meta_block_compressed_2001,1,7",
+			"gregtech:meta_block_compressed_2001,1,7",
+			"gregtech:meta_ingot,1,127",
+			"gregtech:meta_ingot,1,127",
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:crafting_injector,1,2",
+		"catalyst": "draconicevolution:crafting_injector,1,1"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:crafting_injector,1,2",
+		"catalyst": "draconicevolution:crafting_injector,1,1",
+		"energy": 1000000000,
+		"tier": 1,
+		"ingredients": [
+			"minecraft:nether_star",
+			"minecraft:dragon_egg",
+			"draconicevolution:wyvern_core",
+			"draconicevolution:wyvern_core",
+			"minecraft:dragon_egg",
+			"minecraft:nether_star"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:particle_generator,1,2",
+		"catalyst": "draconicevolution:particle_generator"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:particle_generator,1,2",
+		"catalyst": "draconicevolution:particle_generator",
+		"energy": 40000000,
+		"tier": 1,
+		"ingredients": [
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2",
+			"actuallyadditions:block_crystal_empowered,1,2"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:reactor_component",
+		"catalyst": "draconicevolution:reactor_part"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:reactor_component",
+		"catalyst": "draconicevolution:reactor_part",
+		"energy": 7040000000,
+		"tier": 3,
+		"ingredients": [
+			"draconicevolution:reactor_part,1,4",
+			"draconicevolution:reactor_part,1,3",
+			"draconicevolution:draconic_energy_core",
+			"draconicevolution:draconic_energy_core",
+			"draconicevolution:awakened_core",
+			"draconicevolution:awakened_core",
+			"draconicevolution:awakened_core",
+			"draconicevolution:awakened_core"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:infused_obsidian",
+		"catalyst": "minecraft:obsidian"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:infused_obsidian",
+		"catalyst": "enderio:block_reinforced_obsidian",
+		"energy": 10485700,
+		"tier": 0,
+		"ingredients": [
+			"extrautils2:compressedcobblestone,1,3",
+			"enderio:block_alloy,1,6",
+			"draconicevolution:draconium_dust",
+			"draconicevolution:draconium_dust",
+			"thermalfoundation:material,1,1024",
+			"thermalfoundation:material,1,1024",
+			"armorplus:compressed_obsidian",
+			"armorplus:compressed_obsidian",
+			"armorplus:lava_crystal,1,1",
+			"armorplus:lava_crystal,1,1"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:draconic_energy_core",
+		"catalyst": "draconicevolution:wyvern_energy_core"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:draconic_energy_core",
+		"catalyst": "draconicevolution:wyvern_energy_core",
+		"energy": 41943000,
+		"tier": 2,
+		"ingredients": [
+			"draconicevolution:draconic_ingot",
+			"draconicevolution:draconic_ingot",
+			"draconicevolution:awakened_core",
+			"draconicevolution:awakened_core",
+			"ore:compressedoctadiccap",
+			"ore:compressedoctadiccap",
+			"actuallyadditions:block_crystal_empowered",
+			"actuallyadditions:block_crystal_empowered",
+			"draconicevolution:draconic_ingot",
+			"draconicevolution:draconic_ingot"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:draconic_block",
+		"catalyst": "draconicevolution:draconium_block"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:draconic_block,5,0",
+		"catalyst": "draconicevolution:draconium_block,5,0",
+		"energy": 4000000000,
+		"tier": 1,
+		"ingredients": [
+			"draconicevolution:wyvern_core",
+			"draconicevolution:wyvern_core",
+			"draconicevolution:dragon_heart",
+			"draconicevolution:dragon_heart",
+			"draconicevolution:wyvern_core",
+			"draconicevolution:wyvern_core"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:awakened_core",
+		"catalyst": "minecraft:nether_star"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:awakened_core",
+		"catalyst": "minecraft:nether_star",
+		"energy": 500000000,
+		"tier": 1,
+		"ingredients": [
+			"draconicevolution:wyvern_core",
+			"draconicevolution:wyvern_core",
+			"draconicevolution:draconic_block",
+			"draconicevolution:draconic_block",
+			"draconicevolution:wyvern_core",
+			"draconicevolution:wyvern_core"
+		]
+	},
+	{
+		"mode": "REMOVE",
+		"result": "draconicevolution:chaotic_core",
+		"catalyst": "draconicevolution:chaos_shard"
+	},
+	{
+		"mode": "ADD",
+		"result": "draconicevolution:chaotic_core",
+		"catalyst": "gregtech:meta_item_1,1,283",
+		"energy": 3000000000,
+		"tier": 3,
+		"ingredients": [
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard",
+			"gregtech:meta_ingot,1,127",
+			"gregtech:meta_ingot,1,127",
+			"extendedcrafting:material,1,32",
+			"extendedcrafting:material,1,32",
+			"gregtech:meta_ingot,1,127",
+			"gregtech:meta_ingot,1,127",
+			"draconicevolution:chaos_shard",
+			"draconicevolution:chaos_shard"
+		]
+	},
+	{
+        "mode": "REMOVE",
+        "result": "draconicevolution:dislocator_advanced",
+        "catalyst": "draconicevolution:dislocator"
+    },
+    {
+        "mode": "ADD",
+        "result": "draconicevolution:dislocator_advanced,1,0,{}",
+        "catalyst": "draconicevolution:dislocator",
+        "energy": 10000000,
+        "tier": 2,
+        "ingredients": [
+            "ore:enderpearl",
+            "ore:ingotDraconium",
+            "ore:enderpearl",
+            "ore:ingotDraconium",
+            "ore:enderpearl",
+            "ore:ingotDraconium",
+            "ore:dragonEgg",
+            "ore:ingotDraconium"
+        ]
+    }
+]

config/brandon3055/DraconicEvolution.cfg

@@ -0,0 +1,475 @@
+# Configuration file
+
+##########################################################################################################
+# Client Settings
+#--------------------------------------------------------------------------------------------------------#
+# These are client side properties that have no effect server side.
+##########################################################################################################
+
+"Client Settings" {
+    # Disables the 3D tool and armor models. This is required if you want to use a 2D resource pack.
+    B:disable3DModels=false
+
+    # This option is mainly here in case there are conflicts with other mods.
+    B:disableArmorFOVCorrection=false
+
+    # If true, the custom arrow models used by DE will be replaced by the vanilla model.
+    B:disableCustomArrowModel=false
+
+    # If true, the item dislocator will not make the pickup sound when it collects items.
+    B:disableDislocatorSound=false
+
+    # If true, the range of the Celestial Manipulator's sound effect will be significantly reduced.
+    B:disableLoudCelestialManipulator=false
+
+    # If true, the armor shield will not render when you take damage (this is only a visual change).
+    B:disableShieldHitEffect=false
+
+    # If true, the armor shield hit sound will be disabled.
+    B:disableShieldHitSound=false
+
+    # This is where the settings for the in game hud are stored. You should not need to adjust these unless something breaks.
+    # Warning: Changing the number of entries in this list will crash your game.
+    I:hudSettings <
+        996
+        825
+        69
+        907
+        90
+        100
+        3
+        0
+        1
+        1
+        1
+        1
+     >
+
+    # Invert Dislocator Pedestal display name shift behavior.
+    B:invertDPDSB=false
+
+    # This allows you to disable just the Energy Crystal shader. This shader can be a lot lagier than the reactor's shader since there are usually a lot more of them (The fallback crystal texture is not soooo bad...).
+    B:useCrystalShaders=true
+
+    # Set this to false if you prefer the original look of the reactor beams.
+    B:useReactorBeamShaders=true
+
+    # Set this to false if your system can not handle the awesomeness that is shaders! (Warning: Will make cool things look horrible!)
+    B:useShaders=true
+}
+
+
+##########################################################################################################
+# Misc
+#--------------------------------------------------------------------------------------------------------#
+# Just some misc settings.
+##########################################################################################################
+
+Misc {
+    # Set this to false to disable the Chaos Guardian's chunkloading ability.
+    # Note. The chaos guardian is ONLY loaded when a player is within a couple hundred blocks.
+    # This setting is here to avoid issues where the guardian would fly out of the loaded chunks
+    # and freeze; especially an issue on servers with reduced render distance.
+    B:chaosGuardianLoading=true
+
+    # This enables dev log output. I primarily use this for development purposes, so it won't be very useful to regular users.
+    B:devLog=false
+}
+
+
+##########################################################################################################
+# Stat Tweaks
+#--------------------------------------------------------------------------------------------------------#
+# These allow you to tweak the stats of the tools, weapons and armor.
+##########################################################################################################
+
+"Stat Tweaks" {
+    I:bowBaseDamage=2
+    I:bowBaseSpeed=100
+    I:bowDraconicMaxZoom=600
+    I:bowMaxExplosionPower=4
+    I:bowTierMultiplierDamage=1
+    I:bowTierMultiplierSpeed=100
+    I:bowUpgradeMultiplierDamage=2
+    I:bowUpgradeMultiplierSpeed=100
+    I:bowWyvernMaxZoom=300
+    D:draconicAxeAttackDMG=45.0
+    D:draconicAxeAttackSpeed=-3.2
+    D:draconicAxeMineSpeed=18.0
+    I:draconicBaseMineAOE=1
+    I:draconicBaseRFCapacity=16000000
+
+    # Allows you to adjust the total shield capacity of a full set of Draconic Armor.
+    I:draconicBaseShieldCapacity=512
+    D:draconicHoeAttackDMG=10.0
+    D:draconicHoeAttackSpeed=0.0
+
+    # Allows you to adjust how fast Draconic Armor is able to recieve RF/tick.
+    I:draconicMaxRecieve=1000000
+    D:draconicPicAttackDMG=20.0
+    D:draconicPicAttackSpeed=-2.9
+    D:draconicPicMineSpeed=18.0
+
+    # Allows you to adjust the amount of RF that Draconic Armor requires to recharge 1 shield point.
+    I:draconicShieldRechargeCost=1000
+
+    # Allows you to adjust how fast Draconic Armor is able to recover entropy.  Value is {this number}% every 5 seconds.
+    D:draconicShieldRecovery=4.0
+    D:draconicShovelAttackDMG=20.0
+    D:draconicShovelAttackSpeed=-2.9
+    D:draconicShovelMineSpeed=18.0
+    D:draconicStaffAttackDMG=60.0
+    D:draconicStaffAttackSpeed=-3.0
+    D:draconicStaffMineSpeed=60.0
+    D:draconicSwordAttackDMG=35.0
+    D:draconicSwordAttackSpeed=-2.0
+    D:flightSpeedModifier=1.0
+    I:lastStandEnergyRequirement=10000000
+    D:wyvernAttackSpeed=-3.0
+    D:wyvernAxeAttackDMG=25.0
+    D:wyvernAxeMineSpeed=12.0
+    I:wyvernBaseMineAOE=0
+    I:wyvernBaseRFCapacity=4000000
+
+    # Allows you to adjust the total shield capacity of a full set of Wyvern Armor.
+    I:wyvernBaseShieldCapacity=256
+
+    # Allows you to adjust how fast Wyvern Armor is able to recieve RF/tick.
+    I:wyvernMaxRecieve=512000
+    D:wyvernPicAttackDMG=12.0
+    D:wyvernPicAttackSpeed=-3.0
+    D:wyvernPicMineSpeed=12.0
+
+    # Allows you to adjust the amount of RF that Wyvern Armor requires to recharge 1 shield point.
+    I:wyvernShieldRechargeCost=1000
+
+    # Allows you to adjust how fast Wyvern Armor is able to recover entropy.  Value is {this number}% every 5 seconds.
+    D:wyvernShieldRecovery=2.0
+    D:wyvernShovelAttackDMG=12.0
+    D:wyvernShovelMineSpeed=12.0
+    D:wyvernSwordAttackDMG=15.0
+    D:wyvernSwordAttackSpeed=-2.2
+}
+
+
+##########################################################################################################
+# Tweaks
+#--------------------------------------------------------------------------------------------------------#
+# Just what the name says. Tweaks. Allows you to tweak stuff.
+##########################################################################################################
+
+Tweaks {
+    # Enabling this allows boss souls to drop. Use with caution!
+    B:allowBossSouls=false
+
+    # Set to false to prevent the bows explosion effect from breaking blocks.
+    B:bowBlockDamage=true
+
+    # Allows you to tweak the chaos guardians health (will only affect new guardians).
+    I:chaosGuardianHealth=2000
+
+    # This allows you to prevent certain items from being placed in the draconium chest using their registry name
+    S:chestBlackList <
+     >
+
+    # Adds recipes to clear all nbt data from items such as Energy Crystals and Crafting Injectors.
+    B:clearDataRecipes=false
+
+    # Allows you to adjust the capacity of each energy core tier.
+    # Warning changing the number entries in this list will crash your game.
+    D:coreCapacity <
+        4.55E7
+        2.73E8
+        1.64E9
+        9.88E9
+        5.93E10
+        3.56E11
+        2.14E12
+        9.223372036854776E18
+     >
+
+    # If true, this will disable the destruction of chaos islands after the chaos crystal is broken.
+    B:disableChaosIslandExplosion=false
+
+    # (Wuss mode) Setting this to true will disable the Chaos Guardian's ability to respawn healing crystals.
+    B:disableGuardianCrystalRespawn=false
+
+    # If true, this will disable the massive reactor explosion and replace it with a much smaller one.
+    B:disableLargeReactorBoom=false
+
+    # This will disable loot cores (The "Blobs" of items dropped by the tools.).
+    B:disableLootCores=false
+
+    # Sets the number of teleports you get per ender pearl with the Advanced Dislocator.
+    I:dislocatorUsesPerPearl=1
+
+    # Allows you to adjust the cost of disenchanting items via the Disenchanter.
+    D:dissenchnaterCostMultiplier=1.0
+
+    # This allows you to adjust the base capacity of the Draconic Flux Capacitor.
+    I:draconicFluxCapBaseCap=256000000
+
+    # This can be used to adjust the amount of Draconium Dust the Ender Dragon drops when killed.
+    # The amount dropped will be this number +/- 10%
+    I:dragonDustLootModifier=1
+
+    # By default, the dragon egg only ever spawns once. This forces it to spawn every time the dragon is killed.
+    B:dragonEggSpawnOverride=true
+
+    # Set this to false if you would like to disable the draconic armors flight.
+    B:enableFlight=true
+
+    # Allows you to adjust the power requirement of the entity detector.
+    # Set to 0 to disable completely
+    D:entityDetectorPowerModifier=1.0
+
+    # Lets face it. The biggest issue with the new dragon ritual is it is too darn cheap! This modifies the recipe to make it a bit more expensive.
+    B:expensiveDragonRitual=true
+
+    # Use this to limit the max flight speed modifier a player can set on the draconic chestplate.
+    # Setting this to 200 for example would limit the flight speed to +200%.
+    # Default -1 removes the limit and allows the full +600% flight speed.
+    I:flightSpeedLimit=-1
+
+    # For some reason, Forge decided to not set the owner of an item when dropped from an inventory screen.
+    # DE overrides this and sets the stack owner when possible.
+    # If this causes issues, set this value to false.
+    B:forceDroppedItemOwner=true
+
+    # This allows you to prevent the mob grinder from attempting to kill specific entities.
+    S:grinderBlackList <
+        evilcraft:vengeance_spirit
+     >
+
+    # Sets the energy per use per heart of damage for the grinder.
+    I:grinderEnergyPerHeart=80
+
+    # Set to false if you dont want the guardian to be able to kill creative players.
+    # Alternatively... Just dont poke the guardian if you dont want to die!
+    B:guardianCanKillCreative=true
+
+    # When true, everything is just a little harder. (Currently only effects recipes but that will probably change in the future)
+    B:hardMode=true
+
+    # If true fusion crafting injectors will be set to single item mode by default.
+    B:injectorSingleItemDefault=true
+
+    # A list of items of items that should be ignored by the item dislocator. Use the item's registry name (e.g. minecraft:apple) You can also add a meta value after the name (e.g. minecraft:wool|4).
+    S:itemDislocatorBlacklist <
+        appliedenergistics2:crystal_seed
+     >
+
+    # Add ore names (e.g. oreIron) to this list to prevent them from being doubled by the DE chest.
+    S:oreDoublingBlacklist <
+     >
+
+    # When doubling ores with the Draconium Chest, the output will prioritise thermal ingots if TF is installed. This allows you to change that by specifying a different mod id to target.
+    S:oreDoublingOutputPriority=thermalfoundation
+
+    # Passive (Animals) Mobs have a 1 in {this number} chance to drop a soul when killed with the Reaper enchantment.  Note: This is the base value; higher enchantment levels increase this chance.
+    I:passiveSoulDropChance=800
+
+    # Allows you to adjust the overall scale of the reactor explosion. Use "disableLargeReactorBoom" to disable explosion completely.
+    D:reactorExplosionScale=1.0
+
+    # Adjusts the fuel usage multiplier of the reactor.
+    D:reactorFuelUsageMultiplier=1.0
+
+    # Adjusts the energy output multiplier of the reactor.
+    D:reactorOutputMultiplier=1.0
+
+    # Mobs have a 1 in {this number} chance to drop a soul when killed with the Reaper enchantment.  Note: This is the base value; higher enchantment levels increase this chance.
+    I:soulDropChance=1000
+
+    # Sets the min and max spawn delay in ticks for each spawner tier. Order is as follows.
+    # Basic MIN, MAX, Wyvern MIN, MAX, Draconic MIN, MAX, Chaotic MIN MAX
+    I:spawnerDelays <
+        200
+        800
+        100
+        400
+        50
+        200
+        25
+        100
+     >
+
+    # By default, any entities added to this list will not drop their souls and will not be spawnable by the Stabilized Spawner.
+    S:spawnerList <
+     >
+
+    # Changes the spawner list to a whitelist instead of a blacklist.
+    B:spawnerListWhiteList=false
+
+    # This allows you to adjust the base capacity of the Wyvern Flux Capacitor.
+    I:wyvernFluxCapBaseCap=64000000
+}
+
+
+##########################################################################################################
+# World
+#--------------------------------------------------------------------------------------------------------#
+# This category contains config properties related to world gen.
+##########################################################################################################
+
+World {
+    # This is the distance between Chaos Islands.
+    I:chaosIslandSeparation=10000
+
+    # If true, the Chaos Guardian, Crystals, and Healing Crystals will still spawn, but NO other blocks will be placed. (This only exists because someone wanted it for some reason).
+    B:chaosIslandVoidMode=false
+
+    # This allows you to offset the y position of Chaos Islands.
+    I:chaosIslandYOffset=0
+
+    # Ender Comets have a 1 in {this number} chance to spawn in each chunk.
+    I:cometRarity=10000
+
+    # Disables draconium ore generation in the end.
+    B:disableOreSpawnEnd=false
+
+    # Disables draconium ore generation in the nether.
+    B:disableOreSpawnNether=true
+
+    # Disables draconium ore generation in the overworld.
+    B:disableOreSpawnOverworld=true
+
+    # Set this to false if you do not want ore added to chunks that have not previously been generated by DE (this can almost always be left true).
+    B:enableRetroGen=true
+
+    # Set to false to disable the generation of Chaos Islands.
+    B:generateChaosIslands=false
+
+    # Set to false to disable the generation of Ender Comets.
+    B:generateEnderComets=true
+
+    # Add the ID of any mod's dimensions that you don't want Draconium Ore generated in.
+    I:oreGenDimentionBlacklist <
+     >
+
+    # Setting this to false will just completely disable ALL DE world gen!
+    B:worldGenEnabled=true
+}
+
+
+##########################################################################################################
+# |Mod Items/Blocks
+#--------------------------------------------------------------------------------------------------------#
+# These settings allow you to disable Blocks and Items added by this mod.
+# By default disabling a block or item will not remove it completely.
+# But its recipe will be removed and it will be hidden from JEI
+# If you want to completely remove items or blocks you can set hardDisableMode to true.
+# This is not recommended unless you know what you are doing.
+##########################################################################################################
+
+"|Mod Items/Blocks" {
+
+    ##########################################################################################################
+    # Blocks
+    #--------------------------------------------------------------------------------------------------------#
+    # This section allows you to disable/enable blocks from this mod.
+    ##########################################################################################################
+
+    Blocks {
+        B:celestial_manipulator=true
+        B:chaos_crystal=true
+        B:chaos_shard_atmos=true
+        B:crafting_injector=true
+        B:creative_rf_source=true
+        B:dislocator_pedestal=true
+        B:dislocator_receptacle=true
+        B:diss_enchanter=true
+        B:draconic_block=true
+        B:draconic_spawner=true
+        B:draconium_block=true
+        B:draconium_chest=false
+        B:draconium_ore=true
+        B:energy_crystal=true
+        B:energy_infuser=true
+        B:energy_pylon=true
+        B:energy_storage_core=true
+        B:entity_detector=true
+        B:flow_gate=true
+        B:fusion_crafting_core=true
+        B:generator=false
+        B:grinder=false
+        B:infused_obsidian=true
+        B:invis_e_core_block=true
+        B:item_dislocation_inhibitor=true
+        B:particle_generator=true
+        B:placed_item=true
+        B:portal=true
+        B:potentiometer=true
+        B:rain_sensor=true
+        B:reactor_component=true
+        B:reactor_core=true
+    }
+
+    ##########################################################################################################
+    # Items
+    #--------------------------------------------------------------------------------------------------------#
+    # This section allows you to disable/enable items from this mod.
+    ##########################################################################################################
+
+    Items {
+        B:awakened_core=true
+        B:chaos_shard=true
+        B:chaotic_core=true
+        B:creative_exchanger=true
+        B:crystal_binder=true
+        B:debugger=true
+        B:dislocator=true
+        B:dislocator_advanced=true
+        B:dislocator_bound=true
+        B:draconic_axe=true
+        B:draconic_boots=true
+        B:draconic_bow=true
+        B:draconic_chest=true
+        B:draconic_core=true
+        B:draconic_energy_core=true
+        B:draconic_helm=true
+        B:draconic_hoe=true
+        B:draconic_ingot=true
+        B:draconic_legs=true
+        B:draconic_pick=true
+        B:draconic_shovel=true
+        B:draconic_staff_of_power=true
+        B:draconic_sword=true
+        B:draconium_capacitor=true
+        B:draconium_dust=true
+        B:draconium_ingot=true
+        B:dragon_heart=true
+        B:ender_energy_manipulator=true
+        B:info_tablet=true
+        B:magnet=true
+        B:mob_soul=false
+        B:nugget=true
+        B:reactor_part=true
+        B:tool_upgrade=true
+        B:wyvern_axe=true
+        B:wyvern_boots=true
+        B:wyvern_bow=true
+        B:wyvern_chest=true
+        B:wyvern_core=true
+        B:wyvern_energy_core=true
+        B:wyvern_helm=true
+        B:wyvern_legs=true
+        B:wyvern_pick=true
+        B:wyvern_shovel=true
+        B:wyvern_sword=true
+    }
+
+    ##########################################################################################################
+    # Loader Settings
+    #--------------------------------------------------------------------------------------------------------#
+    # These are settings which define what happens when you disable a block or item.
+    ##########################################################################################################
+
+    "Loader Settings" {
+        # If set to true blocks and items will be completely removed from the game when disabled.
+        # When set to softDisableMode they will just have their recipes removed and will not show up in NEI/JEI or the Creative Inventory.
+        # Soft mode is recommended. Only use hard mode if you know what you are doing.
+        B:hardDisableMode=false
+    }
+
+}

config/brandon3055/ProjectIntelligence/manifest.json

@@ -0,0 +1,9 @@
+[
+	{
+		"name": "Draconic Evolution",
+		"modid": "draconicevolution",
+		"downloads": {
+			"https://raw.githubusercontent.com/brandon3055/Project-Intelligence-Docs/master/ModDocs/Draconic%20Evolution/draconicevolution-en_US.xml": 16
+		}
+	}
+]

config/brandon3055/ProjectIntelligence/options.json

@@ -0,0 +1,9 @@
+{
+	"colourNavWindow": "ff3c3f41",
+	"colourContentWindow": "ff3c3f41",
+	"colourMenuBar": "ff3c3f41",
+	"colourNavText": "ffff",
+	"colourText2": "8c8c8c",
+	"editMode": false,
+	"editTarget": "[CONFIG]"
+}

config/brandon3055/ProjectIntelligence/projectintelligence.xml

@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<mod docRevision="0" lang="en_US" modName="pi" modid="PI">
+    <content index="4" type="textArea">Project Intelligence AKA "Project Intel" or "PI" is an ingame documentation mod i am currently building as a part of Draconic Evolution. 
+
+At first this will just be used for Draconic Evolution but once it is complete it will be split off into its own separate mod. 
+
+My goal for this mod is for it to one day have documentation for almost all mods in existence. 
+
+But obviously there is no way one person could handle that much work so i will be leaving it up to the community to document as many mods as possible.
+
+(Project intelligence downloads all of its content (Not including this page) from github. So if this is the only page you see check that you are connected to the internet. You can also check the console for errors.)</content>
+    <content index="3" size="8" type="vSpacer"/>
+    <content index="1" size="4" type="vSpacer"/>
+    <content alignment="CENTER" index="2" shadow="true" size="0" type="heading">Document All The Things!!!!</content>
+    <content alignment="CENTER" index="0" shadow="true" size="2" type="heading">§o§nProject Intelligence</content>
+</mod>

config/brandon3055/contributors.json

@@ -0,0 +1,619 @@
+[
+  {
+    "name": "brandon3055", "ign": "brandon3055", "contribution": "Creator",
+    "details": "Hello! I am the creator of Draconic Evolution and i really hope you are enjoying the mod! The following people have all helped draconic evolution in one way or another and i am eternally grateful for their support! I am also a supporter of the Lolnet Minecraft Community!",
+    "website": "http://www.brandon3055.com/", "contributionLevel": 3
+  }, {
+  "name": "GreatOrator", "ign": "GreatOrator", "contribution": "All the things!!! and now a Patreon",
+  "details": "GreatOrator has been my BIGGEST supporter from day 1! He has helped with everything from feature ideas and textures to to PR and Web design. Draconic Evolution would not be what it is today without him. Thank You GreatOrator! Also a member of the lolnet community!",
+  "website": "http://www.tolkiencraft.com/", "contributionLevel": 3
+}, {
+  "name": "Sn0wShepherd", "ign": "snowshepherd", "contribution": "Texture and Model creator",
+  "details": "Sn0w is responsible fore all of the new 16x textures added in version 1.0.2. As well as all of the new 3D tool and armor models.",
+  "website": "http://www.aleciashepherd.com/", "contributionLevel": 3
+}, {
+  "name": "Hachiseiko", "ign": "Hachiseiko", "contribution": "Texture creator",
+  "details": "Hachiseiko created the original textures for the Draconic Evolution tools and weapons.", "website": "",
+  "contributionLevel": 0
+}, {
+  "name": "Skeletonpunk", "ign": "Skeletonpunk", "contribution": "Model creator",
+  "details": "Skeletonpunk created the original 3D armor models that were in use for a short period before being replaced by models created by Sn0wShepherd. Although they weren't around long i still appreciate the work that went into them.",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "covers1624", "ign": "covers1624", "contribution": "Maintains Code Chicken Lib",
+  "details": "Covers is an awesome guy! He didnt just give me permission to use CCL he actively insisted because its awesome! He also tells me when im doing things wrong and in exchange i am teaching him basic math. Also a member of the lolnet community!",
+  "website": "https://twitter.com/covers1624", "contributionLevel": 3
+}, {
+  "name": "TheMattaBase", "ign": "TheMattaBase", "contribution": "Friend of brandon3055", "details": "[UNLISTED]",
+  "website": "", "contributionLevel": 3
+}, {
+  "name": "Jake_Evans", "ign": "Jake_Evans", "contribution": "", "details": "[UNLISTED]", "website": "",
+  "contributionLevel": 3
+}, {
+  "name": "Gigabit101", "ign": "Gigabit101", "contribution": "Friend of brandon3055",
+  "details": "[UNLISTED] Gigabti404", "website": "", "contributionLevel": 3
+}, {
+  "name": "dezil_nz", "ign": "dezil_nz", "contribution": "One of the founders of the lolnet minecraft comminity!",
+  "details": "[UNLISTED]", "website": "", "contributionLevel": 3
+}, {
+  "name": "LX_Gaming", "ign": "LX_Gaming", "contribution": "Lolnet Staff", "details": "[UNLISTED]", "website": "",
+  "contributionLevel": 3
+}, {
+  "name": "Direwolf20", "ign": "direwolf20", "contribution": "Awesome Person",
+  "details": "Direwolf20's videos are the reason i first started playing modded minecraft soo long ago. This of course eventually lead to me creating Draconic Evolution and all my other mods. So in a way he is responsible for the existance my mods. Thanks Dire!",
+  "website": "https://www.youtube.com/user/direwolf20", "contributionLevel": 3
+}, {
+  "name": "Soaryn", "ign": "Soaryn", "contribution": "Awesome Person",
+  "details": "Soaryn inspires me every day to continue working on my mods and releasing new update by providing a perfect example of what NOT to do! Thanks Soaryn!",
+  "website": "", "contributionLevel": 3
+}, {
+  "name": "Trinity4261", "ign": "Trinity4261", "contribution": "My Brother",
+  "details": "[UNLISTED] He wanted wings so why not? He is my brother after all.", "website": "", "contributionLevel": 3
+},
+{
+  "name": "FoxMcloud5655", "ign": "FoxMcloud5655", "contribution": "Much Help",
+  "details": "Fox is doing great work helping to keep my discord and issue tracker moving smoothly!", "website": "",
+  "contributionLevel": 3
+},
+{
+  "name": "texcubsf", "ign": "texcubsf", "contribution": "Patreon",
+  "details": "robertwsf is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "pxoxd", "ign": "pxoxd", "contribution": "Patreon",
+  "details": "pxoxd is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Antric83", "ign": "Antric83", "contribution": "Patreon",
+  "details": "Antric83 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "FaMatrix", "ign": "FaMatrix", "contribution": "Patreon",
+  "details": "FaMatrix is currently supporting me via Patreon, He is also an Awesome member of Lolnet!",
+  "website": "lolnet.co.nz", "contributionLevel": 1
+}, {
+  "name": "AmberSienna", "ign": "AmberSienna", "contribution": "Patreon",
+  "details": "AmberSienna is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Teraphina", "ign": "Teraphina", "contribution": "Patreon",
+  "details": "Teraphina is currently supporting me via Patreon. Teraphina was also one of the beta testers for Draconic Evolution via Tolkiencraft",
+  "website": "disciplesoftherockministries.org", "contributionLevel": 1
+}, {
+  "name": "Soulrift", "ign": "Soulrift", "contribution": "Patreon",
+  "details": "Soulrift is currently supporting me via Patreon for which i am very grateful!",
+  "website": "https://www.twitch.tv/soulriftx", "contributionLevel": 1
+}, {
+  "name": "Drekryan", "ign": "Drekryan", "contribution": "Patreon",
+  "details": "Drekryan is currently supporting me via Patreon for which i am very grateful!",
+  "website": "http://twitter.com/dreklamb", "contributionLevel": 1
+}, {
+  "name": "xSquibbyx", "ign": "xSquibbyx", "contribution": "Patreon",
+  "details": "xSquibbyx is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "The_Swordsmen", "ign": "The_Swordsmen", "contribution": "Patreon",
+  "details": "The_Swordsmen is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "EricBrian", "ign": "EricBrian", "contribution": "Patreon",
+  "details": "EricBrian is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "ModAPI", "ign": "ModAPI", "contribution": "Patreon",
+  "details": "ModAPI is currently supporting me via Patreon for which i am very grateful!",
+  "website": "https://twitter.com/AmathewsGaming", "contributionLevel": 1
+}, {
+  "name": "Mikepet", "ign": "Mikepet", "contribution": "Patreon",
+  "details": "Mikepet is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Halacon", "ign": "halacon", "contribution": "Patreon",
+  "details": "Halacon is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Nick_J_M", "ign": "Nick_J_M", "contribution": "Patreon",
+  "details": "Nick is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Edward", "ign": "WintrAU", "contribution": "Patreon",
+  "details": "Edward is currently supporting me via Patreon for which i am very grateful! He is also a member of the Lolnet Minecraft community.",
+  "website": "", "contributionLevel": 1
+}, {
+  "name": "Der DracheTV", "ign": "Der1Drache", "contribution": "Patreon",
+  "details": "Der1Drache is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+}, {
+  "name": "WolufHD", "ign": "WolufHD", "contribution": "Patreon",
+  "details": "WolufHD is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Morpheus1101", "ign": "Morpheus1101", "contribution": "Patreon",
+  "details": "Morpheus1101 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Duomaz", "ign": "Duomaz", "contribution": "Patreon",
+  "details": "Duomaz is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Zudakai", "ign": "Zudakai", "contribution": "Patreon",
+  "details": "Zudakai is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Nexus_Chris", "ign": "Nexus_Chris", "contribution": "Patreon",
+  "details": "Nexus_Chris is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Snakemgr12", "ign": "Snakemgr12", "contribution": "Patreon",
+  "details": "Snakemgr12 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Freman_Scum", "ign": "JonathanKish", "contribution": "Patreon",
+  "details": "Freman_Scum is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Mhoku", "ign": "Mhoku_", "contribution": "Patreon",
+  "details": "Mhoku is currently supporting me via Patreon for which i am very grateful!",
+  "website": "https://twitter.com/Mhoku_", "contributionLevel": 1
+}, {
+  "name": "Keith Wagner", "ign": "Om3gagam3r", "contribution": "Patreon",
+  "details": "Keith Wagner is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Aurelio", "ign": "AureIio", "contribution": "Patreon",
+  "details": "Aurelio is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "awk1995", "ign": "awk1995", "contribution": "Patreon",
+  "details": "awk1995 is currently supporting me via Patreon for which i am very grateful!",
+  "website": "https://www.youtube.com/channel/UCqZw7qE3zPgvJY0gDR9Yzxg", "contributionLevel": 1
+}, {
+  "name": "boredi", "ign": "boredi", "contribution": "Patreon",
+  "details": "boredi is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "Jason C", "ign": "DeadHunter", "contribution": "Patreon",
+  "details": "Jason C is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "stjern82", "ign": "stjern82", "contribution": "Patreon",
+  "details": "stjern82 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+}, {
+  "name": "King_Kookie", "ign": "King_Kookie_", "contribution": "Patreon",
+  "details": "King_Kookie is currently supporting me via Patreon for which i am very grateful! Also helped track down an impersonator.",
+  "website": "", "contributionLevel": 3
+}, {
+  "name": "lucid4", "ign": "lucid4", "contribution": "Patreon",
+  "details": "lucid4 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "paddycboy", "ign": "paddycboy", "contribution": "Patreon",
+  "details": "Paddycboy is currently supporting me via Patreon for which i am very grateful!", "website": "twitter.com/spectatorpaddy",
+  "contributionLevel": 1
+ },
+  {
+  "name": "Kris K", "ign": "Krystal_Disc", "contribution": "Patreon",
+  "details": "Kris K is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+  {
+  "name": "Connor Love", "ign": "connorlove9", "contribution": "Patreon",
+  "details": "Connor is currently supporting me via Patreon for which i am very grateful!", "website": "https://www.twitch.tv/connorlove9",
+  "contributionLevel": 1
+ },
+  {
+  "name": "Quarnds", "ign": "Quarnds", "contribution": "Patreon",
+  "details": "Quarnds is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "xtrux", "ign": "xtrux", "contribution": "Patreon",
+  "details": "xtrux is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "Andrew", "ign": "ItzHDGaming", "contribution": "Patreon",
+  "details": "Andrew is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "TanLorik4", "ign": "TanLorik4", "contribution": "Patreon",
+  "details": "[UNLISTED]", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "_apollox_", "ign": "_apollox_", "contribution": "Patreon",
+  "details": "ApolloX is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+ },
+ {
+  "name": "jackkeane98", "ign": "jackkeane98", "contribution": "Patreon",
+  "details": "jackkeane98 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "chaetay", "ign": "chaetay", "contribution": "Patreon",
+  "details": "chaetay is currently supporting me via Patreon for which i am very grateful!", "website": "mc-complex.com",
+  "contributionLevel": 1
+ },
+ {
+  "name": "GoldClassGaming", "ign": "GoldClassGaming", "contribution": "Patreon",
+  "details": "GoldClassGaming is currently supporting me via Patreon for which i am very grateful!", "website": "twitter.com/GCGAndy",
+  "contributionLevel": 1
+ },
+ {
+  "name": "Toon", "ign": "ToonCraTheGod", "contribution": "Patreon",
+  "details": "Toon is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "Merlin (Sean)", "ign": "_Merlin_Book_", "contribution": "Patreon",
+  "details": "Merlin is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "STALlN", "ign": "STALlN", "contribution": "Patreon",
+  "details": "STALlN is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "Elfie", "ign": "elfdafatpizza", "contribution": "Patreon",
+  "details": "Elfie is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ {
+  "name": "muffinman_21", "ign": "muffinman_21", "contribution": "Patreon",
+  "details": "muffinman_21 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+  {
+  "name": "Munchkin", "ign": "AquaKyubey", "contribution": "Patreon",
+  "details": "Munchkin is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+   {
+  "name": "ReignOfFROZE", "ign": "ReignOfFROZE", "contribution": "Patreon",
+  "details": "ReignOfFROZE is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+    {
+  "name": "Jack", "ign": "MistaOmega", "contribution": "Patreon",
+  "details": "Jack is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+ },
+   {
+  "name": "Megaguy444", "ign": "Megaguy444", "contribution": "Contributor",
+  "details": "Megaguy444 helped me identify a credit card scammer! Thanks mega!", "website": "",
+  "contributionLevel": 1
+ },
+   {
+  "name": "TheIcicle", "ign": "TheIcicle", "contribution": "Patreon",
+  "details": "TheIcicle is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+    {
+  "name": "DannySnowPaw", "ign": "DannySnowPaw", "contribution": "Patreon",
+  "details": "DannySnowPaw is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+    {
+  "name": "Einhornyordle", "ign": "Einhornyordle", "contribution": "Patreon",
+  "details": "Einhornyordle is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+     {
+  "name": "SK0R3N", "ign": "SK0R3N", "contribution": "Patreon",
+  "details": "SK0R3N is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+ },
+      {
+  "name": "Allekks", "ign": "allekksNOR", "contribution": "Patreon",
+  "details": "Allekks is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+       {
+  "name": "ShiaLaBeef", "ign": "Shia_La_Beef", "contribution": "Patreon",
+  "details": "ShiaLaBeef is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+ },
+        {
+  "name": "Shotguun29", "ign": "Shotguun29", "contribution": "Patreon",
+  "details": "Shotguun29 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+         {
+  "name": "ImAlexHimSelf", "ign": "ImAlexHimSelf", "contribution": "Patreon",
+  "details": "ImAlexHimSelf is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+          {
+  "name": "Stunnahh", "ign": "Stunnahh", "contribution": "Patreon",
+  "details": "Stunnahh is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+           {
+  "name": "Deltora101", "ign": "DELTORA101", "contribution": "Patreon",
+  "details": "Deltora101 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+             {
+  "name": "Dayrim", "ign": "Dayrim", "contribution": "Patreon",
+  "details": "Dayrim is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 0
+ },
+ {
+  "name": "slaider221", "ign": "slaider221", "contribution": "Patreon",
+  "details": "slaider221 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+             {
+  "name": "DreamyPaw", "ign": "DreamyPaw", "contribution": "Patreon",
+  "details": "DreamyPaw is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+              {
+  "name": "sharkck", "ign": "sharkck", "contribution": "Patreon",
+  "details": "sharkck is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+              {
+  "name": "Zorlander", "ign": "Zorlander", "contribution": "Patreon",
+  "details": "Zorlander is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+               {
+  "name": "Link19658", "ign": "Link19658", "contribution": "Patreon",
+  "details": "Link19658 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+                {
+  "name": "Tetsu502", "ign": "ShuckleGuardian", "contribution": "Patreon",
+  "details": "Tetsu502 is currently supporting me via Patreon for which i am very grateful!", "website": "",
+  "contributionLevel": 1
+ },
+ 
+ 
+ {
+  "name": "OneEyeMaker", "ign": "OneEyeMaker", "contribution": "Code Contributor",
+  "details": "OneEyeMaker is responsible for the config overhall in 1.0.2f", "website": "", "contributionLevel": 1
+}, {
+  "name": "KWPUGH", "ign": "KWPUGH", "contribution": "Donator",
+  "details": "I would just like to say thankyou to KWPUGH for supporting the development of Draconic Evolution.",
+  "website": "", "contributionLevel": 1
+}, {
+  "name": "Straymaverick", "ign": "Straymaverick", "contribution": "Cool streamer guy!!",
+  "details": "[UNLISTED]", "website": "", "contributionLevel": 3
+}, {
+  "name": "mikhaila666", "ign": "mikhaila666", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 2
+}, {
+  "name": "Rustynator", "ign": "Rustynator", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "SalTDS", "ign": "SalTDS", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "uradox", "ign": "uradox", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Rohdon", "ign": "Rohdon", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "ArcaneAscension", "ign": "ArcaneAscension", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "soul_lighter", "ign": "soul_lighter", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Haigen", "ign": "Haigen", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "modulateddreams", "ign": "modulateddreams", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "ChickenMobile", "ign": "ChickenMobile", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Handyman_Sam", "ign": "Handyman_Sam", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "jarakii4", "ign": "jarakii4", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "kristyellen", "ign": "kristyellen", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "willo33", "ign": "willo33", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "123zane321", "ign": "123zane321", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "CrowbarJr", "ign": "CrowbarJr", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Fluro_", "ign": "Fluro_", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "OnyxSentinel04", "ign": "OnyxSentinel04", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "raider_880", "ign": "raider_880", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "deamonbite", "ign": "deamonbite", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Skittzman", "ign": "Skittzman", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Skittzman", "ign": "Skittzman", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Willo33", "ign": "Willo33", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2017 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "44shades44", "ign": "44shades44", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Dr_Teath", "ign": "Dr_Teath", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "fwb2700", "ign": "fwb2700", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "rhodesy523", "ign": "rhodesy523", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Waylandor", "ign": "Waylandor", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "alizdor", "ign": "alizdor", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "yampertx", "ign": "yampertx", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "raider880", "ign": "raider880", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Glitchunter", "ign": "Glitchunter", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "MuadDib912", "ign": "MuadDib912", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Oztin", "ign": "Oztin", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Sarkazo", "ign": "Sarkazo", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "MJW87", "ign": "MJW87", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Dobsonium", "ign": "Dobsonium", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "chocofish31", "ign": "chocofish31", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Dingasm", "ign": "Dingasm", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Microjet", "ign": "Microjet", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "scurry21", "ign": "scurry21", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "anarki99nz", "ign": "anarki99nz", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Cluracan", "ign": "Cluracan", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Deathnz1", "ign": "Deathnz1", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Ae0lian", "ign": "Ae0lian", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Death4999901", "ign": "Death4999901", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "Igneel32", "ign": "Igneel32", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 1
+}, {
+  "name": "StabbyInc", "ign": "StabbyInc", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 0
+}, {
+  "name": "xElementzx", "ign": "xElementzx", "contribution": "lolnet Badge Enabled",
+  "details": "[UNLISTED] This user contributed to Lolnet during the 2018 donation drive. Lolnet is a large Minecraft community that i support. Check them out at lolnet.co.nz",
+  "website": "", "contributionLevel": 1
+}, {
+ "name": "Troopy_", "ign": "Troopy_", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 0
+}, {
+ "name": "Haigen", "ign": "Haigen", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+},
+
+{
+ "name": "Hawkizedyus", "ign": "Hawkizedyus", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}, {
+ "name": "uradox", "ign": "uradox", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}, {
+ "name": "anarki99nz", "ign": "anarki99nz", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}, {
+ "name": "Jackster819", "ign": "Jackster819", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}, {
+ "name": "Sarkazo", "ign": "Sarkazo", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}, {
+ "name": "Dr_Teath", "ign": "Dr_Teath", "contribution": "lolnet Badge Enabled",
+ "details": "[UNLISTED] This user contributed to Creation Reborn during the 2019 donation drive. Creation Reborn is a large Minecraft community that i support. Check them out at creationreborn.net",
+ "website": "", "contributionLevel": 1
+}
+]

config/ceramics.cfg

@@ -0,0 +1,64 @@
+# Configuration file
+
+~CONFIG_VERSION: 0.1
+
+barrel {
+    # Storage capacity for clay barrels in buckets. This determines the base and the amount each extension adds. Changing this will require breaking and replacing the barrel to update. [range: 1 ~ 100, default: 4]
+    I:capacityClay=4
+
+    # Storage capacity for porcelain barrels in buckets. This determines the base and the amount each extension adds. Changing this will require breaking and replacing the barrel to update. [range: 1 ~ 100, default: 6]
+    I:capacityPorcelain=6
+}
+
+
+bucket {
+    # If true, the clay bucket can hold hot fluids and breaks when emptying. If false they cannot be picked up at all [default: true]
+    B:hotFluids=true
+
+    # Allows the unfired clay bucket to be placed in the world, for the sake of block based kilns. Normal clay buckets remain unplaceable [default: false]
+    B:placeClayBucket=false
+
+    # Allows the clay bucket to pick up sand and gravel, because why not? [default: true]
+    B:sand=true
+}
+
+
+enabled {
+    # Enables the clay armor, an early game alternative to leather [default: true]
+    B:armor=true
+
+    # Enables the clay barrel, a liquid tank that can be expanded upwards [default: true]
+    B:barrel=true
+
+    # Enables walls made of vanilla bricks. Mainly here if another mod provides this feature (e.g. Quark) [default: true]
+    B:brickWall=true
+
+    # Enables the clay bucket, an alternative to the iron bucket that breaks from hot liquids [default: true]
+    B:bucket=true
+
+    # Enables four additional decorative bricks [default: true]
+    B:fancyBricks=true
+
+    # Enables porcelain, a whiter clay that produces true colors when dyed [default: true]
+    B:porcelain=true
+
+    # Enables faucets and channels for moving fluids. If porcelain is not enabled, they will be made from normal clay instead of porcelain. [default: true]
+    B:porcelainFaucet=true
+
+    # Enables clay bricks and blocks with a rainbow animation. Includes brick slabs, stairs, and walls. [default: true]
+    B:rainbowClay=true
+
+    # Allows you to create armor out of clay directly which has one durability and terriable protection. [default: true]
+    B:rawClayArmorEnabled=true
+
+    # Enables the clay shears, faster than iron shears but less duribility [default: true]
+    B:shears=true
+}
+
+
+porcelain {
+    # Pulls recipes from the oredict for smelting porcelain bricks. If disabled just adds one static recipe using ceramics porcelain [default: true]
+    B:oredictSmelting=true
+}
+
+

config/ceu.cfg

@@ -0,0 +1,195 @@
+# Configuration file
+
+general {
+    S:circuitsUsing=
+
+    # True if you want CEU & CEF to accept batteries with same voltage as CEU/CEF's. False if you want CEU & CEF to accept any tier of batteries.
+    B:exactVoltage=false
+
+    ceu {
+
+        ulv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        iv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        luv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        zpm {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        uv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+    }
+
+    cef {
+
+        ulv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        iv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        luv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        zpm {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        uv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+    }
+
+    iceu {
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+    }
+
+    icef {
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=true
+        }
+
+    }
+
+    infinite_energy_emitter {
+        B:disableFEEmitter=false
+        B:disableGTEUEmitter=false
+        B:disableIC2EUEmitter=true
+    }
+
+    infinite_energy_receiver {
+        B:disableFEReceiver=false
+        B:disableGTEUReceiver=false
+        B:disableIC2EUReceiver=true
+    }
+
+}
+
+

config/chesttransporter.cfg

@@ -0,0 +1,44 @@
+# Configuration file
+
+general {
+    # Set to false to disable the hunger debuff [default: true]
+    B:debuffHunger=true
+
+    # Set to false to disable the jump debuff [default: true]
+    B:debuffJump=true
+
+    # Set to false to disable the mining fatigue debuff [default: true]
+    B:debuffMiningFatigue=true
+
+    # Set to false to disable the slowness debuff [default: true]
+    B:debuffSlowness=true
+
+    # Set this to false to prevent picking up of mob spawners [default: true]
+    B:pickupSpawners=true
+
+    # Set this to false to prevent the copper transporter to pick up mob spawners [default: true]
+    B:spawnerWithCopper=true
+
+    # Set this to false to prevent the diamond transporter to pick up mob spawners [default: true]
+    B:spawnerWithDiamond=true
+
+    # Set this to false to prevent the gold transporter to pick up mob spawners [default: true]
+    B:spawnerWithGold=true
+
+    # Set this to false to prevent the iron transporter to pick up mob spawners [default: true]
+    B:spawnerWithIron=true
+
+    # Set this to false to prevent the obsidian transporter to pick up mob spawners [default: true]
+    B:spawnerWithObsidian=true
+
+    # Set this to false to prevent the silver transporter to pick up mob spawners [default: true]
+    B:spawnerWithSilver=true
+
+    # Set this to false to prevent the tin transporter to pick up mob spawners [default: true]
+    B:spawnerWithTin=true
+
+    # Set this to false to prevent the wood transporter to pick up mob spawners [default: true]
+    B:spawnerWithWood=true
+}
+
+

config/chisel.cfg

@@ -0,0 +1,172 @@
+# Configuration file
+
+autochisel {
+    # If true, the auto chisel will not function at all without power.
+    B:autoChiselNeedsPower=false
+
+    # If false, the auto chisel will always run at full speed, and will not accept FE.
+    B:autoChiselTakesPower=true
+}
+
+
+chisel {
+    # Should the chisel be damageable and take damage when it chisels something.
+    B:allowChiselDamage=false
+
+    # The extra attack damage points (in half hearts) that the diamond chisel inflicts when it is used to attack an entity.
+    I:diamondChiselAttackDamage=3
+
+    # The max damage of the diamond chisel. [range: 1 ~ 32767, default: 5056]
+    I:diamondChiselMaxDamage=5056
+
+    # The extra attack damage points (in half hearts) that the iChisel inflicts when it is used to attack an entity.
+    I:hitechChiselAttackDamage=3
+
+    # The max damage of the iChisel. [range: 1 ~ 32767, default: 10048]
+    I:hitechChiselMaxDamage=10048
+
+    # The extra attack damage points (in half hearts) that the iron chisel inflicts when it is used to attack an entity.
+    I:ironChiselAttackDamage=2
+
+    # If this is true, the iron chisel can left click chisel blocks. If false, it cannot.
+    B:ironChiselCanLeftClick=true
+
+    # If this is true, the iron chisel can change its chisel mode just as the diamond chisel can.
+    B:ironChiselHasModes=false
+
+    # The max damage of the standard iron chisel. [range: 1 ~ 32767, default: 512]
+    I:ironChiselMaxDamage=512
+}
+
+
+client {
+    # Use old pillar textures
+    B:pillarOldGraphics=false
+
+    # Make variations of blocks have the same name, and use the description in tooltip to distinguish them.
+    B:tooltipsUseBlockDescriptions=true
+}
+
+
+features {
+    B:aluminum=true
+    B:andesite=true
+    B:antiblock=true
+    B:arcaneStone=true
+    B:autochisel=true
+    B:basalt=true
+    B:bloodMagic=true
+    B:bookshelf=true
+    B:bricks=true
+    B:bronze=true
+    B:brownstone=true
+    B:carpet=true
+    B:certus=true
+    B:charcoal=true
+    B:chisel=true
+    B:cloud=true
+    B:coal=true
+    B:coalCoke=true
+    B:cobalt=true
+    B:cobblestone=true
+    B:cobblestonemossy=true
+    B:concrete=true
+    B:copper=true
+    B:diamond=true
+    B:diorite=true
+    B:dirt=true
+    B:electrum=true
+    B:emerald=true
+    B:endPurpur=true
+    B:endstone=true
+    B:factory=true
+    B:futura=true
+    B:glass=true
+    B:glassdyed=true
+    B:glowstone=true
+    B:gold=true
+    B:granite=true
+    B:hardenedClay=true
+    B:ice=true
+    B:invar=true
+    B:iron=true
+    B:ironpane=true
+    B:laboratory=true
+    B:lapis=true
+    B:lavastone=true
+    B:lead=true
+    B:limestone=true
+    B:marble=true
+    B:marblepillar=true
+    B:netherbrick=true
+    B:netherrack=true
+    B:nickel=true
+    B:obsidian=true
+    B:paper=true
+    B:planks=true
+    B:platinum=true
+    B:prismarine=true
+    B:quartz=true
+    B:redstone=true
+    B:sandstone=true
+    B:sandstoneRed=true
+    B:sandstoneScribbles=true
+    B:sandstoneredScribbles=true
+    B:silver=true
+    B:steel=true
+    B:stonebrick=true
+    B:technical=true
+    B:temple=true
+    B:tin=true
+    B:tyrian=true
+    B:uranium=true
+    B:valentines=true
+    B:voidstone=true
+    B:waterstone=true
+    B:wool=true
+}
+
+
+general {
+    # If true, you can chisel stone brick to mossy stone brick.
+    B:allowBrickToMossyInChisel=true
+    I:amountYouGetFromFactoryBlockCrafting=32
+
+    # Use alternative crafting recipe for the chisel
+    B:chiselAlternateRecipe=false
+
+    # If this is true, you can chisel from the chisel leaves back to vanilla ones. If it is false, you cannot.
+    B:chiselBackToVanillaLeaves=false
+
+    # Allow stone to be chiseled to/from stone bricks.
+    B:chiselStoneToStoneBricks=true
+
+    # The factor that concrete_white increases your velocity. Default is 1.35, set to 1 for no change.
+    D:concreteVelocityMult=1.35
+}
+
+
+worldgen {
+    # Amount of limestone to generate in the world; use 0 for none [range: 0 ~ 30, default: 18]
+    I:limestoneAmount=0
+
+    # Amount of marble to generate in the world; use 0 for none [range: 0 ~ 30, default: 20]
+    I:marbleAmount=0
+
+    basalt {
+        # Thickness of the basalt at the bottom of lava lakes. 0 for none. [range: 0 ~ 5, default: 3]
+        I:bottomThickness=3
+
+        # Thickness of the basalt around the sides of lava lakes. 0 for none. [range: 0 ~ 5, default: 1]
+        I:sideThickness=1
+
+        # True to generate basalt only around lava lakes. False to do standard vein generation. [default: true]
+        B:specialGen=true
+
+        # Amount of basalt to generate in the world if not using special generation. Has no effect if basaltSpecialGen is true. Use 0 for none [range: 0 ~ 30, default: 15]
+        I:veinAmount=15
+    }
+
+}
+
+

config/clearwater.cfg

@@ -0,0 +1,21 @@
+# Configuration file
+
+general {
+    # Enables modifications of fog under lava
+    B:enableLava=true
+
+    # Enables modifications of fog under water
+    B:enableWater=true
+
+    # Value for fog density (0-5) Vanilla is 2.0
+    # Min: 0.0
+    # Max: 5.0
+    D:fogDensityLava=0.20000000298023224
+
+    # Value for fog density (0-5) Vanilla is 0.1
+    # Min: 0.0
+    # Max: 5.0
+    D:fogDensityWater=0.0
+}
+
+

config/clienttweaks.cfg

@@ -0,0 +1,73 @@
+# Configuration file
+
+general {
+    # Items that will not prevent offhand-torch placement while in offhand, but do not place torches by themselves [default: [tconstruct:shovel], [tconstruct:excavator]]
+    S:"Offhand Torch Tools" <
+        tconstruct:shovel
+        tconstruct:excavator
+     >
+
+    # Items that count as torches for the offhand-torch tweak options. [default: [minecraft:torch], [tconstruct:stone_torch]]
+    S:"Torch Items" <
+        minecraft:torch
+        tconstruct:stone_torch
+     >
+
+    # Items that will place torches from your hotbar on right-click if enabled. [default: [minecraft:wooden_pickaxe], [minecraft:stone_pickaxe], [minecraft:iron_pickaxe], [minecraft:golden_pickaxe], [minecraft:diamond_pickaxe], [tconstruct:pickaxe], [tconstruct:hammer]]
+    S:"Torch Tools" <
+        minecraft:wooden_pickaxe
+        minecraft:stone_pickaxe
+        minecraft:iron_pickaxe
+        minecraft:golden_pickaxe
+        minecraft:diamond_pickaxe
+        tconstruct:pickaxe
+        tconstruct:hammer
+     >
+}
+
+
+tweaks {
+    # This option will let you climb ladders automatically by just looking upwards, rather than requiring a key to be held down. [default: false]
+    B:"Auto-Climb Ladder"=false
+
+    # Disables the 3d Anaglyph button so you don't accidentally click it and cause a whole resource pack reload. [default: true]
+    B:"Disable 3D Anaglyph"=true
+
+    # This option forces auto jump to be disabled and also disables the button for it. Because it should never have been a thing. [default: false]
+    B:"Disable Auto Jump"=false
+
+    # This option disables the shifting of the inventory to the right when potion effects are active. [default: true]
+    B:"Disable Potion Shift"=true
+
+    # This option will disable step assist added by other mods. [default: false]
+    B:"Disable Step Assist"=false
+
+    # This prevents the last torch in the offhand from being placed. [default: false]
+    B:"Do Not Use Last Torch"=false
+
+    # This option will hide your offhand item. It can be toggled via an optional keybind.
+    B:"Hide Offhand Item"=false
+
+    # This option will hide your own potion particle effects for your client (other players will still see them). [default: false]
+    B:"Hide Own Particle Effects"=false
+
+    # This option will hide your shield unless you are holding a weapon. [default: true]
+    B:"Hide Shield Unless Holding Weapon"=false
+
+    # This adds back the master volume slider to the options screen. Saves you a click! [default: true]
+    B:"Master Volume Slider"=true
+
+    # This prevents torches from being placed from your offhand if you have a block in your main hand. [default: true]
+    B:"No Offhand Torch With Block"=true
+
+    # This prevents torches from being placed from your off hand if you have an empty main hand. [default: false]
+    B:"No Offhand Torch With Empty Hand"=false
+
+    # This restricts torches to be placed from the offhand only when you're holding a tool in your main hand. [default: false]
+    B:"Offhand Torch With Tool Only"=false
+
+    # This strips the underline formatting from chat because it looks terrible. [default: true]
+    B:"Remove Underlines From Chat"=true
+}
+
+

config/codechicken/supporters.json

@@ -0,0 +1,45 @@
+[
+	{
+		"mod" : "EnderStorage",
+		"supporters": [
+			"Blkdragon112"
+		]
+	},
+	{
+		"mod" : "ChickenChunks",
+		"supporters": [
+		]
+	},
+	{
+		"mod" : "NotEnoughItems",
+		"supporters": [
+			"EmuCraft Team",
+			"Victor Zimmer",
+			"lexi85",
+			"Ace_Trainer_Tullius",
+			"Bacon_Donut",
+			"Sleement",
+			"Ninja 5tyl3",
+			"Disalot",
+			"Gamer2313",
+			"Majorangejuice"
+		]
+	},
+	{
+		"mod" : "WR-CBE",
+		"supporters" : [
+			"Vizerei"
+		]
+	},
+	{
+		"mod" : "Translocators",
+		"supporters": [
+		]
+	}, 
+	{
+		"mod" : "ProjectRed",
+		"supporters" : [
+			"Jacob M"
+		]
+	}
+]

config/codechicken/supporters.marker

@@ -0,0 +1 @@
+1545581793041